');
Modal._increment++;
Modal._count++;
this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
this.setupEventHandlers();
}
_createClass(Modal, [{
key: 'getInstance',
/**
* Get Instance
*/
value: function getInstance() {
return this;
}
/**
* Teardown component
*/
}, {
key: 'destroy',
value: function destroy() {
this.removeEventHandlers();
this.$el[0].removeAttribute('style');
if (!!this.$overlay[0].parentNode) {
this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
}
this.$el[0].M_Modal = undefined;
Modal._count--;
}
/**
* Setup Event Handlers
*/
}, {
key: 'setupEventHandlers',
value: function setupEventHandlers() {
this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
if (Modal._count === 1) {
document.body.addEventListener('click', this.handleTriggerClick);
}
this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
}
/**
* Remove Event Handlers
*/
}, {
key: 'removeEventHandlers',
value: function removeEventHandlers() {
if (Modal._count === 0) {
document.body.removeEventListener('click', this.handleTriggerClick);
}
this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
}
/**
* Handle Trigger Click
* @param {Event} e
*/
}, {
key: 'handleTriggerClick',
value: function handleTriggerClick(e) {
var $trigger = $(e.target).closest('.modal-trigger');
if (e.target && $trigger.length) {
var modalId = $trigger[0].getAttribute('href');
if (modalId) {
modalId = modalId.slice(1);
} else {
modalId = $trigger[0].getAttribute('data-target');
}
var modalInstance = document.getElementById(modalId).M_Modal;
if (modalInstance) {
modalInstance.open($trigger);
}
e.preventDefault();
}
}
/**
* Handle Overlay Click
*/
}, {
key: 'handleOverlayClick',
value: function handleOverlayClick() {
if (this.options.dismissible) {
this.close();
}
}
/**
* Handle Modal Close Click
* @param {Event} e
*/
}, {
key: 'handleModalCloseClick',
value: function handleModalCloseClick(e) {
var $closeTrigger = $(e.target).closest('.modal-close');
if (e.target && $closeTrigger.length) {
this.close();
}
}
/**
* Handle Keydown
* @param {Event} e
*/
}, {
key: 'handleKeydown',
value: function handleKeydown(e) {
// ESC key
if (e.keyCode === 27 && this.options.dismissible) {
this.close();
}
}
/**
* Animate in modal
*/
}, {
key: 'animateIn',
value: function animateIn() {
var _this = this;
// Set initial styles
$.extend(this.$el[0].style, {
display: 'block',
opacity: 0
});
$.extend(this.$overlay[0].style, {
display: 'block',
opacity: 0
});
// Animate overlay
Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
// Define modal animation options
var enterVelocityOptions = {
duration: this.options.inDuration,
queue: false,
ease: 'easeOutCubic',
// Handle modal ready callback
complete: function () {
if (typeof _this.options.ready === 'function') {
_this.options.ready.call(_this, _this.$el, _this.openingTrigger);
}
}
};
// Bottom sheet animation
if (this.$el[0].classList.contains('bottom-sheet')) {
Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
// Normal modal animation
} else {
Vel.hook(this.$el[0], 'scaleX', 0.7);
this.$el[0].style.top = this.options.startingTop;
Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
}
}
/**
* Animate out modal
*/
}, {
key: 'animateOut',
value: function animateOut() {
var _this2 = this;
// Animate overlay
Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
// Define modal animation options
var exitVelocityOptions = {
duration: this.options.outDuration,
queue: false,
ease: 'easeOutCubic',
// Handle modal ready callback
complete: function () {
_this2.$el[0].style.display = 'none';
// Call complete callback
if (typeof _this2.options.complete === 'function') {
_this2.options.complete.call(_this2, _this2.$el);
}
_this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
}
};
// Bottom sheet animation
if (this.$el[0].classList.contains('bottom-sheet')) {
Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
// Normal modal animation
} else {
Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
}
}
/**
* Open Modal
* @param {jQuery} [$trigger]
*/
}, {
key: 'open',
value: function open($trigger) {
if (this.isOpen) {
return;
}
this.isOpen = true;
var body = document.body;
body.style.overflow = 'hidden';
this.$el[0].classList.add('open');
body.appendChild(this.$overlay[0]);
// Set opening trigger, undefined indicates modal was opened by javascript
this.openingTrigger = !!$trigger ? $trigger : undefined;
if (this.options.dismissible) {
this.handleKeydownBound = this.handleKeydown.bind(this);
document.addEventListener('keydown', this.handleKeydownBound);
}
this.animateIn();
return this;
}
/**
* Close Modal
*/
}, {
key: 'close',
value: function close() {
if (!this.isOpen) {
return;
}
this.isOpen = false;
this.$el[0].classList.remove('open');
document.body.style.overflow = '';
if (this.options.dismissible) {
document.removeEventListener('keydown', this.handleKeydownBound);
}
this.animateOut();
return this;
}
}], [{
key: 'init',
value: function init($els, options) {
var arr = [];
$els.each(function () {
arr.push(new Modal($(this), options));
});
return arr;
}
}, {
key: 'defaults',
get: function () {
return _defaults;
}
}]);
return Modal;
}();
/**
* @static
* @memberof Modal
*/
Modal._increment = 0;
/**
* @static
* @memberof Modal
*/
Modal._count = 0;
Materialize.Modal = Modal;
$.fn.modal = function (methodOrOptions) {
// Call plugin method if valid method name is passed in
if (Modal.prototype[methodOrOptions]) {
// Getter methods
if (methodOrOptions.slice(0, 3) === 'get') {
return this.first()[0].M_Modal[methodOrOptions]();
// Void methods
} else {
return this.each(function () {
this.M_Modal[methodOrOptions]();
});
}
// Initialize plugin if options or no argument is passed in
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
Modal.init(this, arguments[0]);
return this;
// Return error if an unrecognized method name is passed in
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
}
};
})(jQuery, Materialize.Vel);
;(function ($) {
$.fn.materialbox = function () {
return this.each(function () {
if ($(this).hasClass('initialized')) {
return;
}
$(this).addClass('initialized');
var overlayActive = false;
var doneAnimating = true;
var inDuration = 275;
var outDuration = 200;
var origin = $(this);
var placeholder = $('').addClass('material-placeholder');
var originalWidth = 0;
var originalHeight = 0;
var ancestorsChanged;
var ancestor;
var originInlineStyles = origin.attr('style');
origin.wrap(placeholder);
// Start click handler
origin.on('click', function () {
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.width();
var originalHeight = origin.height();
// If already modal, return to original
if (doneAnimating === false) {
returnToOriginal();
return false;
} else if (overlayActive && doneAnimating === true) {
returnToOriginal();
return false;
}
// Set states
doneAnimating = false;
origin.addClass('active');
overlayActive = true;
// Set positioning for placeholder
placeholder.css({
width: placeholder[0].getBoundingClientRect().width,
height: placeholder[0].getBoundingClientRect().height,
position: 'relative',
top: 0,
left: 0
});
// Find ancestor with overflow: hidden; and remove it
ancestorsChanged = undefined;
ancestor = placeholder[0].parentNode;
var count = 0;
while (ancestor !== null && !$(ancestor).is(document)) {
var curr = $(ancestor);
if (curr.css('overflow') !== 'visible') {
curr.css('overflow', 'visible');
if (ancestorsChanged === undefined) {
ancestorsChanged = curr;
} else {
ancestorsChanged = ancestorsChanged.add(curr);
}
}
ancestor = ancestor.parentNode;
}
// Set css on origin
origin.css({
position: 'absolute',
'z-index': 1000,
'will-change': 'left, top, width, height'
}).data('width', originalWidth).data('height', originalHeight);
// Add overlay
var overlay = $('').css({
opacity: 0
}).click(function () {
if (doneAnimating === true) returnToOriginal();
});
// Put before in origin image to preserve z-index layering.
origin.before(overlay);
// Set dimensions if needed
var overlayOffset = overlay[0].getBoundingClientRect();
overlay.css({
width: windowWidth,
height: windowHeight,
left: -1 * overlayOffset.left,
top: -1 * overlayOffset.top
});
// Animate Overlay
overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
// Add and animate caption if it exists
if (origin.data('caption') !== "") {
var $photo_caption = $('');
$photo_caption.text(origin.data('caption'));
$('body').append($photo_caption);
$photo_caption.css({ "display": "inline" });
$photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
}
// Resize Image
var ratio = 0;
var widthPercent = originalWidth / windowWidth;
var heightPercent = originalHeight / windowHeight;
var newWidth = 0;
var newHeight = 0;
if (widthPercent > heightPercent) {
ratio = originalHeight / originalWidth;
newWidth = windowWidth * 0.9;
newHeight = windowWidth * 0.9 * ratio;
} else {
ratio = originalWidth / originalHeight;
newWidth = windowHeight * 0.9 * ratio;
newHeight = windowHeight * 0.9;
}
// Animate image + set z-index
if (origin.hasClass('responsive-img')) {
origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
complete: function () {
origin.css({ left: 0, top: 0 }).velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
});
} // End Complete
}); // End Velocity
} else {
origin.css('left', 0).css('top', 0).velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
}); // End Velocity
}
// Handle Exit triggers
$(window).on('scroll.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(window).on('resize.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(document).on('keyup.materialbox', function (e) {
// ESC key
if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
returnToOriginal();
}
});
}); // End click handler
// This function returns the modaled image to the original spot
function returnToOriginal() {
doneAnimating = false;
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.data('width');
var originalHeight = origin.data('height');
origin.velocity("stop", true);
$('#materialbox-overlay').velocity("stop", true);
$('.materialbox-caption').velocity("stop", true);
// disable exit handlers
$(window).off('scroll.materialbox');
$(document).off('keyup.materialbox');
$(window).off('resize.materialbox');
$('#materialbox-overlay').velocity({ opacity: 0 }, {
duration: outDuration, // Delay prevents animation overlapping
queue: false, easing: 'easeOutQuad',
complete: function () {
// Remove Overlay
overlayActive = false;
$(this).remove();
}
});
// Resize Image
origin.velocity({
width: originalWidth,
height: originalHeight,
left: 0,
top: 0
}, {
duration: outDuration,
queue: false, easing: 'easeOutQuad',
complete: function () {
placeholder.css({
height: '',
width: '',
position: '',
top: '',
left: ''
});
origin.removeAttr('style');
origin.attr('style', originInlineStyles);
// Remove class
origin.removeClass('active');
doneAnimating = true;
// Remove overflow overrides on ancestors
if (ancestorsChanged) {
ancestorsChanged.css('overflow', '');
}
}
});
// Remove Caption + reset css settings on image
$('.materialbox-caption').velocity({ opacity: 0 }, {
duration: outDuration, // Delay prevents animation overlapping
queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
}
});
};
$(document).ready(function () {
$('.materialboxed').materialbox();
});
})(jQuery);
;(function ($) {
$.fn.parallax = function () {
var window_width = $(window).width();
// Parallax Scripts
return this.each(function (i) {
var $this = $(this);
$this.addClass('parallax');
function updateParallax(initial) {
var container_height;
if (window_width < 601) {
container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
} else {
container_height = $this.height() > 0 ? $this.height() : 500;
}
var $img = $this.children("img").first();
var img_height = $img.height();
var parallax_dist = img_height - container_height;
var bottom = $this.offset().top + container_height;
var top = $this.offset().top;
var scrollTop = $(window).scrollTop();
var windowHeight = window.innerHeight;
var windowBottom = scrollTop + windowHeight;
var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
var parallax = Math.round(parallax_dist * percentScrolled);
if (initial) {
$img.css('display', 'block');
}
if (bottom > scrollTop && top < scrollTop + windowHeight) {
$img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
}
}
// Wait for image load
$this.children("img").one("load", function () {
updateParallax(true);
}).each(function () {
if (this.complete) $(this).trigger("load");
});
$(window).scroll(function () {
window_width = $(window).width();
updateParallax(false);
});
$(window).resize(function () {
window_width = $(window).width();
updateParallax(false);
});
});
};
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
onShow: null,
swipeable: false,
responsiveThreshold: Infinity // breakpoint for swipeable
};
options = $.extend(defaults, options);
var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var uniqueNamespace = namespace + i;
// For each set of tabs, we want to keep track of
// which tab is active and its associated content
var $this = $(this),
window_width = $(window).width();
var $active,
$content,
$links = $this.find('li.tab a'),
$tabs_width = $this.width(),
$tabs_content = $(),
$tabs_wrapper,
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
$indicator,
index = 0,
prev_index = 0,
clicked = false,
clickedTimeout,
transition = 300;
// Finds right attribute for indicator based on active tab.
// el: jQuery Object
var calcRightPos = function (el) {
return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
};
// Finds left attribute for indicator based on active tab.
// el: jQuery Object
var calcLeftPos = function (el) {
return Math.floor(el.position().left + $this.scrollLeft());
};
// Animates Indicator to active tab.
// prev_index: Number
var animateIndicator = function (prev_index) {
if (index - prev_index >= 0) {
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
} else {
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
}
};
// Change swipeable according to responsive threshold
if (options.swipeable) {
if (window_width > options.responsiveThreshold) {
options.swipeable = false;
}
}
// If the location.hash matches one of the links, use that as the active tab.
$active = $($links.filter('[href="' + location.hash + '"]'));
// If no match is found, use the first link or any with class 'active' as the initial active tab.
if ($active.length === 0) {
$active = $(this).find('li.tab a.active').first();
}
if ($active.length === 0) {
$active = $(this).find('li.tab a').first();
}
$active.addClass('active');
index = $links.index($active);
if (index < 0) {
index = 0;
}
if ($active[0] !== undefined) {
$content = $($active[0].hash);
$content.addClass('active');
}
// append indicator then set indicator width to tab width
if (!$this.find('.indicator').length) {
$this.append('');
}
$indicator = $this.find('.indicator');
// we make sure that the indicator is at the end of the tabs
$this.append($indicator);
if ($this.is(":visible")) {
// $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
// $indicator.css({"left": index * $tab_width});
setTimeout(function () {
$indicator.css({ "right": calcRightPos($active) });
$indicator.css({ "left": calcLeftPos($active) });
}, 0);
}
$(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
if (index < 0) {
index = 0;
}
if ($tab_width !== 0 && $tabs_width !== 0) {
$indicator.css({ "right": calcRightPos($active) });
$indicator.css({ "left": calcLeftPos($active) });
}
});
// Initialize Tabs Content.
if (options.swipeable) {
// TODO: Duplicate calls with swipeable? handle multiple div wrapping.
$links.each(function () {
var $curr_content = $(Materialize.escapeHash(this.hash));
$curr_content.addClass('carousel-item');
$tabs_content = $tabs_content.add($curr_content);
});
$tabs_wrapper = $tabs_content.wrapAll('');
$tabs_content.css('display', '');
$('.tabs-content.carousel').carousel({
fullWidth: true,
noWrap: true,
onCycleTo: function (item) {
if (!clicked) {
var prev_index = index;
index = $tabs_wrapper.index(item);
$active.removeClass('active');
$active = $links.eq(index);
$active.addClass('active');
animateIndicator(prev_index);
if (typeof options.onShow === "function") {
options.onShow.call($this[0], $content);
}
}
}
});
} else {
// Hide the remaining content
$links.not($active).each(function () {
$(Materialize.escapeHash(this.hash)).hide();
});
}
// Bind the click event handler
$this.off('click.tabs').on('click.tabs', 'a', function (e) {
if ($(this).parent().hasClass('disabled')) {
e.preventDefault();
return;
}
// Act as regular link if target attribute is specified.
if (!!$(this).attr("target")) {
return;
}
clicked = true;
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
// Make the old tab inactive.
$active.removeClass('active');
var $oldContent = $content;
// Update the variables with the new link and content
$active = $(this);
$content = $(Materialize.escapeHash(this.hash));
$links = $this.find('li.tab a');
var activeRect = $active.position();
// Make the tab active.
