thedesk/app/js/common/materialize.js

10023 lines
359 KiB
JavaScript
Raw Normal View History

2018-01-31 01:43:01 +09:00
//Warning!!: This is edited by CutlsP. It's not raw file.
2018-01-28 21:22:43 +09:00
/*!
* Materialize v0.100.2 (http://materializecss.com)
* Copyright 2014-2017 Materialize
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
*/
var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }();
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
// Check for jQuery.
if (typeof jQuery === 'undefined') {
// Check if require is a defined function.
if (typeof require === 'function') {
jQuery = $ = require('jquery');
// Else use the dollar sign alias.
} else {
jQuery = $;
}
}
; /*
* jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
* Open source under the BSD License.
* Copyright © 2008 George McGinley Smith
* All rights reserved.
* https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
*/
(function (factory) {
if (typeof define === "function" && define.amd) {
define(['jquery'], function ($) {
return factory($);
});
} else if (typeof module === "object" && typeof module.exports === "object") {
exports = factory(require('jquery'));
} else {
factory(jQuery);
}
})(function ($) {
// Preserve the original jQuery "swing" easing as "jswing"
$.easing['jswing'] = $.easing['swing'];
var pow = Math.pow,
sqrt = Math.sqrt,
sin = Math.sin,
cos = Math.cos,
PI = Math.PI,
c1 = 1.70158,
c2 = c1 * 1.525,
c3 = c1 + 1,
c4 = 2 * PI / 3,
c5 = 2 * PI / 4.5;
// x is the fraction of animation progress, in the range 0..1
function bounceOut(x) {
var n1 = 7.5625,
d1 = 2.75;
if (x < 1 / d1) {
return n1 * x * x;
} else if (x < 2 / d1) {
return n1 * (x -= 1.5 / d1) * x + .75;
} else if (x < 2.5 / d1) {
return n1 * (x -= 2.25 / d1) * x + .9375;
} else {
return n1 * (x -= 2.625 / d1) * x + .984375;
}
}
$.extend($.easing, {
def: 'easeOutQuad',
swing: function (x) {
return $.easing[$.easing.def](x);
},
easeInQuad: function (x) {
return x * x;
},
easeOutQuad: function (x) {
return 1 - (1 - x) * (1 - x);
},
easeInOutQuad: function (x) {
return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2;
},
easeInCubic: function (x) {
return x * x * x;
},
easeOutCubic: function (x) {
return 1 - pow(1 - x, 3);
},
easeInOutCubic: function (x) {
return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2;
},
easeInQuart: function (x) {
return x * x * x * x;
},
easeOutQuart: function (x) {
return 1 - pow(1 - x, 4);
},
easeInOutQuart: function (x) {
return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2;
},
easeInQuint: function (x) {
return x * x * x * x * x;
},
easeOutQuint: function (x) {
return 1 - pow(1 - x, 5);
},
easeInOutQuint: function (x) {
return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2;
},
easeInSine: function (x) {
return 1 - cos(x * PI / 2);
},
easeOutSine: function (x) {
return sin(x * PI / 2);
},
easeInOutSine: function (x) {
return -(cos(PI * x) - 1) / 2;
},
easeInExpo: function (x) {
return x === 0 ? 0 : pow(2, 10 * x - 10);
},
easeOutExpo: function (x) {
return x === 1 ? 1 : 1 - pow(2, -10 * x);
},
easeInOutExpo: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2;
},
easeInCirc: function (x) {
return 1 - sqrt(1 - pow(x, 2));
},
easeOutCirc: function (x) {
return sqrt(1 - pow(x - 1, 2));
},
easeInOutCirc: function (x) {
return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2;
},
easeInElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4);
},
easeOutElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1;
},
easeInOutElastic: function (x) {
return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1;
},
easeInBack: function (x) {
return c3 * x * x * x - c1 * x * x;
},
easeOutBack: function (x) {
return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2);
},
easeInOutBack: function (x) {
return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2;
},
easeInBounce: function (x) {
return 1 - bounceOut(1 - x);
},
easeOutBounce: bounceOut,
easeInOutBounce: function (x) {
return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2;
}
});
});; // Custom Easing
jQuery.extend(jQuery.easing, {
easeInOutMaterial: function (x, t, b, c, d) {
if ((t /= d / 2) < 1) return c / 2 * t * t + b;
return c / 4 * ((t -= 2) * t * t + 2) + b;
}
});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) {
function t(e) {
var t = e.length,
a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e;
}if (!e.jQuery) {
var r = function (e, t) {
return new r.fn.init(e, t);
};r.isWindow = function (e) {
return null != e && e == e.window;
}, r.type = function (e) {
return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e;
}, r.isArray = Array.isArray || function (e) {
return "array" === r.type(e);
}, r.isPlainObject = function (e) {
var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try {
if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1;
} catch (a) {
return !1;
}for (t in e) {}return void 0 === t || o.call(e, t);
}, r.each = function (e, r, a) {
var n,
o = 0,
i = e.length,
s = t(e);if (a) {
if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) {
if (n = r.apply(e[o], a), n === !1) break;
}
} else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) {
if (n = r.call(e[o], o, e[o]), n === !1) break;
}return e;
}, r.data = function (e, t, n) {
if (void 0 === n) {
var o = e[r.expando],
i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t];
} else if (void 0 !== t) {
var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n;
}
}, r.removeData = function (e, t) {
var n = e[r.expando],
o = n && a[n];o && r.each(t, function (e, t) {
delete o[t];
});
}, r.extend = function () {
var e,
t,
a,
n,
o,
i,
s = arguments[0] || {},
l = 1,
u = arguments.length,
c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) {
if (null != (o = arguments[l])) for (n in o) {
e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a));
}
}return s;
}, r.queue = function (e, a, n) {
function o(e, r) {
var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) {
for (var r = +t.length, a = 0, n = e.length; r > a;) {
e[n++] = t[a++];
}if (r !== r) for (; void 0 !== t[a];) {
e[n++] = t[a++];
}return e.length = n, e;
}(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a;
}if (e) {
a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || [];
}
}, r.dequeue = function (e, t) {
r.each(e.nodeType ? [e] : e, function (e, a) {
t = t || "fx";var n = r.queue(a, t),
o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () {
r.dequeue(a, t);
}));
});
}, r.fn = r.prototype = { init: function (e) {
if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node.");
}, offset: function () {
var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) };
}, position: function () {
function e() {
for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) {
e = e.offsetParent;
}return e || document;
}var t = this[0],
e = e.apply(t),
a = this.offset(),
n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left };
} };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) {
n["[object " + s[l] + "]"] = s[l].toLowerCase();
}r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r };
}
}(window), function (e) {
"object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e();
}(function () {
return function (e, t, r, a) {
function n(e) {