$active.addClass('active');
prev_index = index;
index = $links.index($(this));
if (index < 0) {
index = 0;
}
// Change url to current tab
// window.location.hash = $active.attr('href');
// Swap content
if (options.swipeable) {
if ($tabs_content.length) {
$tabs_content.carousel('set', index, function () {
if (typeof options.onShow === "function") {
options.onShow.call($this[0], $content);
}
});
}
} else {
if ($content !== undefined) {
$content.show();
$content.addClass('active');
if (typeof options.onShow === "function") {
options.onShow.call(this, $content);
}
}
if ($oldContent !== undefined && !$oldContent.is($content)) {
$oldContent.hide();
$oldContent.removeClass('active');
}
}
// Reset clicked state
clickedTimeout = setTimeout(function () {
clicked = false;
}, transition);
// Update indicator
animateIndicator(prev_index);
// Prevent the anchor's default click action
e.preventDefault();
});
});
},
select_tab: function (id) {
this.find('a[href="#' + id + '"]').trigger('click');
}
};
$.fn.tabs = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
}
};
$(document).ready(function () {
$('ul.tabs').tabs();
});
})(jQuery);
;(function ($) {
$.fn.tooltip = function (options) {
var timeout = null,
margin = 5;
// Defaults
var defaults = {
delay: 350,
tooltip: '',
position: 'bottom',
html: false
};
// Remove tooltip from the activator
if (options === "remove") {
this.each(function () {
$('#' + $(this).attr('data-tooltip-id')).remove();
$(this).removeAttr('data-tooltip-id');
$(this).off('mouseenter.tooltip mouseleave.tooltip');
});
return false;
}
options = $.extend(defaults, options);
return this.each(function () {
var tooltipId = Materialize.guid();
var origin = $(this);
// Destroy old tooltip
if (origin.attr('data-tooltip-id')) {
$('#' + origin.attr('data-tooltip-id')).remove();
}
origin.attr('data-tooltip-id', tooltipId);
// Get attributes.
var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
var setAttributes = function () {
allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
tooltipDelay = origin.attr('data-delay');
tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
tooltipPosition = origin.attr('data-position');
tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
tooltipText = origin.attr('data-tooltip');
tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
};
setAttributes();
var renderTooltipEl = function () {
var tooltip = $('');
// Create Text span
if (allowHtml) {
tooltipText = $('').html(tooltipText);
} else {
tooltipText = $('').text(tooltipText);
}
// Create tooltip
tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
// Create backdrop
backdrop = $('');
backdrop.appendTo(tooltip);
return tooltip;
};
tooltipEl = renderTooltipEl();
// Destroy previously binded events
origin.off('mouseenter.tooltip mouseleave.tooltip');
// Mouse In
var started = false,
timeoutRef;
origin.on({ 'mouseenter.tooltip': function (e) {
var showTooltip = function () {
setAttributes();
started = true;
tooltipEl.velocity('stop');
backdrop.velocity('stop');
tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
// Tooltip positioning
var originWidth = origin.outerWidth();
var originHeight = origin.outerHeight();
var tooltipHeight = tooltipEl.outerHeight();
var tooltipWidth = tooltipEl.outerWidth();
var tooltipVerticalMovement = '0px';
var tooltipHorizontalMovement = '0px';
var backdropOffsetWidth = backdrop[0].offsetWidth;
var backdropOffsetHeight = backdrop[0].offsetHeight;
var scaleXFactor = 8;
var scaleYFactor = 8;
var scaleFactor = 0;
var targetTop, targetLeft, newCoordinates;
if (tooltipPosition === "top") {
// Top Position
targetTop = origin.offset().top - tooltipHeight - margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '-10px';
backdrop.css({
bottom: 0,
left: 0,
borderRadius: '14px 14px 0 0',
transformOrigin: '50% 100%',
marginTop: tooltipHeight,
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
});
}
// Left Position
else if (tooltipPosition === "left") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left - tooltipWidth - margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '-10px';
backdrop.css({
top: '-7px',
right: 0,
width: '14px',
height: '14px',
borderRadius: '14px 0 0 14px',
transformOrigin: '95% 50%',
marginTop: tooltipHeight / 2,
marginLeft: tooltipWidth
});
}
// Right Position
else if (tooltipPosition === "right") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left + originWidth + margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '+10px';
backdrop.css({
top: '-7px',
left: 0,
width: '14px',
height: '14px',
borderRadius: '0 14px 14px 0',
transformOrigin: '5% 50%',
marginTop: tooltipHeight / 2,
marginLeft: '0px'
});
} else {
// Bottom Position
targetTop = origin.offset().top + origin.outerHeight() + margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '+10px';
backdrop.css({
top: 0,
left: 0,
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
});
}
// Set tooptip css placement
tooltipEl.css({
top: newCoordinates.y,
left: newCoordinates.x
});
// Calculate Scale to fill
scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
scaleFactor = Math.max(scaleXFactor, scaleYFactor);
tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
};
timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
// Mouse Out
},
'mouseleave.tooltip': function () {
// Reset State
started = false;
clearTimeout(timeoutRef);
// Animate back
setTimeout(function () {
if (started !== true) {
tooltipEl.velocity({
opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
duration: 225,
queue: false,
complete: function () {
backdrop.css({ visibility: 'hidden' });
tooltipEl.css({ visibility: 'hidden' });
started = false;
}
});
}
}, 225);
}
});
});
};
var repositionWithinScreen = function (x, y, width, height) {
var newX = x;
var newY = y;
if (newX < 0) {
newX = 4;
} else if (newX + width > window.innerWidth) {
newX -= newX + width - window.innerWidth;
}
if (newY < 0) {
newY = 4;
} else if (newY + height > window.innerHeight + $(window).scrollTop) {
newY -= newY + height - window.innerHeight;
}
return { x: newX, y: newY };
};
$(document).ready(function () {
$('.tooltipped').tooltip();
});
})(jQuery);
; /*!
* Waves v0.6.4
* http://fian.my.id/Waves
*
* Copyright 2014 Alfiana E. Sibuea and other contributors
* Released under the MIT license
* https://github.com/fians/Waves/blob/master/LICENSE
*/
;(function (window) {
'use strict';
var Waves = Waves || {};
var $$ = document.querySelectorAll.bind(document);
// Find exact position of element
function isWindow(obj) {
return obj !== null && obj === obj.window;
}
function getWindow(elem) {
return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
}
function offset(elem) {
var docElem,
win,
box = { top: 0, left: 0 },
doc = elem && elem.ownerDocument;
docElem = doc.documentElement;
if (typeof elem.getBoundingClientRect !== typeof undefined) {
box = elem.getBoundingClientRect();
}
win = getWindow(doc);
return {
top: box.top + win.pageYOffset - docElem.clientTop,
left: box.left + win.pageXOffset - docElem.clientLeft
};
}
function convertStyle(obj) {
var style = '';
for (var a in obj) {
if (obj.hasOwnProperty(a)) {
style += a + ':' + obj[a] + ';';
}
}
return style;
}
var Effect = {
// Effect delay
duration: 750,
show: function (e, element) {
// Disable right click
if (e.button === 2) {
return false;
}
var el = element || this;
// Create ripple
var ripple = document.createElement('div');
ripple.className = 'waves-ripple';
el.appendChild(ripple);
// Get click coordinate and element witdh
var pos = offset(el);
var relativeY = e.pageY - pos.top;
var relativeX = e.pageX - pos.left;
var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
// Support for touch devices
if ('touches' in e) {
relativeY = e.touches[0].pageY - pos.top;
relativeX = e.touches[0].pageX - pos.left;
}
// Attach data to element
ripple.setAttribute('data-hold', Date.now());
ripple.setAttribute('data-scale', scale);
ripple.setAttribute('data-x', relativeX);
ripple.setAttribute('data-y', relativeY);
// Set ripple position
var rippleStyle = {
'top': relativeY + 'px',
'left': relativeX + 'px'
};
ripple.className = ripple.className + ' waves-notransition';
ripple.setAttribute('style', convertStyle(rippleStyle));
ripple.className = ripple.className.replace('waves-notransition', '');
// Scale the ripple
rippleStyle['-webkit-transform'] = scale;
rippleStyle['-moz-transform'] = scale;
rippleStyle['-ms-transform'] = scale;
rippleStyle['-o-transform'] = scale;
rippleStyle.transform = scale;
rippleStyle.opacity = '1';
rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
rippleStyle['transition-duration'] = Effect.duration + 'ms';
rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
ripple.setAttribute('style', convertStyle(rippleStyle));
},
hide: function (e) {
TouchHandler.touchup(e);
var el = this;
var width = el.clientWidth * 1.4;
// Get first ripple
var ripple = null;
var ripples = el.getElementsByClassName('waves-ripple');
if (ripples.length > 0) {
ripple = ripples[ripples.length - 1];
} else {
return false;
}
var relativeX = ripple.getAttribute('data-x');
var relativeY = ripple.getAttribute('data-y');
var scale = ripple.getAttribute('data-scale');
// Get delay beetween mousedown and mouse leave
var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
var delay = 350 - diff;
if (delay < 0) {
delay = 0;
}
// Fade out ripple after delay
setTimeout(function () {
var style = {
'top': relativeY + 'px',
'left': relativeX + 'px',
'opacity': '0',
// Duration
'-webkit-transition-duration': Effect.duration + 'ms',
'-moz-transition-duration': Effect.duration + 'ms',
'-o-transition-duration': Effect.duration + 'ms',
'transition-duration': Effect.duration + 'ms',
'-webkit-transform': scale,
'-moz-transform': scale,
'-ms-transform': scale,
'-o-transform': scale,
'transform': scale
};
ripple.setAttribute('style', convertStyle(style));
setTimeout(function () {
try {
el.removeChild(ripple);
} catch (e) {
return false;
}
}, Effect.duration);
}, delay);
},
// Little hack to make can perform waves effect
wrapInput: function (elements) {
for (var a = 0; a < elements.length; a++) {
var el = elements[a];
if (el.tagName.toLowerCase() === 'input') {
var parent = el.parentNode;
// If input already have parent just pass through
if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
continue;
}
// Put element class and style to the specified parent
var wrapper = document.createElement('i');
wrapper.className = el.className + ' waves-input-wrapper';
var elementStyle = el.getAttribute('style');
if (!elementStyle) {
elementStyle = '';
}
wrapper.setAttribute('style', elementStyle);
el.className = 'waves-button-input';
el.removeAttribute('style');
// Put element as child
parent.replaceChild(wrapper, el);
wrapper.appendChild(el);
}
}
}
};
/**
* Disable mousedown event for 500ms during and after touch
*/
var TouchHandler = {
/* uses an integer rather than bool so there's no issues with
* needing to clear timeouts if another touch event occurred
* within the 500ms. Cannot mouseup between touchstart and
* touchend, nor in the 500ms after touchend. */
touches: 0,
allowEvent: function (e) {
var allow = true;
if (e.type === 'touchstart') {
TouchHandler.touches += 1; //push
} else if (e.type === 'touchend' || e.type === 'touchcancel') {
setTimeout(function () {
if (TouchHandler.touches > 0) {
TouchHandler.touches -= 1; //pop after 500ms
}
}, 500);
} else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
allow = false;
}
return allow;
},
touchup: function (e) {
TouchHandler.allowEvent(e);
}
};
/**
* Delegated click handler for .waves-effect element.
* returns null when .waves-effect element not in "click tree"
*/
function getWavesEffectElement(e) {
if (TouchHandler.allowEvent(e) === false) {
return null;
}
var element = null;
var target = e.target || e.srcElement;
while (target.parentNode !== null) {
if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
element = target;
break;
}
target = target.parentNode;
}
return element;
}
/**
* Bubble the click and show effect if .waves-effect elem was found
*/
function showEffect(e) {
var element = getWavesEffectElement(e);
if (element !== null) {
Effect.show(e, element);
if ('ontouchstart' in window) {
element.addEventListener('touchend', Effect.hide, false);
element.addEventListener('touchcancel', Effect.hide, false);
}
element.addEventListener('mouseup', Effect.hide, false);
element.addEventListener('mouseleave', Effect.hide, false);
element.addEventListener('dragend', Effect.hide, false);
}
}
Waves.displayEffect = function (options) {
options = options || {};
if ('duration' in options) {
Effect.duration = options.duration;
}
//Wrap input inside tag
Effect.wrapInput($$('.waves-effect'));
if ('ontouchstart' in window) {
document.body.addEventListener('touchstart', showEffect, false);
}
document.body.addEventListener('mousedown', showEffect, false);
};
/**
* Attach Waves to an input element (or any element which doesn't
* bubble mouseup/mousedown events).
* Intended to be used with dynamically loaded forms/inputs, or
* where the user doesn't want a delegated click handler.
*/
Waves.attach = function (element) {
//FUTURE: automatically add waves classes and allow users
// to specify them with an options param? Eg. light/classic/button
if (element.tagName.toLowerCase() === 'input') {
Effect.wrapInput([element]);
element = element.parentNode;
}
if ('ontouchstart' in window) {
element.addEventListener('touchstart', showEffect, false);
}
element.addEventListener('mousedown', showEffect, false);
};
window.Waves = Waves;
document.addEventListener('DOMContentLoaded', function () {
Waves.displayEffect();
}, false);
})(window);
;(function ($, Vel) {
'use strict';
var _defaults = {
displayLength: Infinity,
inDuration: 300,
outDuration: 375,
className: undefined,
completeCallback: undefined,
activationPercent: 0.8
};
var Toast = function () {
function Toast(message, displayLength, className, completeCallback) {
_classCallCheck(this, Toast);
if (!message) {
return;
}
/**
* Options for the toast
* @member Toast#options
*/
this.options = {
displayLength: displayLength,
className: className,
completeCallback: completeCallback
};
this.options = $.extend({}, Toast.defaults, this.options);
this.message = message;
/**
* Describes current pan state toast
* @type {Boolean}
*/
this.panning = false;
/**
* Time remaining until toast is removed
*/
this.timeRemaining = this.options.displayLength;
if (Toast._toasts.length === 0) {
Toast._createContainer();
}
// Create new toast
Toast._toasts.push(this);
var toastElement = this.createToast();
toastElement.M_Toast = this;
this.el = toastElement;
this._animateIn();
this.setTimer();
}
_createClass(Toast, [{
key: 'createToast',
/**
* Create toast and append it to toast container
*/
value: function createToast() {
var toast = document.createElement('div');
toast.classList.add('toast');
// Add custom classes onto toast
if (this.options.className) {
var classes = this.options.className.split(' ');
var i = void 0,
count = void 0;
for (i = 0, count = classes.length; i < count; i++) {
toast.classList.add(classes[i]);
}
}
// Set content
if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
toast.appendChild(this.message);
// Check if it is jQuery object
} else if (this.message instanceof jQuery) {
$(toast).append(this.message);
// Insert as text;
} else {
toast.innerHTML = this.message;
}
// Append toasft
Toast._container.appendChild(toast);
return toast;
}
/**
* Animate in toast
*/
}, {
key: '_animateIn',
value: function _animateIn() {
// Animate toast in
Vel(this.el, { top: 0, opacity: 1 }, {
duration: 300,
easing: 'easeOutCubic',
queue: false
});
}
/**
* Create setInterval which automatically removes toast when timeRemaining >= 0
* has been reached
*/
}, {
key: 'setTimer',
value: function setTimer() {
var _this3 = this;
if (this.timeRemaining !== Infinity) {
this.counterInterval = setInterval(function () {
// If toast is not being dragged, decrease its time remaining
if (!_this3.panning) {
_this3.timeRemaining -= 20;
}
// Animate toast out
if (_this3.timeRemaining <= 0) {
_this3.remove();
}
}, 20);
}
}
/**
* Dismiss toast with animation
*/
}, {
key: 'remove',
value: function remove() {
var _this4 = this;
window.clearInterval(this.counterInterval);
var activationDistance = this.el.offsetWidth * this.options.activationPercent;
if (this.wasSwiped) {
this.el.style.transition = 'transform .05s, opacity .05s';
this.el.style.transform = 'translateX(' + activationDistance + 'px)';
this.el.style.opacity = 0;
}
Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
duration: this.options.outDuration,
easing: 'easeOutExpo',
queue: false,
complete: function () {
// Call the optional callback
if (typeof _this4.options.completeCallback === 'function') {
_this4.options.completeCallback();
}
// Remove toast from DOM
_this4.el.parentNode.removeChild(_this4.el);
Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
if (Toast._toasts.length === 0) {
Toast._removeContainer();
}
}
});
}
}], [{
key: '_createContainer',
/**
* Append toast container and add event handlers
*/
value: function _createContainer() {
var container = document.createElement('div');
container.setAttribute('id', 'toast-container');
// Add event handler
container.addEventListener('touchstart', Toast._onDragStart);
container.addEventListener('touchmove', Toast._onDragMove);
container.addEventListener('touchend', Toast._onDragEnd);
container.addEventListener('mousedown', Toast._onDragStart);
document.addEventListener('mousemove', Toast._onDragMove);
document.addEventListener('mouseup', Toast._onDragEnd);
document.body.appendChild(container);
Toast._container = container;
}
/**
* Remove toast container and event handlers
*/
}, {
key: '_removeContainer',
value: function _removeContainer() {
// Add event handler
document.removeEventListener('mousemove', Toast._onDragMove);
document.removeEventListener('mouseup', Toast._onDragEnd);
Toast._container.parentNode.removeChild(Toast._container);
Toast._container = null;
}
/**
* Begin drag handler
* @param {Event} e
*/
}, {
key: '_onDragStart',
value: function _onDragStart(e) {
if (e.target && $(e.target).closest('.toast').length) {
var $toast = $(e.target).closest('.toast');
var toast = $toast[0].M_Toast;
toast.panning = true;
Toast._draggedToast = toast;
toast.el.classList.add('panning');
toast.el.style.transition = '';
toast.startingXPos = Toast._xPos(e);
toast.time = Date.now();
toast.xPos = Toast._xPos(e);
}
}
/**
* Drag move handler
* @param {Event} e
*/
}, {
key: '_onDragMove',
value: function _onDragMove(e) {
if (!!Toast._draggedToast) {
e.preventDefault();
var toast = Toast._draggedToast;
toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
toast.xPos = Toast._xPos(e);
toast.velocityX = toast.deltaX / (Date.now() - toast.time);
toast.time = Date.now();
var totalDeltaX = toast.xPos - toast.startingXPos;
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
}
}
/**
* End drag handler
* @param {Event} e
*/
}, {
key: '_onDragEnd',
value: function _onDragEnd(e) {
if (!!Toast._draggedToast) {
var toast = Toast._draggedToast;
toast.panning = false;
toast.el.classList.remove('panning');
var totalDeltaX = toast.xPos - toast.startingXPos;
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
// Remove toast
if (shouldBeDismissed) {
toast.wasSwiped = true;
toast.remove();
// Animate toast back to original position
} else {
toast.el.style.transition = 'transform .2s, opacity .2s';
toast.el.style.transform = '';
toast.el.style.opacity = '';
}
Toast._draggedToast = null;
}
}
/**
* Get x position of mouse or touch event
* @param {Event} e
*/
}, {
key: '_xPos',
value: function _xPos(e) {
if (e.targetTouches && e.targetTouches.length >= 1) {
return e.targetTouches[0].clientX;
}
// mouse event
return e.clientX;
}
/**
* Remove all toasts
*/
}, {
key: 'removeAll',
value: function removeAll() {
for (var toastIndex in Toast._toasts) {
Toast._toasts[toastIndex].remove();
}
}
}, {
key: 'defaults',
get: function () {
return _defaults;
}
}]);
return Toast;
}();
/**
* @static
* @memberof Toast
* @type {Array.}
*/
Toast._toasts = [];
/**
* @static
* @memberof Toast
*/
Toast._container = null;
/**
* @static
* @memberof Toast
* @type {Toast}
*/
Toast._draggedToast = null;
Materialize.Toast = Toast;
Materialize.toast = function (message, displayLength, className, completeCallback) {
return new Toast(message, displayLength, className, completeCallback);
};
})(jQuery, Materialize.Vel);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
menuWidth: 300,
edge: 'left',
closeOnClick: false,
draggable: true,
onOpen: null,
onClose: null
};
options = $.extend(defaults, options);
$(this).each(function () {
var $this = $(this);
var menuId = $this.attr('data-activates');
var menu = $("#" + menuId);
// Set to width
if (options.menuWidth != 300) {
menu.css('width', options.menuWidth);
}
// Add Touch Area
var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
if (options.draggable) {
// Regenerate dragTarget
if ($dragTarget.length) {
$dragTarget.remove();
}
$dragTarget = $('').attr('data-sidenav', menuId);
$('body').append($dragTarget);
} else {
$dragTarget = $();
}
if (options.edge == 'left') {
menu.css('transform', 'translateX(-100%)');
$dragTarget.css({ 'left': 0 }); // Add Touch Area
} else {
menu.addClass('right-aligned') // Change text-alignment to right
.css('transform', 'translateX(100%)');
$dragTarget.css({ 'right': 0 }); // Add Touch Area
}
// If fixed sidenav, bring menu out
if (menu.hasClass('fixed')) {
if (window.innerWidth > 992) {
menu.css('transform', 'translateX(0)');
}
}
// Window resize to reset on large screens fixed
if (menu.hasClass('fixed')) {
$(window).resize(function () {
if (window.innerWidth > 992) {
// Close menu if window is resized bigger than 992 and user has fixed sidenav
if ($('#sidenav-overlay').length !== 0 && menuOut) {
removeMenu(true);
} else {
// menu.removeAttr('style');
menu.css('transform', 'translateX(0%)');
// menu.css('width', options.menuWidth);
}
} else if (menuOut === false) {
if (options.edge === 'left') {
menu.css('transform', 'translateX(-100%)');
} else {
menu.css('transform', 'translateX(100%)');
}
}
});
}
// if closeOnClick, then add close event for all a tags in side sideNav
if (options.closeOnClick === true) {
menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
removeMenu();
}
});
}
var removeMenu = function (restoreNav) {
panning = false;
menuOut = false;
// Reenable scrolling
$('body').css({
overflow: '',
width: ''
});
$('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
} });
if (options.edge === 'left') {
// Reset phantom div
$dragTarget.css({ width: '', right: '', left: '0' });
menu.velocity({ 'translateX': '-100%' }, { duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
} else {
// Reset phantom div
$dragTarget.css({ width: '', right: '0', left: '' });
menu.velocity({ 'translateX': '100%' }, { duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
}
// Callback
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
};
// Touch Event
var panning = false;
var menuOut = false;
if (options.draggable) {
$dragTarget.on('click', function () {
if (menuOut) {
removeMenu();
}
});
$dragTarget.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType == "touch") {
var direction = e.gesture.direction;
var x = e.gesture.center.x;
var y = e.gesture.center.y;
var velocityX = e.gesture.velocityX;
// Vertical scroll bugfix
if (x === 0 && y === 0) {
return;
}
// Disable Scrolling
var $body = $('body');
var $overlay = $('#sidenav-overlay');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// If overlay does not exist, create one and if it is clicked, close menu
if ($overlay.length === 0) {
$overlay = $('');
$overlay.css('opacity', 0).click(function () {
removeMenu();
});
// Run 'onOpen' when sidenav is opened via touch/swipe if applicable
if (typeof options.onOpen === 'function') {
options.onOpen.call(this, menu);
}
$('body').append($overlay);
}
// Keep within boundaries
if (options.edge === 'left') {
if (x > options.menuWidth) {
x = options.menuWidth;
} else if (x < 0) {
x = 0;
}
}
if (options.edge === 'left') {
// Left Direction
if (x < options.menuWidth / 2) {
menuOut = false;
}
// Right Direction
else if (x >= options.menuWidth / 2) {
menuOut = true;
}
menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
} else {
// Left Direction
if (x < window.innerWidth - options.menuWidth / 2) {
menuOut = true;
}
// Right Direction
else if (x >= window.innerWidth - options.menuWidth / 2) {
menuOut = false;
}
var rightPos = x - options.menuWidth / 2;
if (rightPos < 0) {
rightPos = 0;
}
menu.css('transform', 'translateX(' + rightPos + 'px)');
}
// Percentage overlay
var overlayPerc;
if (options.edge === 'left') {
overlayPerc = x / options.menuWidth;
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
} else {
overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType == "touch") {
var $overlay = $('#sidenav-overlay');
var velocityX = e.gesture.velocityX;
var x = e.gesture.center.x;
var leftPos = x - options.menuWidth;
var rightPos = x - options.menuWidth / 2;
if (leftPos > 0) {
leftPos = 0;
}
if (rightPos < 0) {
rightPos = 0;
}
panning = false;
if (options.edge === 'left') {
// If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
// Return menu to open
if (leftPos !== 0) {
menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
$dragTarget.css({ width: '50%', right: 0, left: '' });
menuOut = true;
} else if (!menuOut || velocityX > 0.3) {
// Enable Scrolling
$('body').css({
overflow: '',
width: ''
});
// Slide menu closed
menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
complete: function () {
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
$(this).remove();
} });
$dragTarget.css({ width: '10px', right: '', left: 0 });
}
} else {
if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
// Return menu to open
if (rightPos !== 0) {
menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
$dragTarget.css({ width: '50%', right: '', left: 0 });
menuOut = true;
} else if (!menuOut || velocityX < -0.3) {
// Enable Scrolling
$('body').css({
overflow: '',
width: ''
});
// Slide menu closed
menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
complete: function () {
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
$(this).remove();
} });
$dragTarget.css({ width: '10px', right: 0, left: '' });
}
}
}
});
}
$this.off('click.sidenav').on('click.sidenav', function () {
if (menuOut === true) {
menuOut = false;
panning = false;
removeMenu();
} else {
// Disable Scrolling
var $body = $('body');
var $overlay = $('');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// Push current drag target on top of DOM tree
$('body').append($dragTarget);
if (options.edge === 'left') {
$dragTarget.css({ width: '50%', right: 0, left: '' });
menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
} else {
$dragTarget.css({ width: '50%', right: '', left: 0 });
menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
// Overlay close on click
$overlay.css('opacity', 0).click(function () {
menuOut = false;
panning = false;
removeMenu();
$overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
});
// Append body
$('body').append($overlay);
$overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
menuOut = true;
panning = false;
}
});
// Callback
if (typeof options.onOpen === 'function') {
options.onOpen.call(this, menu);
}
}
return false;
});
});
},
destroy: function () {
var $overlay = $('#sidenav-overlay');
var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
$overlay.trigger('click');
$dragTarget.remove();
$(this).off('click');
$overlay.remove();
},
show: function () {
this.trigger('click');
},
hide: function () {
$('#sidenav-overlay').trigger('click');
}
};
$.fn.sideNav = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
}
}; // Plugin end
})(jQuery);
; /**
* Extend jquery with a scrollspy plugin.
* This watches the window scroll and fires events when elements are scrolled into viewport.
*
* throttle() and getTime() taken from Underscore.js
* https://github.com/jashkenas/underscore
*
* @author Copyright 2013 John Smart
* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
* @see https://github.com/thesmart
* @version 0.1.2
*/
(function ($) {
var jWindow = $(window);
var elements = [];
var elementsInView = [];
var isSpying = false;
var ticks = 0;
var unique_id = 1;
var offset = {
top: 0,
right: 0,
bottom: 0,
left: 0
/**
* Find elements that are within the boundary
* @param {number} top
* @param {number} right
* @param {number} bottom
* @param {number} left
* @return {jQuery} A collection of elements
*/
};function findElements(top, right, bottom, left) {
var hits = $();
$.each(elements, function (i, element) {
if (element.height() > 0) {
var elTop = element.offset().top,
elLeft = element.offset().left,
elRight = elLeft + element.width(),
elBottom = elTop + element.height();
var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
if (isIntersect) {
hits.push(element);
}
}
});
return hits;
}
/**
* Called when the user scrolls the window
*/
function onScroll(scrollOffset) {
// unique tick id
++ticks;
// viewport rectangle
var top = jWindow.scrollTop(),
left = jWindow.scrollLeft(),
right = left + jWindow.width(),
bottom = top + jWindow.height();
// determine which elements are in view
var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
$.each(intersections, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick != 'number') {
// entered into view
element.triggerHandler('scrollSpy:enter');
}
// update tick id
element.data('scrollSpy:ticks', ticks);
});
// determine which elements are no longer in view
$.each(elementsInView, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick == 'number' && lastTick !== ticks) {
// exited from view
element.triggerHandler('scrollSpy:exit');
element.data('scrollSpy:ticks', null);
}
});
// remember elements in view for next tick
elementsInView = intersections;
}
/**
* Called when window is resized
*/
function onWinSize() {
jWindow.trigger('scrollSpy:winSize');
}
/**
* Enables ScrollSpy using a selector
* @param {jQuery|string} selector The elements collection, or a selector
* @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
activeClass : string -> Class name to be added to the active link. Default: active
* @returns {jQuery}
*/
$.scrollSpy = function (selector, options) {
var defaults = {
throttle: 100,
scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
activeClass: 'active',
getActiveElement: function (id) {
return 'a[href="#' + id + '"]';
}
};
options = $.extend(defaults, options);
var visible = [];
selector = $(selector);
selector.each(function (i, element) {
elements.push($(element));
$(element).data("scrollSpy:id", i);
// Smooth scroll to section
$('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
e.preventDefault();
var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
$('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
});
});
offset.top = options.offsetTop || 0;
offset.right = options.offsetRight || 0;
offset.bottom = options.offsetBottom || 0;
offset.left = options.offsetLeft || 0;
var throttledScroll = Materialize.throttle(function () {
onScroll(options.scrollOffset);
}, options.throttle || 100);
var readyScroll = function () {
$(document).ready(throttledScroll);
};
if (!isSpying) {
jWindow.on('scroll', readyScroll);
jWindow.on('resize', readyScroll);
isSpying = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(readyScroll, 0);
selector.on('scrollSpy:enter', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
var $this = $(this);
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
visible.unshift($(this));
} else {
visible.push($(this));
}
} else {
visible.push($(this));
}
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
});
selector.on('scrollSpy:exit', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
var $this = $(this);
visible = $.grep(visible, function (value) {
return value.attr('id') != $this.attr('id');
});
if (visible[0]) {
// Check if empty
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
}
}
});
return selector;
};
/**
* Listen for window resize events
* @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
* @returns {jQuery} $(window)
*/
$.winSizeSpy = function (options) {
$.winSizeSpy = function () {
return jWindow;
}; // lock from multiple calls
options = options || {
throttle: 100
};
return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
};
/**
* Enables ScrollSpy on a collection of elements
* e.g. $('.scrollSpy').scrollSpy()
* @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
* @returns {jQuery}
*/
$.fn.scrollSpy = function (options) {
return $.scrollSpy($(this), options);
};
})(jQuery);
;(function ($) {
$(document).ready(function () {
// Function to update labels of text fields
Materialize.updateTextFields = function () {
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
$(input_selector).each(function (index, element) {
var $this = $(this);
if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
$this.siblings('label').addClass('active');
} else if ($(element)[0].validity) {
$this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
} else {
$this.siblings('label').removeClass('active');
}
});
};
// Text based inputs
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
// Add active if form auto complete
$(document).on('change', input_selector, function () {
if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
$(this).siblings('label').addClass('active');
}
validate_field($(this));
});
// Add active if input element has been pre-populated on document ready
$(document).ready(function () {
Materialize.updateTextFields();
});
// HTML DOM FORM RESET handling
$(document).on('reset', function (e) {
var formReset = $(e.target);
if (formReset.is('form')) {
formReset.find(input_selector).removeClass('valid').removeClass('invalid');
formReset.find(input_selector).each(function () {
if ($(this).attr('value') === '') {
$(this).siblings('label').removeClass('active');
}
});
// Reset select
formReset.find('select.initialized').each(function () {
var reset_text = formReset.find('option[selected]').text();
formReset.siblings('input.select-dropdown').val(reset_text);
});
}
});
// Add active when element has focus
$(document).on('focus', input_selector, function () {
$(this).siblings('label, .prefix').addClass('active');
});
$(document).on('blur', input_selector, function () {
var $inputElement = $(this);
var selector = ".prefix";
if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
selector += ", label";
}
$inputElement.siblings(selector).removeClass('active');
validate_field($inputElement);
});
window.validate_field = function (object) {
var hasLength = object.attr('data-length') !== undefined;
var lenAttr = parseInt(object.attr('data-length'));
var len = object.val().length;
if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
if (object.hasClass('validate')) {
object.removeClass('valid');
object.removeClass('invalid');
}
} else {
if (object.hasClass('validate')) {
// Check for character counter attributes
if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
object.removeClass('invalid');
object.addClass('valid');
} else {
object.removeClass('valid');
object.addClass('invalid');
}
}
}
};
// Radio and Checkbox focus class
var radio_checkbox = 'input[type=radio], input[type=checkbox]';
$(document).on('keyup.radio', radio_checkbox, function (e) {
// TAB, check if tabbing to radio or checkbox.
if (e.which === 9) {
$(this).addClass('tabbed');
var $this = $(this);
$this.one('blur', function (e) {
$(this).removeClass('tabbed');
});
return;
}
});
// Textarea Auto Resize
var hiddenDiv = $('.hiddendiv').first();
if (!hiddenDiv.length) {
hiddenDiv = $('');
$('body').append(hiddenDiv);
}
var text_area_selector = '.materialize-textarea';
function textareaAutoResize($textarea) {
// Set font properties of hiddenDiv
var fontFamily = $textarea.css('font-family');
var fontSize = $textarea.css('font-size');
var lineHeight = $textarea.css('line-height');
var padding = $textarea.css('padding');
if (fontSize) {
hiddenDiv.css('font-size', fontSize);
}
if (fontFamily) {
hiddenDiv.css('font-family', fontFamily);
}
if (lineHeight) {
hiddenDiv.css('line-height', lineHeight);
}
if (padding) {
hiddenDiv.css('padding', padding);
}
// Set original-height, if none
if (!$textarea.data('original-height')) {
$textarea.data('original-height', $textarea.height());
}
if ($textarea.attr('wrap') === 'off') {
hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
}
hiddenDiv.text($textarea.val() + '\n');
var content = hiddenDiv.html().replace(/\n/g, ' ');
hiddenDiv.html(content);
// When textarea is hidden, width goes crazy.