for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) {
var n = e[t];n && a.push(n);
}return a;
}function o(e) {
return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e;
}function i(e) {
var t = f.data(e, "velocity");return null === t ? a : t;
}function s(e) {
return function (t) {
return Math.round(t * e) * (1 / e);
};
}function l(e, r, a, n) {
function o(e, t) {
return 1 - 3 * t + 3 * e;
}function i(e, t) {
return 3 * t - 6 * e;
}function s(e) {
return 3 * e;
}function l(e, t, r) {
return ((o(t, r) * e + i(t, r)) * e + s(t)) * e;
}function u(e, t, r) {
return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t);
}function c(t, r) {
for (var n = 0; m > n; ++n) {
var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o;
}return r;
}function p() {
for (var t = 0; b > t; ++t) {
w[t] = l(t * x, e, a);
}
}function f(t, r, n) {
var o,
i,
s = 0;do {
i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i;
} while (Math.abs(o) > h && ++s < v);return i;
}function d(t) {
for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) {
r += x;
}--n;var i = (t - w[n]) / (w[n + 1] - w[n]),
s = r + i * x,
l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x);
}function g() {
V = !0, (e != r || a != n) && p();
}var m = 4,
y = .001,
h = 1e-7,
v = 10,
b = 11,
x = 1 / (b - 1),
S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) {
if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1;
}e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b),
V = !1,
C = function (t) {
return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n);
};C.getControlPoints = function () {
return [{ x: e, y: r }, { x: a, y: n }];
};var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () {
return T;
}, C;
}function u(e, t) {
var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r;
}function c(e) {
if (e) {
var t = new Date().getTime(),
r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) {
if (b.State.calls[o]) {
var s = b.State.calls[o],
l = s[0],
u = s[2],
d = s[3],
g = !!d,
y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) {
var P = l[v],
V = P.element;if (i(V)) {
var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) {
if ("flex" === u.display) {
var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) {
S.setPropertyValue(V, "display", t);
});
}S.setPropertyValue(V, "display", u.display);
}u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) {
if ("element" !== k) {
var A,
F = P[k],
j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else {
var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue;
}if (F.currentValue = A, "tween" === k) y = A;else {
if (S.Hooks.registered[k]) {
var H = S.Hooks.getRoot(k),
N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N);
}var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0);
}
}
}u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V);
}
}u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o);
}
}
}b.State.isTicking && w(c);
}function p(e, t) {
if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) {
var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) {
i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) {
var r = /^scale/.test(t) ? 1 : 0,
n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]);
}), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating");
}if (!t && o.complete && !o.loop && u === c - 1) try {
o.complete.call(n, n);
} catch (g) {
setTimeout(function () {
throw g;
}, 1);
}s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) {
/^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100);
}), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue);
}b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) {
if (b.State.calls[m] !== !1) {
l = !0;break;
}
}l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []);
}var f,
d = function () {
if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) {
var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e;
}return a;
}(),
g = function () {
var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) {
var r,
a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () {
t(a + r);
}, r);
};
}(),
m = { isString: function (e) {
return "string" == typeof e;
}, isArray: Array.isArray || function (e) {
return "[object Array]" === Object.prototype.toString.call(e);
}, isFunction: function (e) {
return "[object Function]" === Object.prototype.toString.call(e);
}, isNode: function (e) {
return e && e.nodeType;
}, isNodeList: function (e) {
return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0);
}, isWrapped: function (e) {
return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e));
}, isSVG: function (e) {
return t.SVGElement && e instanceof t.SVGElement;
}, isEmptyObject: function (e) {
for (var t in e) {
return !1;
}return !0;
} },
y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400,
v = "swing",
b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) {
f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} });
}, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () {
function e(e) {
return -e.tension * e.x - e.friction * e.v;
}function t(t, r, a) {
var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) };
}function r(r, a) {
var n = { dx: r.v, dv: e(r) },
o = t(r, .5 * a, n),
i = t(r, .5 * a, o),
s = t(r, a, i),
l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx),
u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r;
}return function a(e, t, n) {
var o,
i,
s,
l = { x: -1, v: 0, tension: null, friction: null },
u = [0],
c = 0,
p = 1e-4,
f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) {
return u[e * (u.length - 1) | 0];
} : c;
};
}();b.Easings = { linear: function (e) {
return e;
}, swing: function (e) {
return .5 - Math.cos(e * Math.PI) / 2;
}, spring: function (e) {
return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e);
} }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) {
b.Easings[t[0]] = l.apply(null, t[1]);
});var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () {
for (var e = 0; e < S.Lists.colors.length; e++) {
var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t];
}var r, a, n;if (d) for (r in S.Hooks.templates) {
a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]);
}for (r in S.Hooks.templates) {
a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) {
var i = r + n[e],
s = e;S.Hooks.registered[i] = [r, s];
}
}
}, getRoot: function (e) {
var t = S.Hooks.registered[e];return t ? t[0] : e;
}, cleanRootPropertyValue: function (e, t) {
return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t;
}, extractValue: function (e, t) {
var r = S.Hooks.registered[e];if (r) {
var a = r[0],
n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n];
}return t;
}, injectValue: function (e, t, r) {
var a = S.Hooks.registered[e];if (a) {
var n,
o,
i = a[0],
s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" ");
}return r;
} }, Normalizations: { registered: { clip: function (e, t, r) {
switch (e) {case "name":
return "clip";case "extract":
var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject":
return "rect(" + r + ")";}
}, blur: function (e, t, r) {
switch (e) {case "name":
return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract":
var a = parseFloat(r);if (!a && 0 !== a) {
var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0;
}return a;case "inject":
return parseFloat(r) ? "blur(" + r + ")" : "none";}
}, opacity: function (e, t, r) {
if (8 >= d) switch (e) {case "name":
return "filter";case "extract":
var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject":
return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name":
return "opacity";case "extract":
return r;case "inject":
return r;}
} }, register: function () {
9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) {
!function () {
var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) {
switch (e) {case "name":
return "transform";case "extract":
return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject":
var o = !1;switch (t.substr(0, t.length - 1)) {case "translate":
o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale":
b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew":
o = !/(deg|\d)$/i.test(n);break;case "rotate":
o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];}
};
}();
}for (var e = 0; e < S.Lists.colors.length; e++) {
!function () {
var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) {
switch (e) {case "name":
return t;case "extract":
var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else {
var i,
s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " ");
}return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject":
return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";}
};
}();
}
} }, Names: { camelCase: function (e) {
return e.replace(/-(\w)/g, function (e, t) {
return t.toUpperCase();
});
}, SVGAttribute: function (e) {
var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e);
}, prefixCheck: function (e) {
if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) {
var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) {
return e.toUpperCase();
}), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0];
}return [e, !1];
} }, Values: { hexToRgb: function (e) {
var t,
r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i,
a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) {
return t + t + r + r + a + a;
}), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0];
}, isCSSNullValue: function (e) {
return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e);
}, getUnitType: function (e) {
return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px"
);
}, getDisplayType: function (e) {
var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block"
);
}, addClass: function (e, t) {
e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t;
}, removeClass: function (e, t) {
e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " ");
} }, getPropertyValue: function (e, r, n, o) {
function s(e, r) {
function n() {
u && S.setPropertyValue(e, "display", "none");
}var l = 0;if (8 >= d) l = f.css(e, r);else {
var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) {
if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c;
}if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) {
var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p;
}
}var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n();
}if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) {
var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px");
}return l;
}var l;if (S.Hooks.registered[r]) {
var u = r,
c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n);
} else if (S.Normalizations.registered[r]) {
var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g);
}if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) {
if (/^(height|width)$/i.test(r)) try {
l = e.getBBox()[r];
} catch (m) {
l = 0;
} else l = e.getAttribute(r);
} else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l;
}, setPropertyValue: function (e, r, a, n, o) {
var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else {
if (S.Hooks.registered[r]) {
var l = r,
u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u;
}if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try {
e.style[s] = a;
} catch (c) {
b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]");
} else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a);
}return [s, a];
}, flushTransformCache: function (e) {
function t(t) {
return parseFloat(S.getPropertyValue(e, t));
}var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) {
var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) {
/^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]);
});
} else {
var n, o;f.each(i(e).transformCache, function (t) {
return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " "));
}), o && (r = "perspective" + o + " " + r);
}S.setPropertyValue(e, "transform", r);
} };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) {
var n = a;return e = o(e), f.each(e, function (e, o) {
if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else {
var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s;
}
}), n;
};var P = function () {
function e() {
return s ? k.promise || null : l;
}function n() {
function e(e) {
function p(e, t) {
var r = a,
n = a,
i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i];
}function d(e, t) {
var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) {
return r = e, "";
}), r || (r = S.Values.getUnitType(e)), [a, r];
}function h() {
var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") },
a = e.position === L.lastPosition && e.myParent === L.lastParent,
n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100,
l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else {
var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) {
b.CSS.setPropertyValue(u, t, "hidden");
}), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) {
b.CSS.setPropertyValue(u, t, s + "%");
}), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u);
}return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l;
}if (s.begin && 0 === V) try {
s.begin.call(g, g);
} catch (x) {
setTimeout(function () {
throw x;
}, 1);
}if ("scroll" === A) {
var P,
C,
T,
F = /^x$/i.test(s.axis) ? "Left" : "Top",
j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o);
} else if ("reverse" === A) {
if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) {
if ("element" !== H) {
var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o);
}
}l = E;
} else if ("start" === A) {
var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) {
if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) {
var r = p(t, !0),
n = r[0],
o = r[1],
i = r[2];if (S.RegEx.isHex.test(n)) {
for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) {
var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f;
}delete y[e];
}
}
});for (var z in y) {
var O = p(y[z]),
q = O[0],
$ = O[1],
M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z),
B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) {
(s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W,
G,
Y,
D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) {
return D = t, "";
}), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else {
n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%":
M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px":
break;default:
M *= n[Y + "ToPx"];}switch (G) {case "%":
M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px":
break;default:
M *= 1 / n[G + "ToPx"];}
}switch (D) {case "+":