// Approximate with half of window size
if ($textarea.is(':visible')) {
hiddenDiv.css('width', $textarea.width());
} else {
hiddenDiv.css('width', $(window).width() / 2);
}
/**
* Resize if the new height is greater than the
* original height of the textarea
*/
if ($textarea.data('original-height') <= hiddenDiv.height()) {
$textarea.css('height', hiddenDiv.height());
} else if ($textarea.val().length < $textarea.data('previous-length')) {
/**
* In case the new height is less than original height, it
* means the textarea has less text than before
* So we set the height to the original one
*/
$textarea.css('height', $textarea.data('original-height'));
}
$textarea.data('previous-length', $textarea.val().length);
}
$(text_area_selector).each(function () {
var $textarea = $(this);
/**
* Instead of resizing textarea on document load,
* store the original height and the original length
*/
$textarea.data('original-height', $textarea.height());
$textarea.data('previous-length', $textarea.val().length);
});
$('body').on('keyup keydown autoresize', text_area_selector, function () {
textareaAutoResize($(this));
});
// File Input Path
$(document).on('change', '.file-field input[type="file"]', function () {
var file_field = $(this).closest('.file-field');
var path_input = file_field.find('input.file-path');
var files = $(this)[0].files;
var file_names = [];
for (var i = 0; i < files.length; i++) {
file_names.push(files[i].name);
}
path_input.val(file_names.join(", "));
path_input.trigger('change');
});
/****************
* Range Input *
****************/
var range_type = 'input[type=range]';
var range_mousedown = false;
var left;
$(range_type).each(function () {
var thumb = $('');
$(this).after(thumb);
});
var showRangeBubble = function (thumb) {
var paddingLeft = parseInt(thumb.parent().css('padding-left'));
var marginLeft = -7 + paddingLeft + 'px';
thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
};
var calcRangeOffset = function (range) {
var width = range.width() - 15;
var max = parseFloat(range.attr('max'));
var min = parseFloat(range.attr('min'));
var percent = (parseFloat(range.val()) - min) / (max - min);
return percent * width;
};
var range_wrapper = '.range-field';
$(document).on('change', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
thumb.find('.value').html($(this).val());
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
});
$(document).on('mousedown touchstart', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
// If thumb indicator does not exist yet, create it
if (thumb.length <= 0) {
thumb = $('');
$(this).after(thumb);
}
// Set indicator value
thumb.find('.value').html($(this).val());
range_mousedown = true;
$(this).addClass('active');
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
if (e.type !== 'input') {
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
}
});
$(document).on('mouseup touchend', range_wrapper, function () {
range_mousedown = false;
$(this).removeClass('active');
});
$(document).on('input mousemove touchmove', range_wrapper, function (e) {
var thumb = $(this).children('.thumb');
var left;
var input = $(this).find(range_type);
if (range_mousedown) {
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset(input);
thumb.addClass('active').css('left', offsetLeft);
thumb.find('.value').html(thumb.siblings(range_type).val());
}
});
$(document).on('mouseout touchleave', range_wrapper, function () {
if (!range_mousedown) {
var thumb = $(this).children('.thumb');
var paddingLeft = parseInt($(this).css('padding-left'));
var marginLeft = 7 + paddingLeft + 'px';
if (thumb.hasClass('active')) {
thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
}
thumb.removeClass('active');
}
});
/**************************
* Auto complete plugin *
*************************/
$.fn.autocomplete = function (options) {
// Defaults
var defaults = {
data: {},
limit: Infinity,
onAutocomplete: null,
minLength: 1
};
options = $.extend(defaults, options);
return this.each(function () {
var $input = $(this);
var data = options.data,
count = 0,
activeIndex = -1,
oldVal,
$inputDiv = $input.closest('.input-field'); // Div to append on
// Check if data isn't empty
if (!$.isEmptyObject(data)) {
var $autocomplete = $('
');
var $oldAutocomplete;
// Append autocomplete element.
// Prevent double structure init.
if ($inputDiv.length) {
$oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
if (!$oldAutocomplete.length) {
$inputDiv.append($autocomplete); // Set ul in body
}
} else {
$oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
if (!$oldAutocomplete.length) {
$input.after($autocomplete);
}
}
if ($oldAutocomplete.length) {
$autocomplete = $oldAutocomplete;
}
// Highlight partial match.
var highlight = function (string, $el) {
var img = $el.find('img');
var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
matchEnd = matchStart + string.length - 1,
beforeMatch = $el.text().slice(0, matchStart),
matchText = $el.text().slice(matchStart, matchEnd + 1),
afterMatch = $el.text().slice(matchEnd + 1);
$el.html("" + beforeMatch + "" + matchText + "" + afterMatch + "");
if (img.length) {
$el.prepend(img);
}
};
// Reset current element position
var resetCurrentElement = function () {
activeIndex = -1;
$autocomplete.find('.active').removeClass('active');
};
// Remove autocomplete elements
var removeAutocomplete = function () {
$autocomplete.empty();
resetCurrentElement();
oldVal = undefined;
};
$input.off('blur.autocomplete').on('blur.autocomplete', function () {
removeAutocomplete();
});
// Perform search
$input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
// Reset count.
count = 0;
var val = $input.val().toLowerCase();
// Don't capture enter or arrow key usage.
if (e.which === 13 || e.which === 38 || e.which === 40) {
return;
}
// Check if the input isn't empty
if (oldVal !== val) {
removeAutocomplete();
if (val.length >= options.minLength) {
for (var key in data) {
if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
// Break if past limit
if (count >= options.limit) {
break;
}
var autocompleteOption = $('');
if (!!data[key]) {
autocompleteOption.append('' + key + '');
} else {
autocompleteOption.append('' + key + '');
}
$autocomplete.append(autocompleteOption);
highlight(val, autocompleteOption);
count++;
}
}
}
}
// Update oldVal
oldVal = val;
});
$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
// Arrow keys and enter key usage
var keyCode = e.which,
liElement,
numItems = $autocomplete.children('li').length,
$active = $autocomplete.children('.active').first();
// select element on Enter
if (keyCode === 13 && activeIndex >= 0) {
liElement = $autocomplete.children('li').eq(activeIndex);
if (liElement.length) {
liElement.trigger('mousedown.autocomplete');
e.preventDefault();
}
return;
}
// Capture up and down key
if (keyCode === 38 || keyCode === 40) {
e.preventDefault();
if (keyCode === 38 && activeIndex > 0) {
activeIndex--;
}
if (keyCode === 40 && activeIndex < numItems - 1) {
activeIndex++;
}
$active.removeClass('active');
if (activeIndex >= 0) {
$autocomplete.children('li').eq(activeIndex).addClass('active');
}
}
});
// Set input value
$autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
var text = $(this).text().trim();
$input.val(text);
$input.trigger('change');
removeAutocomplete();
// Handle onAutocomplete callback.
if (typeof options.onAutocomplete === "function") {
options.onAutocomplete.call(this, text);
}
});
// Empty data
} else {
$input.off('keyup.autocomplete focus.autocomplete');
}
});
};
}); // End of $(document).ready
/*******************
* Select Plugin *
******************/
$.fn.material_select = function (callback) {
$(this).each(function () {
var $select = $(this);
if ($select.hasClass('browser-default')) {
return; // Continue to next (return false breaks out of entire loop)
}
var multiple = $select.attr('multiple') ? true : false,
lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
if (lastID) {
$select.parent().find('span.caret').remove();
$select.parent().find('input').remove();
$select.unwrap();
$('ul#select-options-' + lastID).remove();
}
// If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
if (callback === 'destroy') {
$select.removeAttr('data-select-id').removeClass('initialized');
$(window).off('click.select');
return;
}
var uniqueID = Materialize.guid();
$select.attr('data-select-id', uniqueID);
var wrapper = $('');
wrapper.addClass($select.attr('class'));
if ($select.is(':disabled')) wrapper.addClass('disabled');
var options = $('
'),
selectChildren = $select.children('option, optgroup'),
valuesSelected = [],
optionsHover = false;
var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
// Function that renders and appends the option taking into
// account type and possible image icon.
var appendOptionWithIcon = function (select, option, type) {
// Add disabled attr if disabled
var disabledClass = option.is(':disabled') ? 'disabled ' : '';
var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
var multipleCheckbox = multiple ? '' : '';
// add icons
var icon_url = option.data('icon');
var classes = option.attr('class');
if (!!icon_url) {
var classString = '';
if (!!classes) classString = ' class="' + classes + '"';
// Check for multiple type.
options.append($('
' + multipleCheckbox + option.html() + '
'));
return true;
}
// Check for multiple type.
options.append($('
' + multipleCheckbox + option.html() + '
'));
};
/* Create dropdown structure. */
if (selectChildren.length) {
selectChildren.each(function () {
if ($(this).is('option')) {
// Direct descendant option.
if (multiple) {
appendOptionWithIcon($select, $(this), 'multiple');
} else {
appendOptionWithIcon($select, $(this));
}
} else if ($(this).is('optgroup')) {
// Optgroup.
var selectOptions = $(this).children('option');
options.append($('
' + $(this).attr('label') + '
'));
selectOptions.each(function () {
appendOptionWithIcon($select, $(this), 'optgroup-option');
});
}
});
}
options.find('li:not(.optgroup)').each(function (i) {
$(this).click(function (e) {
// Check if option element is disabled
if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
var selected = true;
if (multiple) {
$('input[type="checkbox"]', this).prop('checked', function (i, v) {
return !v;
});
selected = toggleEntryFromArray(valuesSelected, i, $select);
$newSelect.trigger('focus');
} else {
options.find('li').removeClass('active');
$(this).toggleClass('active');
$newSelect.val($(this).text());
}
activateOption(options, $(this));
$select.find('option').eq(i).prop('selected', selected);
// Trigger onchange() event
$select.trigger('change');
if (typeof callback !== 'undefined') callback();
}
e.stopPropagation();
});
});
// Wrap Elements
$select.wrap(wrapper);
// Add Select Display Element
var dropdownIcon = $('▼');
// escape double quotes
var sanitizedLabelHtml = label.replace(/"/g, '"');
var $newSelect = $('');
$select.before($newSelect);
$newSelect.before(dropdownIcon);
$newSelect.after(options);
// Check if section element is disabled
if (!$select.is(':disabled')) {
$newSelect.dropdown({ 'hover': false });
}
// Copy tabindex
if ($select.attr('tabindex')) {
$($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
}
$select.addClass('initialized');
$newSelect.on({
'focus': function () {
if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
$('input.select-dropdown').trigger('close');
$(window).off('click.select');
}
if (!options.is(':visible')) {
$(this).trigger('open', ['focus']);
var label = $(this).val();
if (multiple && label.indexOf(',') >= 0) {
label = label.split(',')[0];
}
var selectedOption = options.find('li').filter(function () {
return $(this).text().toLowerCase() === label.toLowerCase();
})[0];
activateOption(options, selectedOption, true);
$(window).off('click.select').on('click.select', function () {
multiple && (optionsHover || $newSelect.trigger('close'));
$(window).off('click.select');
});
}
},
'click': function (e) {
e.stopPropagation();
}
});
$newSelect.on('blur', function () {
if (!multiple) {
$(this).trigger('close');
$(window).off('click.select');
}
options.find('li.selected').removeClass('selected');
});
options.hover(function () {
optionsHover = true;
}, function () {
optionsHover = false;
});
// Add initial multiple selections.
if (multiple) {
$select.find("option:selected:not(:disabled)").each(function () {
var index = this.index;
toggleEntryFromArray(valuesSelected, index, $select);
options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
});
}
/**
* Make option as selected and scroll to selected position
* @param {jQuery} collection Select options jQuery element
* @param {Element} newOption element of the new option
* @param {Boolean} firstActivation If on first activation of select
*/
var activateOption = function (collection, newOption, firstActivation) {
if (newOption) {
collection.find('li.selected').removeClass('selected');
var option = $(newOption);
option.addClass('selected');
if (!multiple || !!firstActivation) {
options.scrollTo(option);
}
}
};
// Allow user to search by typing
// this array is cleared after 1 second
var filterQuery = [],
onKeyDown = function (e) {
// TAB - switch to another input
if (e.which == 9) {
$newSelect.trigger('close');
return;
}
// ARROW DOWN WHEN SELECT IS CLOSED - open select options
if (e.which == 40 && !options.is(':visible')) {
$newSelect.trigger('open');
return;
}
// ENTER WHEN SELECT IS CLOSED - submit form
if (e.which == 13 && !options.is(':visible')) {
return;
}
e.preventDefault();
// CASE WHEN USER TYPE LETTERS
var letter = String.fromCharCode(e.which).toLowerCase(),
nonLetters = [9, 13, 27, 38, 40];
if (letter && nonLetters.indexOf(e.which) === -1) {
filterQuery.push(letter);
var string = filterQuery.join(''),
newOption = options.find('li').filter(function () {
return $(this).text().toLowerCase().indexOf(string) === 0;
})[0];
if (newOption) {
activateOption(options, newOption);
}
}
// ENTER - select option and close when select options are opened
if (e.which == 13) {
var activeOption = options.find('li.selected:not(.disabled)')[0];
if (activeOption) {
$(activeOption).trigger('click');
if (!multiple) {
$newSelect.trigger('close');
}
}
}
// ARROW DOWN - move to next not disabled option
if (e.which == 40) {
if (options.find('li.selected').length) {
newOption = options.find('li.selected').next('li:not(.disabled)')[0];
} else {
newOption = options.find('li:not(.disabled)')[0];
}
activateOption(options, newOption);
}
// ESC - close options
if (e.which == 27) {
$newSelect.trigger('close');
}
// ARROW UP - move to previous not disabled option
if (e.which == 38) {
newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
if (newOption) activateOption(options, newOption);
}
// Automaticaly clean filter query so user can search again by starting letters
setTimeout(function () {
filterQuery = [];
}, 1000);
};
$newSelect.on('keydown', onKeyDown);
});
function toggleEntryFromArray(entriesArray, entryIndex, select) {
var index = entriesArray.indexOf(entryIndex),
notAdded = index === -1;
if (notAdded) {
entriesArray.push(entryIndex);
} else {
entriesArray.splice(index, 1);
}
select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
// use notAdded instead of true (to detect if the option is selected or not)
select.find('option').eq(entryIndex).prop('selected', notAdded);
setValueToInput(entriesArray, select);
return notAdded;
}
function setValueToInput(entriesArray, select) {
var value = '';
for (var i = 0, count = entriesArray.length; i < count; i++) {
var text = select.find('option').eq(entriesArray[i]).text();
i === 0 ? value += text : value += ', ' + text;
}
if (value === '') {
value = select.find('option:disabled').eq(0).text();
}
select.siblings('input.select-dropdown').val(value);
}
};
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
indicators: true,
height: 400,
transition: 500,
interval: 6000
};
options = $.extend(defaults, options);
return this.each(function () {
// For each slider, we want to keep track of
// which slide is active and its associated content
var $this = $(this);
var $slider = $this.find('ul.slides').first();
var $slides = $slider.find('> li');
var $active_index = $slider.find('.active').index();
var $active, $indicators, $interval;
if ($active_index != -1) {
$active = $slides.eq($active_index);
}
// Transitions the caption depending on alignment
function captionTransition(caption, duration) {
if (caption.hasClass("center-align")) {
caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
} else if (caption.hasClass("right-align")) {
caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
} else if (caption.hasClass("left-align")) {
caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
}
}
// This function will transition the slide to any index of the next slide
function moveToSlide(index) {
// Wrap around indices.