q = M + q;break;case "-":
q = M - q;break;case "*":
q = M * q;break;case "/":
q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o);
} else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support.");
}l.element = o;
}l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++);
}var n,
o = this,
s = f.extend({}, b.defaults, v),
l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) {
b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e };
}), s.duration.toString().toLowerCase()) {case "fast":
s.duration = 200;break;case "normal":
s.duration = h;break;case "slow":
s.duration = 600;break;default:
s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) {
return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t));
}), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o);
}var s,
l,
d,
g,
y,
v,
x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) {
x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length,
V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) {
var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) {
m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T];
}
}var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) {
k.resolver = e, k.rejecter = t;
}));var A;switch (y) {case "scroll":
A = "scroll";break;case "reverse":
A = "reverse";break;case "finish":case "stop":
f.each(g, function (e, t) {
i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer);
});var F = [];return f.each(b.State.calls, function (e, t) {
t && f.each(t[1], function (r, n) {
var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) {
a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) {
m.isFunction(t) && t(null, !0);
}), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) {
t.endValue = t.currentValue;
}), F.push(e)) : "finish" === y && (t[2].duration = 1));
}) : !0;
});
}), "stop" === y && (f.each(F, function (e, t) {
p(t, !0);
}), k.promise && k.resolver(g)), e();default:
if (!f.isPlainObject(y) || m.isEmptyObject(y)) {
if (m.isString(y) && b.Redirects[y]) {
var j = f.extend({}, v),
E = j.duration,
H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) {
parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a);
}), e();
}var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e();
}A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null },
R = [];f.each(g, function (e, t) {
m.isNode(t) && n.call(t);
});var z,
j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) {
var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q);
}return e();
}
};b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () {
r.hidden ? (w = function (e) {
return setTimeout(function () {
e(!0);
}, 16);
}, c()) : w = t.requestAnimationFrame || g;
}), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) {
b.Redirects["slide" + t] = function (e, r, n, o, i, s) {
var l = f.extend({}, r),
u = l.begin,
c = l.complete,
p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" },
d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () {
u && u.call(i, i);for (var r in p) {
d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a];
}d.overflow = e.style.overflow, e.style.overflow = "hidden";
}, l.complete = function () {
for (var t in d) {
e.style[t] = d[t];
}c && c.call(i, i), s && s.resolver(i);
}, b(e, p, l);
};
}), f.each(["In", "Out"], function (e, t) {
b.Redirects["fade" + t] = function (e, r, n, o, i, s) {
var l = f.extend({}, r),
u = { opacity: "In" === t ? 1 : 0 },
c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () {
c && c.call(i, i), s && s.resolver(i);
}, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l);
};
}), b;
}(window.jQuery || window.Zepto || window, window, document);
}));
;!function (a, b, c, d) {
"use strict";
function k(a, b, c) {
return setTimeout(q(a, c), b);
}function l(a, b, c) {
return Array.isArray(a) ? (m(a, c[b], c), !0) : !1;
}function m(a, b, c) {
var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) {
b.call(c, a[e], e, a), e++;
} else for (e in a) {
a.hasOwnProperty(e) && b.call(c, a[e], e, a);
}
}function n(a, b, c) {
for (var e = Object.keys(b), f = 0; f < e.length;) {
(!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++;
}return a;
}function o(a, b) {
return n(a, b, !0);
}function p(a, b, c) {
var e,
d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c);
}function q(a, b) {
return function () {
return a.apply(b, arguments);
};
}function r(a, b) {
return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a;
}function s(a, b) {
return a === d ? b : a;
}function t(a, b, c) {
m(x(b), function (b) {
a.addEventListener(b, c, !1);
});
}function u(a, b, c) {
m(x(b), function (b) {
a.removeEventListener(b, c, !1);
});
}function v(a, b) {
for (; a;) {
if (a == b) return !0;a = a.parentNode;
}return !1;
}function w(a, b) {
return a.indexOf(b) > -1;
}function x(a) {
return a.trim().split(/\s+/g);
}function y(a, b, c) {
if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) {
if (c && a[d][c] == b || !c && a[d] === b) return d;d++;
}return -1;
}function z(a) {
return Array.prototype.slice.call(a, 0);
}function A(a, b, c) {
for (var d = [], e = [], f = 0; f < a.length;) {
var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++;
}return c && (d = b ? d.sort(function (a, c) {
return a[b] > c[b];
}) : d.sort()), d;
}function B(a, b) {
for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) {
if (c = e[h], f = c ? c + g : b, f in a) return f;h++;
}return d;
}function D() {
return C++;
}function E(a) {
var b = a.ownerDocument;return b.defaultView || b.parentWindow;
}function ab(a, b) {
var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) {
r(a.options.enable, [a]) && c.handler(b);
}, this.init();
}function bb(a) {
var b,
c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb);
}function cb(a, b, c) {
var d = c.pointers.length,
e = c.changedPointers.length,
f = b & O && 0 === d - e,
g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c;
}function db(a, b) {
var c = a.session,
d = b.pointers,
e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput,
g = c.firstMultiple,
h = g ? g.center : f.center,
i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k;
}function eb(a, b) {
var c = b.center,
d = a.offsetDelta || {},
e = a.prevDelta || {},
f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y);
}function fb(a, b) {
var f,
g,
h,
j,
c = a.lastInterval || b,
e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) {
var k = c.deltaX - b.deltaX,
l = c.deltaY - b.deltaY,
m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b;
} else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j;
}function gb(a) {
for (var b = [], c = 0; c < a.pointers.length;) {
b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++;
}return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY };
}function hb(a) {
var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) {
c += a[e].clientX, d += a[e].clientY, e++;
}return { x: h(c / b), y: h(d / b) };
}function ib(a, b, c) {
return { x: b / a || 0, y: c / a || 0 };
}function jb(a, b) {
return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W;
}function kb(a, b, c) {
c || (c = $);var d = b[c[0]] - a[c[0]],
e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e);
}function lb(a, b, c) {
c || (c = $);var d = b[c[0]] - a[c[0]],
e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI;
}function mb(a, b) {
return lb(b[1], b[0], _) - lb(a[1], a[0], _);
}function nb(a, b) {
return kb(b[0], b[1], _) / kb(a[0], a[1], _);
}function rb() {
this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments);
}function wb() {
this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = [];
}function Ab() {
this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments);
}function Bb(a, b) {
var c = z(a.touches),
d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d];
}function Eb() {
this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments);
}function Fb(a, b) {
var c = z(a.touches),
d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e,
f,
g = z(a.changedTouches),
h = [],
i = this.target;if (f = c.filter(function (a) {
return v(a.target, i);
}), b === O) for (e = 0; e < f.length;) {
d[f[e].identifier] = !0, e++;
}for (e = 0; e < g.length;) {
d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++;
}return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0;
}function Gb() {
ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a);
}function Pb(a, b) {
this.manager = a, this.set(b);
}function Qb(a) {
if (w(a, Mb)) return Mb;var b = w(a, Nb),
c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb;
}function Yb(a) {
this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = [];
}function Zb(a) {
return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : "";
}function $b(a) {
return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : "";
}function _b(a, b) {
var c = b.manager;return c ? c.get(a) : a;
}function ac() {
Yb.apply(this, arguments);
}function bc() {
ac.apply(this, arguments), this.pX = null, this.pY = null;
}function cc() {
ac.apply(this, arguments);
}function dc() {
Yb.apply(this, arguments), this._timer = null, this._input = null;
}function ec() {
ac.apply(this, arguments);
}function fc() {
ac.apply(this, arguments);
}function gc() {
Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0;
}function hc(a, b) {
return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b);
}function kc(a, b) {
b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) {
var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]);
}, this);
}function lc(a, b) {
var c = a.element;m(a.options.cssProps, function (a, d) {
c.style[B(c.style, d)] = b ? a : "";
});
}function mc(a, c) {
var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d);
}var e = ["", "webkit", "moz", "MS", "ms", "o"],
f = b.createElement("div"),
g = "function",
h = Math.round,
i = Math.abs,
j = Date.now,
C = 1,
F = /mobile|tablet|ip(ad|hone|od)|android/i,
G = "ontouchstart" in a,
H = B(a, "PointerEvent") !== d,
I = G && F.test(navigator.userAgent),
J = "touch",
K = "pen",
L = "mouse",
M = "kinect",
N = 25,
O = 1,
P = 2,
Q = 4,
R = 8,
S = 1,
T = 2,
U = 4,
V = 8,
W = 16,
X = T | U,
Y = V | W,
Z = X | Y,
$ = ["x", "y"],
_ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () {
this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler);
}, destroy: function () {
this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler);
} };var ob = { mousedown: O, mousemove: P, mouseup: Q },
pb = "mousedown",
qb = "mousemove mouseup";p(rb, ab, { handler: function (a) {
var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a }));
} });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R },
tb = { 2: J, 3: K, 4: L, 5: M },
ub = "pointerdown",
vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) {
var b = this.store,
c = !1,
d = a.type.toLowerCase().replace("ms", ""),
e = sb[d],
f = tb[a.pointerType] || a.pointerType,
g = f == J,
h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1));
} });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
yb = "touchstart",
zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) {
var b = xb[a.type];if (b === O && (this.started = !0), this.started) {
var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
}
} });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R },
Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) {
var b = Cb[a.type],
c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a });
} }), p(Gb, ab, { handler: function (a, b, c) {
var d = c.pointerType == J,
e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c);
}, destroy: function () {
this.touch.destroy(), this.mouse.destroy();
} });var Hb = B(f.style, "touchAction"),
Ib = Hb !== d,
Jb = "compute",
Kb = "auto",
Lb = "manipulation",
Mb = "none",
Nb = "pan-x",
Ob = "pan-y";Pb.prototype = { set: function (a) {
a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim();
}, update: function () {
this.set(this.manager.options.touchAction);
}, compute: function () {
var a = [];return m(this.manager.recognizers, function (b) {
r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction()));
}), Qb(a.join(" "));
}, preventDefaults: function (a) {
if (!Ib) {
var b = a.srcEvent,
c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions,
e = w(d, Mb),
f = w(d, Ob),
g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0;
}
}, preventSrc: function (a) {
this.manager.session.prevented = !0, a.preventDefault();
} };var Rb = 1,
Sb = 2,
Tb = 4,
Ub = 8,
Vb = Ub,
Wb = 16,
Xb = 32;Yb.prototype = { defaults: {}, set: function (a) {
return n(this.options, a), this.manager && this.manager.touchAction.update(), this;
}, recognizeWith: function (a) {
if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this;
}, dropRecognizeWith: function (a) {
return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this);
}, requireFailure: function (a) {
if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this;
}, dropRequireFailure: function (a) {
if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this;
}, hasRequireFailures: function () {
return this.requireFail.length > 0;
}, canRecognizeWith: function (a) {
return !!this.simultaneous[a.id];
}, emit: function (a) {
function d(d) {
b.manager.emit(b.options.event + (d ? Zb(c) : ""), a);
}var b = this,
c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0);
}, tryEmit: function (a) {
return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0);
}, canEmit: function () {
for (var a = 0; a < this.requireFail.length;) {
if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++;
}return !0;
}, recognize: function (a) {
var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0);
}, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) {
var b = this.options.pointers;return 0 === b || a.pointers.length === b;
}, process: function (a) {
var b = this.state,
c = a.eventType,
d = b & (Sb | Tb),
e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb;
} }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () {
var a = this.options.direction,
b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b;
}, directionTest: function (a) {
var b = this.options,
c = !0,
d = a.distance,
e = a.direction,
f = a.deltaX,
g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction;
}, attrTest: function (a) {
return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a));
}, emit: function (a) {
this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a);
} }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () {
return [Mb];
}, attrTest: function (a) {