if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
$active_index = $slider.find('.active').index();
// Only do if index changes
if ($active_index != index) {
$active = $slides.eq($active_index);
$caption = $active.find('.caption');
$active.removeClass('active');
$active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
complete: function () {
$slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
} });
captionTransition($caption, options.transition);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).removeClass('active');
}
$slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
$slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
$slides.eq(index).addClass('active');
// Update indicators
if (options.indicators) {
$indicators.eq(index).addClass('active');
}
}
}
// Set height of slider
// If fullscreen, do nothing
if (!$this.hasClass('fullscreen')) {
if (options.indicators) {
// Add height if indicators are present
$this.height(options.height + 40);
} else {
$this.height(options.height);
}
$slider.height(options.height);
}
// Set initial positions of captions
$slides.find('.caption').each(function () {
captionTransition($(this), 0);
});
// Move img src into background-image
$slides.find('img').each(function () {
var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
if ($(this).attr('src') !== placeholderBase64) {
$(this).css('background-image', 'url("' + $(this).attr('src') + '")');
$(this).attr('src', placeholderBase64);
}
});
// dynamically add indicators
if (options.indicators) {
$indicators = $('
');
$slides.each(function (index) {
var $indicator = $('');
// Handle clicks on indicators
$indicator.click(function () {
var $parent = $slider.parent();
var curr_index = $parent.find($(this)).index();
moveToSlide(curr_index);
// reset interval
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
});
$indicators.append($indicator);
});
$this.append($indicators);
$indicators = $this.find('ul.indicators').find('li.indicator-item');
}
if ($active) {
$active.show();
} else {
$slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
$active_index = 0;
$active = $slides.eq($active_index);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).addClass('active');
}
}
// Adjust height to current slide
$active.find('img').each(function () {
$active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
});
// auto scroll
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
}, options.transition + options.interval);
// HammerJS, Swipe navigation
// Touch Event
var panning = false;
var swipeLeft = false;
var swipeRight = false;
$this.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
// reset interval
clearInterval($interval);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
var velocityY = e.gesture.velocityY;
$curr_slide = $slider.find('.active');
if (Math.abs(velocityX) > Math.abs(velocityY)) {
$curr_slide.velocity({ translateX: x
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
}
// Swipe Left
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
swipeRight = true;
}
// Swipe Right
else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
swipeLeft = true;
}
// Make Slide Behind active slide visible
var next_slide;
if (swipeLeft) {
next_slide = $curr_slide.next();
if (next_slide.length === 0) {
next_slide = $slides.first();
}
next_slide.velocity({ opacity: 1
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
if (swipeRight) {
next_slide = $curr_slide.prev();
if (next_slide.length === 0) {
next_slide = $slides.last();
}
next_slide.velocity({ opacity: 1
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType === "touch") {
$curr_slide = $slider.find('.active');
panning = false;
curr_index = $slider.find('.active').index();
if (!swipeRight && !swipeLeft || $slides.length <= 1) {
// Return to original spot
$curr_slide.velocity({ translateX: 0
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
} else if (swipeLeft) {
moveToSlide(curr_index + 1);
$curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
} });
} else if (swipeRight) {
moveToSlide(curr_index - 1);
$curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
} });
}
swipeLeft = false;
swipeRight = false;
// Restart interval
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
}
});
$this.on('sliderPause', function () {
clearInterval($interval);
});
$this.on('sliderStart', function () {
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
});
$this.on('sliderNext', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
});
$this.on('sliderPrev', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index - 1);
});
});
},
pause: function () {
$(this).trigger('sliderPause');
},
start: function () {
$(this).trigger('sliderStart');
},
next: function () {
$(this).trigger('sliderNext');
},
prev: function () {
$(this).trigger('sliderPrev');
}
};
$.fn.slider = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
}
}; // Plugin end
})(jQuery);
;(function ($) {
$(document).ready(function () {
$(document).on('click.card', '.card', function (e) {
if ($(this).find('> .card-reveal').length) {
var $card = $(e.target).closest('.card');
if ($card.data('initialOverflow') === undefined) {
$card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
}
if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
// Make Reveal animate down and display none
$(this).find('.card-reveal').velocity({ translateY: 0 }, {
duration: 225,
queue: false,
easing: 'easeInOutQuad',
complete: function () {
$(this).css({ display: 'none' });
$card.css('overflow', $card.data('initialOverflow'));
}
});
} else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
$card.css('overflow', 'hidden');
$(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
}
}
});
});
})(jQuery);
;(function ($) {
var materialChipsDefaults = {
data: [],
placeholder: '',
secondaryPlaceholder: '',
autocompleteOptions: {}
};
$(document).ready(function () {
// Handle removal of static chips.
$(document).on('click', '.chip .close', function (e) {
var $chips = $(this).closest('.chips');
if ($chips.attr('data-initialized')) {
return;
}
$(this).closest('.chip').remove();
});
});
$.fn.material_chip = function (options) {
var self = this;
this.$el = $(this);
this.$document = $(document);
this.SELS = {
CHIPS: '.chips',
CHIP: '.chip',
INPUT: 'input',
DELETE: '.material-icons',
SELECTED_CHIP: '.selected'
};
if ('data' === options) {
return this.$el.data('chips');
}
var curr_options = $.extend({}, materialChipsDefaults, options);
self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
// Initialize
this.init = function () {
var i = 0;
var chips;
self.$el.each(function () {
var $chips = $(this);
var chipId = Materialize.guid();
self.chipId = chipId;
if (!curr_options.data || !(curr_options.data instanceof Array)) {
curr_options.data = [];
}
$chips.data('chips', curr_options.data);
$chips.attr('data-index', i);
$chips.attr('data-initialized', true);
if (!$chips.hasClass(self.SELS.CHIPS)) {
$chips.addClass('chips');
}
self.chips($chips, chipId);
i++;
});
};
this.handleEvents = function () {
var SELS = self.SELS;
self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
$(e.target).find(SELS.INPUT).focus();
});
self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
var $chip = $(e.target);
if ($chip.length) {
var wasSelected = $chip.hasClass('selected');
var $chips = $chip.closest(SELS.CHIPS);
$(SELS.CHIP).removeClass('selected');
if (!wasSelected) {
self.selectChip($chip.index(), $chips);
}
}
});
self.$document.off('keydown.chips').on('keydown.chips', function (e) {
if ($(e.target).is('input, textarea')) {
return;
}
// delete
var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
var $chips = $chip.closest(SELS.CHIPS);
var length = $chip.siblings(SELS.CHIP).length;
var index;
if (!$chip.length) {
return;
}
if (e.which === 8 || e.which === 46) {
e.preventDefault();
index = $chip.index();
self.deleteChip(index, $chips);
var selectIndex = null;
if (index + 1 < length) {
selectIndex = index;
} else if (index === length || index + 1 === length) {
selectIndex = length - 1;
}
if (selectIndex < 0) selectIndex = null;
if (null !== selectIndex) {
self.selectChip(selectIndex, $chips);
}
if (!length) $chips.find('input').focus();
// left
} else if (e.which === 37) {
index = $chip.index() - 1;
if (index < 0) {
return;
}
$(SELS.CHIP).removeClass('selected');
self.selectChip(index, $chips);
// right
} else if (e.which === 39) {
index = $chip.index() + 1;
$(SELS.CHIP).removeClass('selected');
if (index > length) {
$chips.find('input').focus();
return;
}
self.selectChip(index, $chips);
}
});
self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.addClass('focus');
$currChips.siblings('label, .prefix').addClass('active');
$(SELS.CHIP).removeClass('selected');
});
self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.removeClass('focus');
// Remove active if empty
if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
$currChips.siblings('label').removeClass('active');
}
$currChips.siblings('.prefix').removeClass('active');
});
self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var chipsLength = $chips.children(SELS.CHIP).length;
// enter
if (13 === e.which) {
// Override enter if autocompleting.
if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
return;
}
e.preventDefault();
self.addChip({ tag: $target.val() }, $chips);
$target.val('');
return;
}
// delete or left
if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
e.preventDefault();
self.selectChip(chipsLength - 1, $chips);
$target.blur();
return;
}
});
// Click on delete icon in chip.
self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var $chip = $target.closest(SELS.CHIP);
e.stopPropagation();
self.deleteChip($chip.index(), $chips);
$chips.find('input').focus();
});
};
this.chips = function ($chips, chipId) {
$chips.empty();
$chips.data('chips').forEach(function (elem) {
$chips.append(self.renderChip(elem));
});
$chips.append($(''));
self.setPlaceholder($chips);
// Set for attribute for label
var label = $chips.next('label');
if (label.length) {
label.attr('for', chipId);
if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
label.addClass('active');
}
}
// Setup autocomplete if needed.
var input = $('#' + chipId);
if (self.hasAutocomplete) {
curr_options.autocompleteOptions.onAutocomplete = function (val) {
self.addChip({ tag: val }, $chips);
input.val('');
input.focus();
};
input.autocomplete(curr_options.autocompleteOptions);
}
};
/**
* Render chip jQuery element.
* @param {Object} elem
* @return {jQuery}
*/
this.renderChip = function (elem) {
if (!elem.tag) return;
var $renderedChip = $('');
$renderedChip.text(elem.tag);
if (elem.image) {
$renderedChip.prepend($('').attr('src', elem.image));
}
$renderedChip.append($('close'));
return $renderedChip;
};
this.setPlaceholder = function ($chips) {
if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
$chips.find('input').prop('placeholder', curr_options.placeholder);
} else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
$chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
}
};
this.isValid = function ($chips, elem) {
var chips = $chips.data('chips');
var exists = false;
for (var i = 0; i < chips.length; i++) {
if (chips[i].tag === elem.tag) {
exists = true;
return;
}
}
return '' !== elem.tag && !exists;
};
this.addChip = function (elem, $chips) {
if (!self.isValid($chips, elem)) {
return;
}
var $renderedChip = self.renderChip(elem);
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
newData.push(oldData[i]);
}
newData.push(elem);
$chips.data('chips', newData);
$renderedChip.insertBefore($chips.find('input'));
$chips.trigger('chip.add', elem);
self.setPlaceholder($chips);
};
this.deleteChip = function (chipIndex, $chips) {
var chip = $chips.data('chips')[chipIndex];
$chips.find('.chip').eq(chipIndex).remove();
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
if (i !== chipIndex) {
newData.push(oldData[i]);
}
}
$chips.data('chips', newData);
$chips.trigger('chip.delete', chip);
self.setPlaceholder($chips);
};
this.selectChip = function (chipIndex, $chips) {
var $chip = $chips.find('.chip').eq(chipIndex);
if ($chip && false === $chip.hasClass('selected')) {
$chip.addClass('selected');
$chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
}
};
this.getChipsElement = function (index, $chips) {
return $chips.eq(index);
};
// init
this.init();
this.handleEvents();
};
})(jQuery);
;(function ($) {
$.fn.pushpin = function (options) {
// Defaults
var defaults = {
top: 0,
bottom: Infinity,
offset: 0
};
// Remove pushpin event and classes
if (options === "remove") {
this.each(function () {
if (id = $(this).data('pushpin-id')) {
$(window).off('scroll.' + id);
$(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
}
});
return false;
}
options = $.extend(defaults, options);
$index = 0;
return this.each(function () {
var $uniqueId = Materialize.guid(),
$this = $(this),
$original_offset = $(this).offset().top;
function removePinClasses(object) {
object.removeClass('pin-top');
object.removeClass('pinned');
object.removeClass('pin-bottom');
}
function updateElements(objects, scrolled) {
objects.each(function () {
// Add position fixed (because its between top and bottom)
if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
removePinClasses($(this));
$(this).css('top', options.offset);
$(this).addClass('pinned');
}
// Add pin-top (when scrolled position is above top)
if (scrolled < options.top && !$(this).hasClass('pin-top')) {
removePinClasses($(this));
$(this).css('top', 0);
$(this).addClass('pin-top');
}
// Add pin-bottom (when scrolled position is below bottom)
if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
removePinClasses($(this));
$(this).addClass('pin-bottom');
$(this).css('top', options.bottom - $original_offset);
}
});
}
$(this).data('pushpin-id', $uniqueId);
updateElements($this, $(window).scrollTop());
$(window).on('scroll.' + $uniqueId, function () {
var $scrolled = $(window).scrollTop() + options.offset;
updateElements($this, $scrolled);
});
});
};
})(jQuery);;(function ($) {
$(document).ready(function () {
// jQuery reverse
$.fn.reverse = [].reverse;
// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
$(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
openFABMenu($this);
});
$(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
closeFABMenu($this);
});
// Toggle-on-click behaviour.
$(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
if ($menu.hasClass('active')) {
closeFABMenu($menu);
} else {
openFABMenu($menu);
}
});
// Toolbar transition behaviour.
$(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
FABtoToolbar($menu);
});
});
$.fn.extend({
openFAB: function () {
openFABMenu($(this));
},
closeFAB: function () {
closeFABMenu($(this));
},
openToolbar: function () {
FABtoToolbar($(this));
},
closeToolbar: function () {
toolbarToFAB($(this));
}
});
var openFABMenu = function (btn) {
var $this = btn;
if ($this.hasClass('active') === false) {
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.addClass('active');
$this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
var time = 0;
$this.find('ul .btn-floating').reverse().each(function () {
$(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
time += 40;
});
}
};
var closeFABMenu = function (btn) {
var $this = btn;
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.removeClass('active');
var time = 0;
$this.find('ul .btn-floating').velocity("stop", true);
$this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
};
/**
* Transform FAB into toolbar
* @param {Object} object jQuery object
*/
var FABtoToolbar = function (btn) {
if (btn.attr('data-open') === "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnRect = btn[0].getBoundingClientRect();
var anchor = btn.find('> a').first();
var menu = btn.find('> ul').first();
var backdrop = $('');
var fabColor = anchor.css('background-color');
anchor.append(backdrop);
offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
offsetY = windowHeight - btnRect.bottom;
scaleFactor = windowWidth / backdrop.width();
btn.attr('data-origin-bottom', btnRect.bottom);
btn.attr('data-origin-left', btnRect.left);
btn.attr('data-origin-width', btnRect.width);
// Set initial state
btn.addClass('active');
btn.attr('data-open', true);
btn.css({
'text-align': 'center',
width: '100%',
bottom: 0,
left: 0,
transform: 'translateX(' + offsetX + 'px)',
transition: 'none'
});
anchor.css({
transform: 'translateY(' + -offsetY + 'px)',
transition: 'none'
});
backdrop.css({
'background-color': fabColor
});
setTimeout(function () {
btn.css({
transform: '',
transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
});
anchor.css({
overflow: 'visible',
transform: '',
transition: 'transform .2s'
});
setTimeout(function () {
btn.css({
overflow: 'hidden',
'background-color': fabColor
});
backdrop.css({
transform: 'scale(' + scaleFactor + ')',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
menu.find('> li > a').css({
opacity: 1
});
// Scroll to close.
$(window).on('scroll.fabToolbarClose', function () {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
});
$(document).on('click.fabToolbarClose', function (e) {
if (!$(e.target).closest(menu).length) {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
}
});
}, 100);
}, 0);
};
/**
* Transform toolbar back into FAB
* @param {Object} object jQuery object
*/
var toolbarToFAB = function (btn) {
if (btn.attr('data-open') !== "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnWidth = btn.attr('data-origin-width');
var btnBottom = btn.attr('data-origin-bottom');
var btnLeft = btn.attr('data-origin-left');
var anchor = btn.find('> .btn-floating').first();
var menu = btn.find('> ul').first();
var backdrop = btn.find('.fab-backdrop');
var fabColor = anchor.css('background-color');
offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
offsetY = windowHeight - btnBottom;
scaleFactor = windowWidth / backdrop.width();
// Hide backdrop
btn.removeClass('active');
btn.attr('data-open', false);
btn.css({
'background-color': 'transparent',
transition: 'none'
});
anchor.css({
transition: 'none'
});
backdrop.css({
transform: 'scale(0)',
'background-color': fabColor
});
menu.find('> li > a').css({
opacity: ''
});
setTimeout(function () {
backdrop.remove();
// Set initial state.