return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb);
}, emit: function (a) {
if (this._super.emit.call(this, a), 1 !== a.scale) {
var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a);
}
} }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () {
return [Kb];
}, process: function (a) {
var b = this.options,
c = a.pointers.length === b.pointers,
d = a.distance < b.threshold,
e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () {
this.state = Vb, this.tryEmit();
}, b.time, this);else if (a.eventType & Q) return Vb;return Xb;
}, reset: function () {
clearTimeout(this._timer);
}, emit: function (a) {
this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input)));
} }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () {
return [Mb];
}, attrTest: function (a) {
return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb);
} }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () {
return bc.prototype.getTouchAction.call(this);
}, attrTest: function (a) {
var c,
b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q;
}, emit: function (a) {
var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a);
} }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () {
return [Lb];
}, process: function (a) {
var b = this.options,
c = a.pointers.length === b.pointers,
d = a.distance < b.threshold,
e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) {
if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0,
g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () {
this.state = Vb, this.tryEmit();
}, b.interval, this), Sb) : Vb;
}return Xb;
}, failTimeout: function () {
return this._timer = k(function () {
this.state = Xb;
}, this.options.interval, this), Xb;
}, reset: function () {
clearTimeout(this._timer);
}, emit: function () {
this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input));
} }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1,
jc = 2;kc.prototype = { set: function (a) {
return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this;
}, stop: function (a) {
this.session.stopped = a ? jc : ic;
}, recognize: function (a) {
var b = this.session;if (!b.stopped) {
this.touchAction.preventDefaults(a);var c,
d = this.recognizers,
e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) {
c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++;
}
}
}, get: function (a) {
if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) {
if (b[c].options.event == a) return b[c];
}return null;
}, add: function (a) {
if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a;
}, remove: function (a) {
if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this;
}, on: function (a, b) {
var c = this.handlers;return m(x(a), function (a) {
c[a] = c[a] || [], c[a].push(b);
}), this;
}, off: function (a, b) {
var c = this.handlers;return m(x(a), function (a) {
b ? c[a].splice(y(c[a], b), 1) : delete c[a];
}), this;
}, emit: function (a, b) {
this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) {
b.type = a, b.preventDefault = function () {
b.srcEvent.preventDefault();
};for (var d = 0; d < c.length;) {
c[d](b), d++;
}
}
}, destroy: function () {
this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null;
} }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () {
return hc;
}) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc;
}(window, document, "Hammer");;(function (factory) {
if (typeof define === 'function' && define.amd) {
define(['jquery', 'hammerjs'], factory);
} else if (typeof exports === 'object') {
factory(require('jquery'), require('hammerjs'));
} else {
factory(jQuery, Hammer);
}
})(function ($, Hammer) {
function hammerify(el, options) {
var $el = $(el);
if (!$el.data("hammer")) {
$el.data("hammer", new Hammer($el[0], options));
}
}
$.fn.hammer = function (options) {
return this.each(function () {
hammerify(this, options);
});
};
// extend the emit method to also trigger jQuery events
Hammer.Manager.prototype.emit = function (originalEmit) {
return function (type, data) {
originalEmit.call(this, type, data);
$(this.element).trigger({
type: type,
gesture: data
});
};
}(Hammer.Manager.prototype.emit);
});
; // Required for Meteor package, the use of window prevents export by Meteor
(function (window) {
if (window.Package) {
Materialize = {};
} else {
window.Materialize = {};
}
})(window);
if (typeof exports !== 'undefined' && !exports.nodeType) {
if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
exports = module.exports = Materialize;
}
exports.default = Materialize;
}
/*
* raf.js
* https://github.com/ngryman/raf.js
*
* original requestAnimationFrame polyfill by Erik Möller
* inspired from paul_irish gist and post
*
* Copyright (c) 2013 ngryman
* Licensed under the MIT license.
*/
(function (window) {
var lastTime = 0,
vendors = ['webkit', 'moz'],
requestAnimationFrame = window.requestAnimationFrame,
cancelAnimationFrame = window.cancelAnimationFrame,
i = vendors.length;
// try to un-prefix existing raf
while (--i >= 0 && !requestAnimationFrame) {
requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
}
// polyfill with setTimeout fallback
// heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
if (!requestAnimationFrame || !cancelAnimationFrame) {
requestAnimationFrame = function (callback) {
var now = +Date.now(),
nextTime = Math.max(lastTime + 16, now);
return setTimeout(function () {
callback(lastTime = nextTime);
}, nextTime - now);
};
cancelAnimationFrame = clearTimeout;
}
// export to window
window.requestAnimationFrame = requestAnimationFrame;
window.cancelAnimationFrame = cancelAnimationFrame;
})(window);
/**
* Generate approximated selector string for a jQuery object
* @param {jQuery} obj jQuery object to be parsed
* @returns {string}
*/
Materialize.objectSelectorString = function (obj) {
var tagStr = obj.prop('tagName') || '';
var idStr = obj.attr('id') || '';
var classStr = obj.attr('class') || '';
return (tagStr + idStr + classStr).replace(/\s/g, '');
};
// Unique Random ID
Materialize.guid = function () {
function s4() {
return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1);
}
return function () {
return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4();
};
}();
/**
* Escapes hash from special characters
* @param {string} hash String returned from this.hash
* @returns {string}
*/
Materialize.escapeHash = function (hash) {
return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1");
};
Materialize.elementOrParentIsFixed = function (element) {
var $element = $(element);
var $checkElements = $element.add($element.parents());
var isFixed = false;
$checkElements.each(function () {
if ($(this).css("position") === "fixed") {
isFixed = true;
return false;
}
});
return isFixed;
};
/**
* Get time in ms
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @type {function}
* @return {number}
*/
var getTime = Date.now || function () {
return new Date().getTime();
};
/**
* Returns a function, that, when invoked, will only be triggered at most once
* during a given window of time. Normally, the throttled function will run
* as much as it can, without ever going more than once per `wait` duration;
* but if you'd like to disable the execution on the leading edge, pass
* `{leading: false}`. To disable execution on the trailing edge, ditto.
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
* @param {function} func
* @param {number} wait
* @param {Object=} options
* @returns {Function}
*/
Materialize.throttle = function (func, wait, options) {
var context, args, result;
var timeout = null;
var previous = 0;
options || (options = {});
var later = function () {
previous = options.leading === false ? 0 : getTime();
timeout = null;
result = func.apply(context, args);
context = args = null;
};
return function () {
var now = getTime();
if (!previous && options.leading === false) previous = now;
var remaining = wait - (now - previous);
context = this;
args = arguments;
if (remaining <= 0) {
clearTimeout(timeout);
timeout = null;
previous = now;
result = func.apply(context, args);
context = args = null;
} else if (!timeout && options.trailing !== false) {
timeout = setTimeout(later, remaining);
}
return result;
};
};
// Velocity has conflicts when loaded with jQuery, this will check for it
// First, check if in noConflict mode
var Vel;
if (jQuery) {
Vel = jQuery.Velocity;
} else if ($) {
Vel = $.Velocity;
} else {
Vel = Velocity;
}
if (Vel) {
Materialize.Vel = Vel;
} else {
Materialize.Vel = Velocity;
}
;(function ($) {
$.fn.collapsible = function (options, methodParam) {
var defaults = {
accordion: undefined,
onOpen: undefined,
onClose: undefined
};
var methodName = options;
options = $.extend(defaults, options);
return this.each(function () {
var $this = $(this);
var $panel_headers = $(this).find('> li > .collapsible-header');
var collapsible_type = $this.data("collapsible");
/****************
Helper Functions
****************/
// Accordion Open
function accordionOpen(object) {
$panel_headers = $this.find('> li > .collapsible-header');
if (object.hasClass('active')) {
object.parent().addClass('active');
} else {
object.parent().removeClass('active');
}
if (object.parent().hasClass('active')) {
object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
} else {
object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
}
$panel_headers.not(object).removeClass('active').parent().removeClass('active');
// Close previously open accordion elements.
$panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () {
if ($(this).is(':visible')) {
$(this).slideUp({
duration: 350,
easing: "easeOutQuart",
queue: false,
complete: function () {
$(this).css('height', '');
execCallbacks($(this).siblings('.collapsible-header'));
}
});
}
});
}
// Expandable Open
function expandableOpen(object) {
if (object.hasClass('active')) {
object.parent().addClass('active');
} else {
object.parent().removeClass('active');
}
if (object.parent().hasClass('active')) {
object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
} else {
object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () {
$(this).css('height', '');
} });
}
}
// Open collapsible. object: .collapsible-header
function collapsibleOpen(object, noToggle) {
if (!noToggle) {
object.toggleClass('active');
}
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
// Handle Accordion
accordionOpen(object);
} else {
// Handle Expandables
expandableOpen(object);
}
execCallbacks(object);
}
// Handle callbacks
function execCallbacks(object) {
if (object.hasClass('active')) {
if (typeof options.onOpen === "function") {
options.onOpen.call(this, object.parent());
}
} else {
if (typeof options.onClose === "function") {
options.onClose.call(this, object.parent());
}
}
}
/**
* Check if object is children of panel header
* @param {Object} object Jquery object
* @return {Boolean} true if it is children
*/
function isChildrenOfPanelHeader(object) {
var panelHeader = getPanelHeader(object);
return panelHeader.length > 0;
}
/**
* Get panel header from a children element
* @param {Object} object Jquery object
* @return {Object} panel header object
*/
function getPanelHeader(object) {
return object.closest('li > .collapsible-header');
}
// Turn off any existing event handlers
function removeEventHandlers() {
$this.off('click.collapse', '> li > .collapsible-header');
}
/***** End Helper Functions *****/
// Methods
if (methodName === 'destroy') {
removeEventHandlers();
return;
} else if (methodParam >= 0 && methodParam < $panel_headers.length) {
var $curr_header = $panel_headers.eq(methodParam);
if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) {
collapsibleOpen($curr_header);
}
return;
}
removeEventHandlers();
// Add click handler to only direct collapsible header children
$this.on('click.collapse', '> li > .collapsible-header', function (e) {
var element = $(e.target);
if (isChildrenOfPanelHeader(element)) {
element = getPanelHeader(element);
}
collapsibleOpen(element);
});
// Open first active
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) {
// Handle Accordion
collapsibleOpen($panel_headers.filter('.active').first(), true);
} else {
// Handle Expandables
$panel_headers.filter('.active').each(function () {
collapsibleOpen($(this), true);
});
}
});
};
$(document).ready(function () {
$('.collapsible').collapsible();
});
})(jQuery);;(function ($) {
// Add posibility to scroll to selected option
// usefull for select for example
$.fn.scrollTo = function (elem) {
$(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
return this;
};
$.fn.dropdown = function (options) {
var defaults = {
inDuration: 300,
outDuration: 225,
constrainWidth: true, // Constrains width of dropdown to the activator
hover: false,
gutter: 0, // Spacing from edge
belowOrigin: false,
alignment: 'left',
stopPropagation: false
};
// Open dropdown.
if (options === "open") {
this.each(function () {
$(this).trigger('open');
});
return false;
}
// Close dropdown.
if (options === "close") {
this.each(function () {
$(this).trigger('close');
});
return false;
}
this.each(function () {
var origin = $(this);
var curr_options = $.extend({}, defaults, options);
var isFocused = false;
// Dropdown menu
var activates = $("#" + origin.attr('data-activates'));
function updateOptions() {
if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration');
if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration');
if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth');
if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover');
if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter');
if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin');
if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment');
if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation');
}
updateOptions();
// Attach dropdown to its activator
origin.after(activates);
/*
Helper function to position and resize dropdown.
Used in hover and click handler.
*/
function placeDropdown(eventType) {
// Check for simultaneous focus and click events.
if (eventType === 'focus') {
isFocused = true;
}
// Check html data attributes
updateOptions();
// Set Dropdown state
activates.addClass('active');
origin.addClass('active');
var originWidth = origin[0].getBoundingClientRect().width;
// Constrain width
if (curr_options.constrainWidth === true) {
activates.css('width', originWidth);
} else {
activates.css('white-space', 'nowrap');
}
// Offscreen detection
var windowHeight = window.innerHeight;
var originHeight = origin.innerHeight();
var offsetLeft = origin.offset().left;
var offsetTop = origin.offset().top - $(window).scrollTop();
var currAlignment = curr_options.alignment;
var gutterSpacing = 0;
var leftPosition = 0;
// Below Origin
var verticalOffset = 0;
if (curr_options.belowOrigin === true) {
verticalOffset = originHeight;
}
// Check for scrolling positioned container.