btn.css({
'text-align': '',
width: '',
bottom: '',
left: '',
overflow: '',
'background-color': '',
transform: 'translate3d(' + -offsetX + 'px,0,0)'
});
anchor.css({
overflow: '',
transform: 'translate3d(0,' + offsetY + 'px,0)'
});
setTimeout(function () {
btn.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s'
});
anchor.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
}, 20);
}, 200);
};
})(jQuery);
;(function ($) {
// Image transition function
Materialize.fadeInImage = function (selectorOrEl) {
var element;
if (typeof selectorOrEl === 'string') {
element = $(selectorOrEl);
} else if (typeof selectorOrEl === 'object') {
element = selectorOrEl;
} else {
return;
}
element.css({ opacity: 0 });
$(element).velocity({ opacity: 1 }, {
duration: 650,
queue: false,
easing: 'easeOutSine'
});
$(element).velocity({ opacity: 1 }, {
duration: 1300,
queue: false,
easing: 'swing',
step: function (now, fx) {
fx.start = 100;
var grayscale_setting = now / 100;
var brightness_setting = 150 - (100 - now) / 1.75;
if (brightness_setting < 100) {
brightness_setting = 100;
}
if (now >= 0) {
$(this).css({
"-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
"filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
});
}
}
});
};
// Horizontal staggered list
Materialize.showStaggeredList = function (selectorOrEl) {
var element;
if (typeof selectorOrEl === 'string') {
element = $(selectorOrEl);
} else if (typeof selectorOrEl === 'object') {
element = selectorOrEl;
} else {
return;
}
var time = 0;
element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
element.find('li').each(function () {
$(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
time += 120;
});
};
$(document).ready(function () {
// Hardcoded .staggered-list scrollFire
// var staggeredListOptions = [];
// $('ul.staggered-list').each(function (i) {
// var label = 'scrollFire-' + i;
// $(this).addClass(label);
// staggeredListOptions.push(
// {selector: 'ul.staggered-list.' + label,
// offset: 200,
// callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
// });
// scrollFire(staggeredListOptions);
// HammerJS, Swipe navigation
// Touch Event
var swipeLeft = false;
var swipeRight = false;
// Dismissible Collections
$('.dismissable').each(function () {
$(this).hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
var $this = $(this);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
$this.velocity({ translateX: x
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
// Swipe Left
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
swipeLeft = true;
}
// Swipe Right
if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
swipeRight = true;
}
}
}).on('panend', function (e) {
// Reset if collection is moved back into original position
if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
swipeRight = false;
swipeLeft = false;
}
if (e.gesture.pointerType === "touch") {
var $this = $(this);
if (swipeLeft || swipeRight) {
var fullWidth;
if (swipeLeft) {
fullWidth = $this.innerWidth();
} else {
fullWidth = -1 * $this.innerWidth();
}
$this.velocity({ translateX: fullWidth
}, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
$this.css('border', 'none');
$this.velocity({ height: 0, padding: 0
}, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
$this.remove();
}
});
}
});
} else {
$this.velocity({ translateX: 0
}, { duration: 100, queue: false, easing: 'easeOutQuad' });
}
swipeLeft = false;
swipeRight = false;
}
});
});
// time = 0
// // Vertical Staggered list
// $('ul.staggered-list.vertical li').velocity(
// { translateY: "100px"},
// { duration: 0 });
// $('ul.staggered-list.vertical li').each(function() {
// $(this).velocity(
// { opacity: "1", translateY: "0"},
// { duration: 800, delay: time, easing: [60, 25] });
// time += 120;
// });
// // Fade in and Scale
// $('.fade-in.scale').velocity(
// { scaleX: .4, scaleY: .4, translateX: -600},
// { duration: 0});
// $('.fade-in').each(function() {
// $(this).velocity(
// { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
// { duration: 800, easing: [60, 10] });
// });
});
})(jQuery);
;(function ($) {
var scrollFireEventsHandled = false;
// Input: Array of JSON objects {selector, offset, callback}
Materialize.scrollFire = function (options) {
var onScroll = function () {
var windowScroll = window.pageYOffset + window.innerHeight;
for (var i = 0; i < options.length; i++) {
// Get options from each line
var value = options[i];
var selector = value.selector,
offset = value.offset,
callback = value.callback;
var currentElement = document.querySelector(selector);
if (currentElement !== null) {
var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
if (windowScroll > elementOffset + offset) {
if (value.done !== true) {
if (typeof callback === 'function') {
callback.call(this, currentElement);
} else if (typeof callback === 'string') {
var callbackFunc = new Function(callback);
callbackFunc(currentElement);
}
value.done = true;
}
}
}
}
};
var throttledScroll = Materialize.throttle(function () {
onScroll();
}, options.throttle || 100);
if (!scrollFireEventsHandled) {
window.addEventListener("scroll", throttledScroll);
window.addEventListener("resize", throttledScroll);
scrollFireEventsHandled = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(throttledScroll, 0);
};
})(jQuery);
; /*!
* pickadate.js v3.5.0, 2014/04/13
* By Amsul, http://amsul.ca
* Hosted on http://amsul.github.io/pickadate.js
* Licensed under MIT
*/
(function (factory) {
Materialize.Picker = factory(jQuery);
})(function ($) {
var $window = $(window);
var $document = $(document);
var $html = $(document.documentElement);
/**
* The picker constructor that creates a blank picker.
*/
function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
// If there’s no element, return the picker constructor.
if (!ELEMENT) return PickerConstructor;
var IS_DEFAULT_THEME = false,
// The state of the picker.
STATE = {
id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
},
// Merge the defaults and options passed.
SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
// Merge the default classes with the settings classes.
CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
// The element node wrapper into a jQuery object.
$ELEMENT = $(ELEMENT),
// Pseudo picker constructor.
PickerInstance = function () {
return this.start();
},
// The picker prototype.
P = PickerInstance.prototype = {
constructor: PickerInstance,
$node: $ELEMENT,
/**
* Initialize everything
*/
start: function () {
// If it’s already started, do nothing.
if (STATE && STATE.start) return P;
// Update the picker states.
STATE.methods = {};
STATE.start = true;
STATE.open = false;
STATE.type = ELEMENT.type;
// Confirm focus state, convert into text input to remove UA stylings,
// and set as readonly to prevent keyboard popup.
ELEMENT.autofocus = ELEMENT == getActiveElement();
ELEMENT.readOnly = !SETTINGS.editable;
ELEMENT.id = ELEMENT.id || STATE.id;
if (ELEMENT.type != 'text') {
ELEMENT.type = 'text';
}
// Create a new picker component with the settings.
P.component = new COMPONENT(P, SETTINGS);
// Create the picker root with a holder and then prepare it.
P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
prepareElementRoot();
// If there’s a format for the hidden input element, create the element.
if (SETTINGS.formatSubmit) {
prepareElementHidden();
}
// Prepare the input element.
prepareElement();
// Insert the root as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
// Bind the default component and settings events.
P.on({
start: P.component.onStart,
render: P.component.onRender,
stop: P.component.onStop,
open: P.component.onOpen,
close: P.component.onClose,
set: P.component.onSet
}).on({
start: SETTINGS.onStart,
render: SETTINGS.onRender,
stop: SETTINGS.onStop,
open: SETTINGS.onOpen,
close: SETTINGS.onClose,
set: SETTINGS.onSet
});
// Once we’re all set, check the theme in use.
IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
// If the element has autofocus, open the picker.
if (ELEMENT.autofocus) {
P.open();
}
// Trigger queued the “start” and “render” events.
return P.trigger('start').trigger('render');
}, //start
/**
* Render a new picker
*/
render: function (entireComponent) {
// Insert a new component holder in the root or box.
if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
// Trigger the queued “render” events.
return P.trigger('render');
}, //render
/**
* Destroy everything
*/
stop: function () {
// If it’s already stopped, do nothing.
if (!STATE.start) return P;
// Then close the picker.
P.close();
// Remove the hidden field.
if (P._hidden) {
P._hidden.parentNode.removeChild(P._hidden);
}
// Remove the root.
P.$root.remove();
// Remove the input class, remove the stored data, and unbind
// the events (after a tick for IE - see `P.close`).
$ELEMENT.removeClass(CLASSES.input).removeData(NAME);
setTimeout(function () {
$ELEMENT.off('.' + STATE.id);
}, 0);
// Restore the element state
ELEMENT.type = STATE.type;
ELEMENT.readOnly = false;
// Trigger the queued “stop” events.
P.trigger('stop');
// Reset the picker states.
STATE.methods = {};
STATE.start = false;
return P;
}, //stop
/**
* Open up the picker
*/
open: function (dontGiveFocus) {
// If it’s already open, do nothing.
if (STATE.open) return P;
// Add the “active” class.
$ELEMENT.addClass(CLASSES.active);
aria(ELEMENT, 'expanded', true);
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So add the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Add the “opened” class to the picker root.
P.$root.addClass(CLASSES.opened);
aria(P.$root[0], 'hidden', false);
}, 0);
// If we have to give focus, bind the element and doc events.
if (dontGiveFocus !== false) {
// Set it as open.
STATE.open = true;
// Prevent the page from scrolling.
if (IS_DEFAULT_THEME) {
$html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
}
// Pass focus to the root element’s jQuery object.
// * Workaround for iOS8 to bring the picker’s root into view.
P.$root.eq(0).focus();
// Bind the document events.
$document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
var target = event.target;
// If the target of the event is not the element, close the picker picker.
// * Don’t worry about clicks or focusins on the root because those don’t bubble up.
// Also, for Firefox, a click on an `option` element bubbles up directly
// to the doc. So make sure the target wasn't the doc.
// * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
// which causes the picker to unexpectedly close when right-clicking it. So make
// sure the event wasn’t a right-click.
if (target != ELEMENT && target != document && event.which != 3) {
// If the target was the holder that covers the screen,
// keep the element focused to maintain tabindex.
P.close(target === P.$root.children()[0]);
}
}).on('keydown.' + STATE.id, function (event) {
var
// Get the keycode.
keycode = event.keyCode,
// Translate that to a selection change.
keycodeToMove = P.component.key[keycode],
// Grab the target.
target = event.target;
// On escape, close the picker and give focus.
if (keycode == 27) {
P.close(true);
}
// Check if there is a key movement or “enter” keypress on the element.
else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
// Prevent the default action to stop page movement.
event.preventDefault();
// Trigger the key movement action.
if (keycodeToMove) {
PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
}
// On “enter”, if the highlighted item isn’t disabled, set the value and close.
else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
P.set('select', P.component.item.highlight);
if (SETTINGS.closeOnSelect) {
P.close(true);
}
}
}
// If the target is within the root and “enter” is pressed,
// prevent the default action and trigger a click on the target instead.
else if ($.contains(P.$root[0], target) && keycode == 13) {
event.preventDefault();
target.click();
}
});
}
// Trigger the queued “open” events.
return P.trigger('open');
}, //open
/**
* Close the picker
*/
close: function (giveFocus) {
// If we need to give focus, do it before changing states.
if (giveFocus) {
// ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
// The focus is triggered *after* the close has completed - causing it
// to open again. So unbind and rebind the event at the next tick.
P.$root.off('focus.toOpen').eq(0).focus();
setTimeout(function () {
P.$root.on('focus.toOpen', handleFocusToOpenEvent);
}, 0);
}
// Remove the “active” class.
$ELEMENT.removeClass(CLASSES.active);
aria(ELEMENT, 'expanded', false);
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So remove the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Remove the “opened” and “focused” class from the picker root.
P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
aria(P.$root[0], 'hidden', true);
}, 0);
// If it’s already closed, do nothing more.
if (!STATE.open) return P;
// Set it as closed.
STATE.open = false;
// Allow the page to scroll.
if (IS_DEFAULT_THEME) {
$html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
}
// Unbind the document events.
$document.off('.' + STATE.id);
// Trigger the queued “close” events.
return P.trigger('close');
}, //close
/**
* Clear the values
*/
clear: function (options) {
return P.set('clear', null, options);
}, //clear
/**
* Set something
*/
set: function (thing, value, options) {
var thingItem,
thingValue,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {};
// Make sure we have usable options.
options = thingIsObject && $.isPlainObject(value) ? value : options || {};
if (thing) {
// If the thing isn’t an object, make it one.
if (!thingIsObject) {
thingObject[thing] = value;
}
// Go through the things of items to set.
for (thingItem in thingObject) {
// Grab the value of the thing.
thingValue = thingObject[thingItem];
// First, if the item exists and there’s a value, set it.
if (thingItem in P.component.item) {
if (thingValue === undefined) thingValue = null;
P.component.set(thingItem, thingValue, options);
}
// Then, check to update the element value and broadcast a change.
if (thingItem == 'select' || thingItem == 'clear') {
$ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
}
}
// Render a new picker.
P.render();
}
// When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
return options.muted ? P : P.trigger('set', thingObject);
}, //set
/**
* Get something
*/
get: function (thing, format) {
// Make sure there’s something to get.
thing = thing || 'value';
// If a picker state exists, return that.
if (STATE[thing] != null) {
return STATE[thing];
}
// Return the submission value, if that.
if (thing == 'valueSubmit') {
if (P._hidden) {
return P._hidden.value;
}
thing = 'value';
}
// Return the value, if that.
if (thing == 'value') {
return ELEMENT.value;
}
// Check if a component item exists, return that.
if (thing in P.component.item) {
if (typeof format == 'string') {
var thingValue = P.component.get(thing);
return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
}
return P.component.get(thing);
}
}, //get
/**
* Bind events on the things.
*/
on: function (thing, method, internal) {
var thingName,
thingMethod,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {};
if (thing) {
// If the thing isn’t an object, make it one.
if (!thingIsObject) {
thingObject[thing] = method;
}
// Go through the things to bind to.
for (thingName in thingObject) {
// Grab the method of the thing.
thingMethod = thingObject[thingName];
// If it was an internal binding, prefix it.
if (internal) {
thingName = '_' + thingName;
}
// Make sure the thing methods collection exists.
STATE.methods[thingName] = STATE.methods[thingName] || [];
// Add the method to the relative method collection.
STATE.methods[thingName].push(thingMethod);
}
}
return P;
}, //on
/**
* Unbind events on the things.
*/
off: function () {
var i,
thingName,
names = arguments;
for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
thingName = names[i];
if (thingName in STATE.methods) {
delete STATE.methods[thingName];
}
}
return P;
},
/**
* Fire off method events.
*/
trigger: function (name, data) {
var _trigger = function (name) {
var methodList = STATE.methods[name];
if (methodList) {
methodList.map(function (method) {
PickerConstructor._.trigger(method, P, [data]);
});
}
};
_trigger('_' + name);
_trigger(name);
return P;
} //trigger
//PickerInstance.prototype
/**
* Wrap the picker holder components together.
*/
};function createWrappedComponent() {
// Create a picker wrapper holder
return PickerConstructor._.node('div',
// Create a picker wrapper node
PickerConstructor._.node('div',
// Create a picker frame
PickerConstructor._.node('div',
// Create a picker box node
PickerConstructor._.node('div',
// Create the components nodes.
P.component.nodes(STATE.open),
// The picker box class
CLASSES.box),
// Picker wrap class
CLASSES.wrap),
// Picker frame class
CLASSES.frame),
// Picker holder class
CLASSES.holder); //endreturn
} //createWrappedComponent
/**
* Prepare the input element with all bindings.
*/
function prepareElement() {
$ELEMENT.
// Store the picker data by component name.
data(NAME, P).
// Add the “input” class name.
addClass(CLASSES.input).
// Remove the tabindex.
attr('tabindex', -1).
// If there’s a `data-value`, update the value of the element.
val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
// Only bind keydown events if the element isn’t editable.
if (!SETTINGS.editable) {
$ELEMENT.
// On focus/click, focus onto the root to open it up.
on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
event.preventDefault();
P.$root.eq(0).focus();
}).
// Handle keyboard event based on the picker being opened or not.
on('keydown.' + STATE.id, handleKeydownEvent);
}
// Update the aria attributes.
aria(ELEMENT, {
haspopup: true,
expanded: false,
readonly: false,
owns: ELEMENT.id + '_root'
});
}
/**
* Prepare the root picker element with all bindings.
*/
function prepareElementRoot() {
P.$root.on({
// For iOS8.
keydown: handleKeydownEvent,
// When something within the root is focused, stop from bubbling
// to the doc and remove the “focused” state from the root.
focusin: function (event) {
P.$root.removeClass(CLASSES.focused);
event.stopPropagation();
},
// When something within the root holder is clicked, stop it
// from bubbling to the doc.
'mousedown click': function (event) {
var target = event.target;
// Make sure the target isn’t the root holder so it can bubble up.
if (target != P.$root.children()[0]) {
event.stopPropagation();
// * For mousedown events, cancel the default action in order to
// prevent cases where focus is shifted onto external elements
// when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
// Also, for Firefox, don’t prevent action on the `option` element.
if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
event.preventDefault();
// Re-focus onto the root so that users can click away
// from elements focused within the picker.
P.$root.eq(0).focus();
}
}
}
}).
// Add/remove the “target” class on focus and blur.
on({
focus: function () {
$ELEMENT.addClass(CLASSES.target);
},
blur: function () {
$ELEMENT.removeClass(CLASSES.target);
}
}).
// Open the picker and adjust the root “focused” state
on('focus.toOpen', handleFocusToOpenEvent).
// If there’s a click on an actionable element, carry out the actions.
on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
var $target = $(this),
targetData = $target.data(),
targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
// * For IE, non-focusable elements can be active elements as well
// (http://stackoverflow.com/a/2684561).
activeElement = getActiveElement();
activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;
// If it’s disabled or nothing inside is actively focused, re-focus the element.
if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
P.$root.eq(0).focus();
}
// If something is superficially changed, update the `highlight` based on the `nav`.
if (!targetDisabled && targetData.nav) {
P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
}
// If something is picked, set `select` then close with focus.
else if (!targetDisabled && 'pick' in targetData) {
P.set('select', targetData.pick);
if (SETTINGS.closeOnSelect) {
P.close(true);
}
}
// If a “clear” button is pressed, empty the values and close with focus.
else if (targetData.clear) {
P.clear();
if (SETTINGS.closeOnSelect) {
P.close(true);
}
} else if (targetData.close) {
P.close(true);
}
}); //P.$root
aria(P.$root[0], 'hidden', true);
}
/**
* Prepare the hidden input element along with all bindings.
*/
function prepareElementHidden() {
var name;
if (SETTINGS.hiddenName === true) {
name = ELEMENT.name;
ELEMENT.name = '';
} else {
name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
name = name[0] + ELEMENT.name + name[1];
}
P._hidden = $('')[0];
$ELEMENT.
// If the value changes, update the hidden input with the correct format.
on('change.' + STATE.id, function () {
P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
});
// Insert the hidden input as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
}
// For iOS8.
function handleKeydownEvent(event) {
var keycode = event.keyCode,
// Check if one of the delete keys was pressed.
isKeycodeDelete = /^(8|46)$/.test(keycode);
// For some reason IE clears the input value on “escape”.
if (keycode == 27) {
P.close();
return false;
}
// Check if `space` or `delete` was pressed or the picker is closed with a key movement.
if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
// Prevent it from moving the page and bubbling to doc.
event.preventDefault();
event.stopPropagation();
// If `delete` was pressed, clear the values and close the picker.
// Otherwise open the picker.
if (isKeycodeDelete) {
P.clear().close();
} else {
P.open();
}
}
}
// Separated for IE
function handleFocusToOpenEvent(event) {
// Stop the event from propagating to the doc.
event.stopPropagation();
// If it’s a focus event, add the “focused” class to the root.
if (event.type == 'focus') {
P.$root.addClass(CLASSES.focused);
}
// And then finally open the picker.
P.open();
}
// Return a new picker instance.
return new PickerInstance();
} //PickerConstructor
/**
* The default classes and prefix to use for the HTML classes.
*/
PickerConstructor.klasses = function (prefix) {
prefix = prefix || 'picker';
return {
picker: prefix,
opened: prefix + '--opened',
focused: prefix + '--focused',
input: prefix + '__input',
active: prefix + '__input--active',
target: prefix + '__input--target',
holder: prefix + '__holder',
frame: prefix + '__frame',
wrap: prefix + '__wrap',
box: prefix + '__box'
};
}; //PickerConstructor.klasses
/**
* Check if the default theme is being used.
*/
function isUsingDefaultTheme(element) {
var theme,
prop = 'position';
// For IE.
if (element.currentStyle) {
theme = element.currentStyle[prop];
}
// For normal browsers.
else if (window.getComputedStyle) {
theme = getComputedStyle(element)[prop];
}
return theme == 'fixed';
}
/**
* Get the width of the browser’s scrollbar.
* Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
*/
function getScrollbarWidth() {
if ($html.height() <= $window.height()) {
return 0;
}
var $outer = $('').appendTo('body');
// Get the width without scrollbars.
var widthWithoutScroll = $outer[0].offsetWidth;
// Force adding scrollbars.
$outer.css('overflow', 'scroll');
// Add the inner div.
var $inner = $('').appendTo($outer);
// Get the width with scrollbars.
var widthWithScroll = $inner[0].offsetWidth;
// Remove the divs.
$outer.remove();
// Return the difference between the widths.
return widthWithoutScroll - widthWithScroll;
}
/**
* PickerConstructor helper methods.
*/
PickerConstructor._ = {
/**
* Create a group of nodes. Expects:
* `
{
min: {Integer},
max: {Integer},
i: {Integer},
node: {String},
item: {Function}
}
* `
*/
group: function (groupObject) {
var
// Scope for the looped object
loopObjectScope,
// Create the nodes list
nodesList = '',
// The counter starts from the `min`
counter = PickerConstructor._.trigger(groupObject.min, groupObject);
// Loop from the `min` to `max`, incrementing by `i`
for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
// Trigger the `item` function within scope of the object
loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
// Splice the subgroup and create nodes out of the sub nodes
nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
loopObjectScope[1], // the classes
loopObjectScope[2] // the attributes
);
}
// Return the list of nodes
return nodesList;
}, //group
/**
* Create a dom node string
*/
node: function (wrapper, item, klass, attribute) {
// If the item is false-y, just return an empty string
if (!item) return '';
// If the item is an array, do a join
item = $.isArray(item) ? item.join('') : item;
// Check for the class
klass = klass ? ' class="' + klass + '"' : '';
// Check for any attributes
attribute = attribute ? ' ' + attribute : '';
// Return the wrapped item
return '<' + wrapper + klass + attribute + '>' + item + '' + wrapper + '>';
}, //node
/**
* Lead numbers below 10 with a zero.
*/
lead: function (number) {
return (number < 10 ? '0' : '') + number;
},
/**
* Trigger a function otherwise return the value.
*/
trigger: function (callback, scope, args) {
return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
},
/**
* If the second character is a digit, length is 2 otherwise 1.
*/
digits: function (string) {
return (/\d/.test(string[1]) ? 2 : 1
);
},
/**
* Tell if something is a date object.
*/
isDate: function (value) {
return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
},
/**
* Tell if something is an integer.
*/
isInteger: function (value) {
return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
},
/**
* Create ARIA attribute strings.
*/
ariaAttr: ariaAttr //PickerConstructor._
/**
* Extend the picker with a component and defaults.
*/
};PickerConstructor.extend = function (name, Component) {
// Extend jQuery.
$.fn[name] = function (options, action) {
// Grab the component data.
var componentData = this.data(name);
// If the picker is requested, return the data object.
if (options == 'picker') {
return componentData;
}
// If the component data exists and `options` is a string, carry out the action.
if (componentData && typeof options == 'string') {
return PickerConstructor._.trigger(componentData[options], componentData, [action]);
}
// Otherwise go through each matched element and if the component
// doesn’t exist, create a new picker using `this` element
// and merging the defaults and options with a deep copy.
return this.each(function () {
var $this = $(this);
if (!$this.data(name)) {
new PickerConstructor(this, name, Component, options);
}
});
};
// Set the defaults.
$.fn[name].defaults = Component.defaults;
}; //PickerConstructor.extend
function aria(element, attribute, value) {
if ($.isPlainObject(attribute)) {
for (var key in attribute) {
ariaSet(element, key, attribute[key]);
}
} else {
ariaSet(element, attribute, value);
}
}
function ariaSet(element, attribute, value) {
element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
}
function ariaAttr(attribute, data) {
if (!$.isPlainObject(attribute)) {
attribute = { attribute: data };
}
data = '';
for (var key in attribute) {
var attr = (key == 'role' ? '' : 'aria-') + key,
attrVal = attribute[key];
data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
}
return data;
}
// IE8 bug throws an error for activeElements within iframes.
function getActiveElement() {
try {
return document.activeElement;
} catch (err) {}
}
// Expose the picker constructor.
return PickerConstructor;
});
; /*!
* Date picker for pickadate.js v3.5.0
* http://amsul.github.io/pickadate.js/date.htm
*/
(function (factory) {
factory(Materialize.Picker, jQuery);
})(function (Picker, $) {
/**
* Globals and constants
*/
var DAYS_IN_WEEK = 7,
WEEKS_IN_CALENDAR = 6,
_ = Picker._;
/**
* The date picker constructor
*/
function DatePicker(picker, settings) {
var calendar = this,
element = picker.$node[0],
elementValue = element.value,
elementDataValue = picker.$node.data('value'),
valueString = elementDataValue || elementValue,
formatString = elementDataValue ? settings.formatSubmit : settings.format,
isRTL = function () {
return element.currentStyle ?
// For IE.
element.currentStyle.direction == 'rtl' :
// For normal browsers.
getComputedStyle(picker.$root[0]).direction == 'rtl';
};
calendar.settings = settings;
calendar.$node = picker.$node;
// The queue of methods that will be used to build item objects.
calendar.queue = {
min: 'measure create',
max: 'measure create',
now: 'now create',
select: 'parse create validate',
highlight: 'parse navigate create validate',
view: 'parse create validate viewset',
disable: 'deactivate',
enable: 'activate'
// The component's item object.
};calendar.item = {};
calendar.item.clear = null;
calendar.item.disable = (settings.disable || []).slice(0);
calendar.item.enable = -function (collectionDisabled) {
return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
}(calendar.item.disable);
calendar.set('min', settings.min).set('max', settings.max).set('now');
// When there’s a value, set the `select`, which in turn
// also sets the `highlight` and `view`.
if (valueString) {
calendar.set('select', valueString, { format: formatString });
}
// If there’s no value, default to highlighting “today”.
else {
calendar.set('select', null).set('highlight', calendar.item.now);
}
// The keycode to movement mapping.
calendar.key = {
40: 7, // Down
38: -7, // Up
39: function () {
return isRTL() ? -1 : 1;
}, // Right
37: function () {
return isRTL() ? 1 : -1;
}, // Left
go: function (timeChange) {
var highlightedObject = calendar.item.highlight,
targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
calendar.set('highlight', targetDate, { interval: timeChange });
this.render();
}
// Bind some picker events.
};picker.on('render', function () {
picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
var value = this.value;
if (value) {
picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
}
});
picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
var value = this.value;
if (value) {
picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
}
});
}, 1).on('open', function () {
var includeToday = '';
if (calendar.disabled(calendar.get('now'))) {
includeToday = ':not(.' + settings.klass.buttonToday + ')';
}
picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
}, 1).on('close', function () {
picker.$root.find('button, select').attr('disabled', true);
}, 1);
} //DatePicker
/**
* Set a datepicker item object.
*/
DatePicker.prototype.set = function (type, value, options) {
var calendar = this,
calendarItem = calendar.item;
// If the value is `null` just set it immediately.
if (value === null) {
if (type == 'clear') type = 'select';
calendarItem[type] = value;
return calendar;
}
// Otherwise go through the queue of methods, and invoke the functions.
// Update this as the time unit, and set the final value as this item.
// * In the case of `enable`, keep the queue but set `disable` instead.
// And in the case of `flip`, keep the queue but set `enable` instead.
calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
value = calendar[method](type, value, options);
return value;
}).pop();
// Check if we need to cascade through more updates.
if (type == 'select') {
calendar.set('highlight', calendarItem.select, options);
} else if (type == 'highlight') {
calendar.set('view', calendarItem.highlight, options);
} else if (type.match(/^(flip|min|max|disable|enable)$/)) {
if (calendarItem.select && calendar.disabled(calendarItem.select)) {
calendar.set('select', calendarItem.select, options);
}
if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
calendar.set('highlight', calendarItem.highlight, options);
}
}
return calendar;
}; //DatePicker.prototype.set
/**
* Get a datepicker item object.
*/
DatePicker.prototype.get = function (type) {
return this.item[type];
}; //DatePicker.prototype.get
/**
* Create a picker date object.
*/
DatePicker.prototype.create = function (type, value, options) {
var isInfiniteValue,
calendar = this;
// If there’s no value, use the type as the value.
value = value === undefined ? type : value;
// If it’s infinity, update the value.
if (value == -Infinity || value == Infinity) {
isInfiniteValue = value;
}
// If it’s an object, use the native date object.
else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
value = value.obj;
}
// If it’s an array, convert it into a date and make sure
// that it’s a valid date – otherwise default to today.
else if ($.isArray(value)) {
value = new Date(value[0], value[1], value[2]);
value = _.isDate(value) ? value : calendar.create().obj;
}
// If it’s a number or date object, make a normalized date.
else if (_.isInteger(value) || _.isDate(value)) {
value = calendar.normalize(new Date(value), options);
}
// If it’s a literal true or any other case, set it to now.
else /*if ( value === true )*/{
value = calendar.now(type, value, options);
}
// Return the compiled object.
return {
year: isInfiniteValue || value.getFullYear(),
month: isInfiniteValue || value.getMonth(),
date: isInfiniteValue || value.getDate(),
day: isInfiniteValue || value.getDay(),
obj: isInfiniteValue || value,
pick: isInfiniteValue || value.getTime()
};
}; //DatePicker.prototype.create
/**
* Create a range limit object using an array, date object,
* literal “true”, or integer relative to another time.
*/
DatePicker.prototype.createRange = function (from, to) {
var calendar = this,
createDate = function (date) {
if (date === true || $.isArray(date) || _.isDate(date)) {
return calendar.create(date);
}
return date;
};
// Create objects if possible.
if (!_.isInteger(from)) {
from = createDate(from);
}
if (!_.isInteger(to)) {
to = createDate(to);
}
// Create relative dates.
if (_.isInteger(from) && $.isPlainObject(to)) {
from = [to.year, to.month, to.date + from];
} else if (_.isInteger(to) && $.isPlainObject(from)) {
to = [from.year, from.month, from.date + to];
}
return {
from: createDate(from),
to: createDate(to)
};
}; //DatePicker.prototype.createRange
/**
* Check if a date unit falls within a date range object.
*/
DatePicker.prototype.withinRange = function (range, dateUnit) {
range = this.createRange(range.from, range.to);
return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
};
/**
* Check if two date range objects overlap.
*/
DatePicker.prototype.overlapRanges = function (one, two) {
var calendar = this;
// Convert the ranges into comparable dates.
one = calendar.createRange(one.from, one.to);
two = calendar.createRange(two.from, two.to);
return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
};
/**
* Get the date today.
*/
DatePicker.prototype.now = function (type, value, options) {
value = new Date();
if (options && options.rel) {
value.setDate(value.getDate() + options.rel);
}
return this.normalize(value, options);
};
/**
* Navigate to next/prev month.
*/
DatePicker.prototype.navigate = function (type, value, options) {
var targetDateObject,
targetYear,
targetMonth,
targetDate,
isTargetArray = $.isArray(value),
isTargetObject = $.isPlainObject(value),
viewsetObject = this.item.view; /*,
safety = 100*/
if (isTargetArray || isTargetObject) {
if (isTargetObject) {
targetYear = value.year;
targetMonth = value.month;
targetDate = value.date;
} else {
targetYear = +value[0];
targetMonth = +value[1];
targetDate = +value[2];
}
// If we’re navigating months but the view is in a different
// month, navigate to the view’s year and month.
if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
targetYear = viewsetObject.year;
targetMonth = viewsetObject.month;
}
// Figure out the expected target year and month.
targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
targetYear = targetDateObject.getFullYear();
targetMonth = targetDateObject.getMonth();
// If the month we’re going to doesn’t have enough days,
// keep decreasing the date until we reach the month’s last date.
while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
targetDate -= 1;
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
}*/
}
value = [targetYear, targetMonth, targetDate];
}
return value;
}; //DatePicker.prototype.navigate
/**
* Normalize a date by setting the hours to midnight.
*/
DatePicker.prototype.normalize = function (value /*, options*/) {
value.setHours(0, 0, 0, 0);
return value;
};
/**
* Measure the range of dates.
*/
DatePicker.prototype.measure = function (type, value /*, options*/) {
var calendar = this;
// If it’s anything false-y, remove the limits.
if (!value) {
value = type == 'min' ? -Infinity : Infinity;
}
// If it’s a string, parse it.
else if (typeof value == 'string') {
value = calendar.parse(type, value);
}
// If it's an integer, get a date relative to today.
else if (_.isInteger(value)) {
value = calendar.now(type, value, { rel: value });
}
return value;
}; ///DatePicker.prototype.measure
/**
* Create a viewset object based on navigation.
*/
DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
return this.create([dateObject.year, dateObject.month, 1]);
};
/**
* Validate a date as enabled and shift if needed.
*/
DatePicker.prototype.validate = function (type, dateObject, options) {
var calendar = this,
// Keep a reference to the original date.
originalDateObject = dateObject,
// Make sure we have an interval.
interval = options && options.interval ? options.interval : 1,
// Check if the calendar enabled dates are inverted.
isFlippedBase = calendar.item.enable === -1,
// Check if we have any enabled dates after/before now.
hasEnabledBeforeTarget,
hasEnabledAfterTarget,
// The min & max limits.
minLimitObject = calendar.item.min,
maxLimitObject = calendar.item.max,
// Check if we’ve reached the limit during shifting.
reachedMin,
reachedMax,
// Check if the calendar is inverted and at least one weekday is enabled.
hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
// If there’s a date, check where it is relative to the target.
if ($.isArray(value)) {
var dateTime = calendar.create(value).pick;
if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
}
// Return only integers for enabled weekdays.
return _.isInteger(value);
}).length; /*,
safety = 100*/
// Cases to validate for:
// [1] Not inverted and date disabled.
// [2] Inverted and some dates enabled.
// [3] Not inverted and out of range.
//
// Cases to **not** validate for:
// • Navigating months.
// • Not inverted and date enabled.
// • Inverted and all dates disabled.
// • ..and anything else.
if (!options || !options.nav) if (
/* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
/* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
/* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
// When inverted, flip the direction if there aren’t any enabled weekdays
// and there are no enabled dates in the direction of the interval.
if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
interval *= -1;
}
// Keep looping until we reach an enabled date.
while ( /*safety &&*/calendar.disabled(dateObject)) {
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
}*/
// If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
dateObject = originalDateObject;
interval = interval > 0 ? 1 : -1;
}
// If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
if (dateObject.pick <= minLimitObject.pick) {
reachedMin = true;
interval = 1;
dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
} else if (dateObject.pick >= maxLimitObject.pick) {
reachedMax = true;
interval = -1;
dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
}
// If we’ve reached both limits, just break out of the loop.
if (reachedMin && reachedMax) {
break;
}
// Finally, create the shifted date using the interval and keep looping.
dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
}
} //endif
// Return the date object settled on.
return dateObject;
}; //DatePicker.prototype.validate
/**
* Check if a date is disabled.
*/
DatePicker.prototype.disabled = function (dateToVerify) {
var calendar = this,
// Filter through the disabled dates to check if this is one.
isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
// If the date is a number, match the weekday with 0index and `firstDay` check.
if (_.isInteger(dateToDisable)) {
return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
}
// If it’s an array or a native JS date, create and match the exact date.
if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
return dateToVerify.pick === calendar.create(dateToDisable).pick;
}
// If it’s an object, match a date within the “from” and “to” range.
if ($.isPlainObject(dateToDisable)) {
return calendar.withinRange(dateToDisable, dateToVerify);
}
});
// If this date matches a disabled date, confirm it’s not inverted.
isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
}).length;
// Check the calendar “enabled” flag and respectively flip the
// disabled state. Then also check if it’s beyond the min/max limits.
return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
}; //DatePicker.prototype.disabled
/**
* Parse a string into a usable type.
*/
DatePicker.prototype.parse = function (type, value, options) {
var calendar = this,
parsingObject = {};
// If it’s already parsed, we’re good.
if (!value || typeof value != 'string') {
return value;
}
// We need a `.format` to parse the value with.
if (!(options && options.format)) {
options = options || {};
options.format = calendar.settings.format;
}
// Convert the format into an array and then map through it.
calendar.formats.toArray(options.format).map(function (label) {
var
// Grab the formatting label.
formattingLabel = calendar.formats[label],
// The format length is from the formatting label function or the
// label length without the escaping exclamation (!) mark.
formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
// If there's a format label, split the value up to the format length.
// Then add it to the parsing object with appropriate label.
if (formattingLabel) {
parsingObject[label] = value.substr(0, formatLength);
}
// Update the value as the substring from format length to end.
value = value.substr(formatLength);
});
// Compensate for month 0index.
return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
}; //DatePicker.prototype.parse
/**
* Various formats to display the object in.
*/
DatePicker.prototype.formats = function () {
// Return the length of the first word in a collection.
function getWordLengthFromCollection(string, collection, dateObject) {
// Grab the first word from the string.
var word = string.match(/\w+/)[0];
// If there's no month index, add it to the date object
if (!dateObject.mm && !dateObject.m) {
dateObject.m = collection.indexOf(word) + 1;
}
// Return the length of the word.
return word.length;
}
// Get the length of the first word in a string.
function getFirstWordLength(string) {
return string.match(/\w+/)[0].length;
}
return {
d: function (string, dateObject) {
// If there's string, then get the digits length.
// Otherwise return the selected date.
return string ? _.digits(string) : dateObject.date;
},
dd: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected date with a leading zero.
return string ? 2 : _.lead(dateObject.date);
},
ddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the short selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
},
dddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the full selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
},
m: function (string, dateObject) {
// If there's a string, then get the length of the digits
// Otherwise return the selected month with 0index compensation.
return string ? _.digits(string) : dateObject.month + 1;
},
mm: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected month with 0index and leading zero.
return string ? 2 : _.lead(dateObject.month + 1);
},
mmm: function (string, dateObject) {
var collection = this.settings.monthsShort;
// If there's a string, get length of the relevant month from the short
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
},
mmmm: function (string, dateObject) {
var collection = this.settings.monthsFull;
// If there's a string, get length of the relevant month from the full
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
},
yy: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected year by slicing out the first 2 digits.
return string ? 2 : ('' + dateObject.year).slice(2);
},
yyyy: function (string, dateObject) {
// If there's a string, then the length is always 4.
// Otherwise return the selected year.
return string ? 4 : dateObject.year;
},
// Create an array by splitting the formatting string passed.
toArray: function (formatString) {
return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
},
// Format an object into a string using the formatting options.
toString: function (formatString, itemObject) {
var calendar = this;
return calendar.formats.toArray(formatString).map(function (label) {
return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
}).join('');
}
};
}(); //DatePicker.prototype.formats
/**
* Check if two date units are the exact.
*/
DatePicker.prototype.isDateExact = function (one, two) {
var calendar = this;
// When we’re working with weekdays, do a direct comparison.
if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
return one === two;
}
// When we’re working with date representations, compare the “pick” value.
if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
return calendar.create(one).pick === calendar.create(two).pick;
}
// When we’re working with range objects, compare the “from” and “to”.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
}
return false;
};
/**
* Check if two date units overlap.
*/
DatePicker.prototype.isDateOverlap = function (one, two) {
var calendar = this,
firstDay = calendar.settings.firstDay ? 1 : 0;
// When we’re working with a weekday index, compare the days.
if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
one = one % 7 + firstDay;
return one === calendar.create(two).day + 1;
}
if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
two = two % 7 + firstDay;
return two === calendar.create(one).day + 1;
}
// When we’re working with range objects, check if the ranges overlap.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.overlapRanges(one, two);
}
return false;
};
/**
* Flip the “enabled” state.
*/
DatePicker.prototype.flipEnable = function (val) {
var itemObject = this.item;
itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
};
/**
* Mark a collection of dates as “disabled”.
*/
DatePicker.prototype.deactivate = function (type, datesToDisable) {
var calendar = this,
disabledItems = calendar.item.disable.slice(0);
// If we’re flipping, that’s all we need to do.
if (datesToDisable == 'flip') {
calendar.flipEnable();
} else if (datesToDisable === false) {
calendar.flipEnable(1);
disabledItems = [];
} else if (datesToDisable === true) {
calendar.flipEnable(-1);
disabledItems = [];
}
// Otherwise go through the dates to disable.
else {
datesToDisable.map(function (unitToDisable) {
var matchFound;
// When we have disabled items, check for matches.
// If something is matched, immediately break out.
for (var index = 0; index < disabledItems.length; index += 1) {
if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
matchFound = true;
break;
}
}
// If nothing was found, add the validated unit to the collection.
if (!matchFound) {
if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
disabledItems.push(unitToDisable);
}
}
});
}
// Return the updated collection.
return disabledItems;
}; //DatePicker.prototype.deactivate
/**
* Mark a collection of dates as “enabled”.
*/
DatePicker.prototype.activate = function (type, datesToEnable) {
var calendar = this,
disabledItems = calendar.item.disable,
disabledItemsCount = disabledItems.length;
// If we’re flipping, that’s all we need to do.
if (datesToEnable == 'flip') {
calendar.flipEnable();
} else if (datesToEnable === true) {
calendar.flipEnable(1);
disabledItems = [];
} else if (datesToEnable === false) {
calendar.flipEnable(-1);
disabledItems = [];
}
// Otherwise go through the disabled dates.
else {
datesToEnable.map(function (unitToEnable) {
var matchFound, disabledUnit, index, isExactRange;
// Go through the disabled items and try to find a match.
for (index = 0; index < disabledItemsCount; index += 1) {
disabledUnit = disabledItems[index];
// When an exact match is found, remove it from the collection.
if (calendar.isDateExact(disabledUnit, unitToEnable)) {
matchFound = disabledItems[index] = null;
isExactRange = true;
break;
}
// When an overlapped match is found, add the “inverted” state to it.
else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
if ($.isPlainObject(unitToEnable)) {
unitToEnable.inverted = true;
matchFound = unitToEnable;
} else if ($.isArray(unitToEnable)) {
matchFound = unitToEnable;
if (!matchFound[3]) matchFound.push('inverted');
} else if (_.isDate(unitToEnable)) {
matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
}
break;
}
}
// If a match was found, remove a previous duplicate entry.
if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
disabledItems[index] = null;
break;
}
}
// In the event that we’re dealing with an exact range of dates,
// make sure there are no “inverted” dates because of it.
if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
disabledItems[index] = null;
break;
}
}
// If something is still matched, add it into the collection.
if (matchFound) {
disabledItems.push(matchFound);
}
});
}
// Return the updated collection.
return disabledItems.filter(function (val) {
return val != null;
});
}; //DatePicker.prototype.activate
/**
* Create a string for the nodes in the picker.
*/
DatePicker.prototype.nodes = function (isOpen) {
var calendar = this,
settings = calendar.settings,
calendarItem = calendar.item,
nowObject = calendarItem.now,
selectedObject = calendarItem.select,
highlightedObject = calendarItem.highlight,
viewsetObject = calendarItem.view,
disabledCollection = calendarItem.disable,
minLimitObject = calendarItem.min,
maxLimitObject = calendarItem.max,
// Create the calendar table head using a copy of weekday labels collection.
// * We do a copy so we don't mutate the original array.
tableHead = function (collection, fullCollection) {
// If the first day should be Monday, move Sunday to the end.
if (settings.firstDay) {
collection.push(collection.shift());
fullCollection.push(fullCollection.shift());
}
// Create and return the table head group.
return _.node('thead', _.node('tr', _.group({
min: 0,
max: DAYS_IN_WEEK - 1,
i: 1,
node: 'th',
item: function (counter) {
return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
}
}))); //endreturn
// Materialize modified
}((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
//tableHead
// Create the nav for next/prev month.
createMonthNav = function (next) {
// Otherwise, return the created month tag.
return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
// If the focused month is outside the range, disabled the button.
next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
role: 'button',
controls: calendar.$node[0].id + '_table'
}) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
},
//createMonthNav
// Create the month label.
//Materialize modified
createMonthLabel = function (override) {
var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
// Materialize modified
if (override == "short_months") {
monthsCollection = settings.monthsShort;
}
// If there are months to select, add a dropdown menu.
if (settings.selectMonths && override == undefined) {
return _.node('select', _.group({
min: 0,
max: 11,
i: 1,
node: 'option',
item: function (loopedMonth) {
return [
// The looped month and no classes.
monthsCollection[loopedMonth], 0,
// Set the value and selected index.
'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
}
}), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
}
// Materialize modified
if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
// If there's a need for a month selector
return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
},
//createMonthLabel
// Create the year label.
// Materialize modified
createYearLabel = function (override) {
var focusedYear = viewsetObject.year,
// If years selector is set to a literal "true", set it to 5. Otherwise
// divide in half to get half before and half after focused year.
numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
// If there are years to select, add a dropdown menu.
if (numberYears) {
var minYear = minLimitObject.year,
maxYear = maxLimitObject.year,
lowestYear = focusedYear - numberYears,
highestYear = focusedYear + numberYears;
// If the min year is greater than the lowest year, increase the highest year
// by the difference and set the lowest year to the min year.
if (minYear > lowestYear) {
highestYear += minYear - lowestYear;
lowestYear = minYear;
}
// If the max year is less than the highest year, decrease the lowest year
// by the lower of the two: available and needed years. Then set the
// highest year to the max year.
if (maxYear < highestYear) {
var availableYears = lowestYear - minYear,
neededYears = highestYear - maxYear;
lowestYear -= availableYears > neededYears ? neededYears : availableYears;
highestYear = maxYear;
}
if (settings.selectYears && override == undefined) {
return _.node('select', _.group({
min: lowestYear,
max: highestYear,
i: 1,
node: 'option',
item: function (loopedYear) {
return [
// The looped year and no classes.
loopedYear, 0,
// Set the value and selected index.
'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
}
}), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
}
}
// Materialize modified
if (override === 'raw' && selectedObject != null) {
return _.node('div', selectedObject.year);
}
// Otherwise just return the year focused
return _.node('div', focusedYear, settings.klass.year);
}; //createYearLabel
// Materialize modified
createDayLabel = function () {
if (selectedObject != null) return selectedObject.date;else return nowObject.date;
};
createWeekdayLabel = function () {
var display_day;
if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
var weekday = settings.weekdaysShort[display_day];
return weekday;
};
// Create and return the entire calendar.
return _.node(
// Date presentation View
'div', _.node(
// Div for Year
'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
// Div for short Month
'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
// Div for Day
'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
// Calendar container
_.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
min: 0,
max: WEEKS_IN_CALENDAR - 1,
i: 1,
node: 'tr',
item: function (rowCounter) {
// If Monday is the first day and the month starts on Sunday, shift the date back a week.
var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
return [_.group({
min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
max: function () {
return this.min + DAYS_IN_WEEK - 1;
},
i: 1,
node: 'td',
item: function (targetDate) {
// Convert the time date from a relative date to a target date.
targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
return [_.node('div', targetDate.date, function (klasses) {
// Add the `infocus` or `outfocus` classes based on month in view.
klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
// Add the `today` class if needed.
if (nowObject.pick == targetDate.pick) {
klasses.push(settings.klass.now);
}
// Add the `selected` class if something's selected and the time matches.
if (isSelected) {
klasses.push(settings.klass.selected);
}
// Add the `highlighted` class if something's highlighted and the time matches.
if (isHighlighted) {
klasses.push(settings.klass.highlighted);
}
// Add the `disabled` class if something's disabled and the object matches.
if (isDisabled) {
klasses.push(settings.klass.disabled);
}
return klasses.join(' ');
}([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
role: 'gridcell',
label: formattedDate,
selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
activedescendant: isHighlighted ? true : null,
disabled: isDisabled ? true : null
}) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
}
})]; //endreturn
}
})), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
role: 'grid',
controls: calendar.$node[0].id,
readonly: true
})), settings.klass.calendar_container) // end calendar
+
// * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
_.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
}; //DatePicker.prototype.nodes
/**
* The date picker defaults.
*/
DatePicker.defaults = function (prefix) {
return {
// The title label to use for the month nav buttons
labelMonthNext: 'Next month',
labelMonthPrev: 'Previous month',
// The title label to use for the dropdown selectors
labelMonthSelect: 'Select a month',
labelYearSelect: 'Select a year',
// Months and weekdays
monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
// Materialize modified
weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
// Today and clear
today: 'Today',
clear: 'Clear',
close: 'Ok',
// Picker close behavior (Prevent a change in behaviour for backwards compatibility)
closeOnSelect: false,
// The format to show on the `input` element
format: 'd mmmm, yyyy',
// Classes
klass: {
table: prefix + 'table',
header: prefix + 'header',
// Materialize Added klasses
date_display: prefix + 'date-display',
day_display: prefix + 'day-display',
month_display: prefix + 'month-display',
year_display: prefix + 'year-display',
calendar_container: prefix + 'calendar-container',
// end
navPrev: prefix + 'nav--prev',
navNext: prefix + 'nav--next',
navDisabled: prefix + 'nav--disabled',
month: prefix + 'month',
year: prefix + 'year',
selectMonth: prefix + 'select--month',
selectYear: prefix + 'select--year',
weekdays: prefix + 'weekday',
day: prefix + 'day',
disabled: prefix + 'day--disabled',
selected: prefix + 'day--selected',
highlighted: prefix + 'day--highlighted',
now: prefix + 'day--today',
infocus: prefix + 'day--infocus',
outfocus: prefix + 'day--outfocus',
footer: prefix + 'footer',
buttonClear: prefix + 'button--clear',
buttonToday: prefix + 'button--today',
buttonClose: prefix + 'button--close'
}
};
}(Picker.klasses().picker + '__');
/**
* Extend the picker to add the date picker.
*/
Picker.extend('pickadate', DatePicker);
});
; /*!
* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
* Copyright 2014 Wang Shenwei.
* Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
*
* Further modified
* Copyright 2015 Ching Yaw Hao.
*/
(function ($) {
var $win = $(window),
$doc = $(document);
// Can I use inline svg ?
var svgNS = 'http://www.w3.org/2000/svg',
svgSupported = 'SVGAngle' in window && function () {
var supported,
el = document.createElement('div');
el.innerHTML = '';
supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
el.innerHTML = '';
return supported;
}();
// Can I use transition ?
var transitionSupported = function () {
var style = document.createElement('div').style;
return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
}();
// Listen touch events in touch screen device, instead of mouse events in desktop.
var touchSupported = 'ontouchstart' in window,
mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
// Vibrate the device if supported
var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
function createSvgElement(name) {
return document.createElementNS(svgNS, name);
}
function leadingZero(num) {
return (num < 10 ? '0' : '') + num;
}
// Get a unique id
var idCounter = 0;
function uniqueId(prefix) {
var id = ++idCounter + '';
return prefix ? prefix + id : id;
}
// Clock size
var dialRadius = 135,
outerRadius = 105,
// innerRadius = 80 on 12 hour clock
innerRadius = 70,
tickRadius = 20,
diameter = dialRadius * 2,
duration = transitionSupported ? 350 : 1;
// Popover template
var tpl = ['