var scrollYOffset = 0;
var scrollXOffset = 0;
var wrapper = origin.parent();
if (!wrapper.is('body')) {
if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
scrollYOffset = wrapper[0].scrollTop;
}
if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
scrollXOffset = wrapper[0].scrollLeft;
}
}
if (offsetLeft + activates.innerWidth() > $(window).width()) {
// Dropdown goes past screen on right, force right alignment
currAlignment = 'right';
} else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
// Dropdown goes past screen on left, force left alignment
currAlignment = 'left';
}
// Vertical bottom offscreen detection
if (offsetTop + activates.innerHeight() > windowHeight) {
// If going upwards still goes offscreen, just crop height of dropdown.
if (offsetTop + originHeight - activates.innerHeight() < 0) {
var adjustedHeight = windowHeight - offsetTop - verticalOffset;
activates.css('max-height', adjustedHeight);
} else {
// Flow upwards.
if (!verticalOffset) {
verticalOffset += originHeight;
}
verticalOffset -= activates.innerHeight();
}
}
// Handle edge alignment
if (currAlignment === 'left') {
gutterSpacing = curr_options.gutter;
leftPosition = origin.position().left + gutterSpacing;
} else if (currAlignment === 'right') {
// Material icons fix
activates.stop(true, true).css({
opacity: 0,
left: 0
});
var offsetRight = origin.position().left + originWidth - activates.width();
gutterSpacing = -curr_options.gutter;
leftPosition = offsetRight + gutterSpacing;
}
// Position dropdown
activates.css({
position: 'absolute',
top: origin.position().top + verticalOffset + scrollYOffset,
left: leftPosition + scrollXOffset
});
// Show dropdown
activates.slideDown({
queue: false,
duration: curr_options.inDuration,
easing: 'easeOutCubic',
complete: function () {
$(this).css('height', '');
}
}).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' });
// Add click close handler to document
setTimeout(function () {
$(document).on('click.' + activates.attr('id'), function (e) {
hideDropdown();
$(document).off('click.' + activates.attr('id'));
});
}, 0);
}
function hideDropdown() {
// Check for simultaneous focus and click events.
isFocused = false;
activates.fadeOut(curr_options.outDuration);
activates.removeClass('active');
origin.removeClass('active');
$(document).off('click.' + activates.attr('id'));
setTimeout(function () {
activates.css('max-height', '');
}, curr_options.outDuration);
}
// Hover
if (curr_options.hover) {
var open = false;
origin.off('click.' + origin.attr('id'));
// Hover handler to show dropdown
origin.on('mouseenter', function (e) {
// Mouse over
if (open === false) {
placeDropdown();
open = true;
}
});
origin.on('mouseleave', function (e) {
// If hover on origin then to something other than dropdown content, then close
var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
if (!$(toEl).closest('.dropdown-content').is(activates)) {
activates.stop(true, true);
hideDropdown();
open = false;
}
});
activates.on('mouseleave', function (e) {
// Mouse out
var toEl = e.toElement || e.relatedTarget;
if (!$(toEl).closest('.dropdown-button').is(origin)) {
activates.stop(true, true);
hideDropdown();
open = false;
}
});
// Click
} else {
// Click handler to show dropdown
origin.off('click.' + origin.attr('id'));
origin.on('click.' + origin.attr('id'), function (e) {
if (!isFocused) {
if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) {
e.preventDefault(); // Prevents button click from moving window
if (curr_options.stopPropagation) {
e.stopPropagation();
}
placeDropdown('click');
}
// If origin is clicked and menu is open, close menu
else if (origin.hasClass('active')) {
hideDropdown();
$(document).off('click.' + activates.attr('id'));
}
}
});
} // End else
// Listen to open and close event - useful for select component
origin.on('open', function (e, eventType) {
placeDropdown(eventType);
});
origin.on('close', hideDropdown);
});
}; // End dropdown plugin
$(document).ready(function () {
$('.dropdown-button').dropdown();
});
})(jQuery);
;(function ($, Vel) {
'use strict';
var _defaults = {
opacity: 0.5,
inDuration: 250,
outDuration: 250,
ready: undefined,
complete: undefined,
dismissible: true,
startingTop: '4%',
2018-01-31 01:43:01 +09:00
endingTop: '0%'
2018-01-28 21:22:43 +09:00
};
/**
* @class
*
*/
var Modal = function () {
/**
* Construct Modal instance and set up overlay
* @constructor
* @param {jQuery} $el
* @param {Object} options
*/
function Modal($el, options) {
_classCallCheck(this, Modal);
// If exists, destroy and reinitialize
if (!!$el[0].M_Modal) {
$el[0].M_Modal.destroy();
}
/**
* The jQuery element
* @type {jQuery}
*/
this.$el = $el;
/**
* Options for the modal
* @member Modal#options
* @prop {Number} [opacity=0.5] - Opacity of the modal overlay
* @prop {Number} [inDuration=250] - Length in ms of enter transition
* @prop {Number} [outDuration=250] - Length in ms of exit transition
* @prop {Function} ready - Callback function called when modal is finished entering
* @prop {Function} complete - Callback function called when modal is finished exiting
* @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
* @prop {String} [startingTop='4%'] - startingTop
* @prop {String} [endingTop='10%'] - endingTop
*/
this.options = $.extend({}, Modal.defaults, options);
/**
* Describes open/close state of modal
* @type {Boolean}
*/
this.isOpen = false;
this.$el[0].M_Modal = this;
this.id = $el.attr('id');
this.openingTrigger = undefined;
this.$overlay = $('<div class="modal-overlay"></div>');
Modal._increment++;
Modal._count++;
this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
this.setupEventHandlers();
}
_createClass(Modal, [{
key: 'getInstance',
/**
* Get Instance
*/
value: function getInstance() {
return this;
}
/**
* Teardown component
*/
}, {
key: 'destroy',
value: function destroy() {
this.removeEventHandlers();
this.$el[0].removeAttribute('style');
if (!!this.$overlay[0].parentNode) {
this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
}
this.$el[0].M_Modal = undefined;
Modal._count--;
}
/**
* Setup Event Handlers
*/
}, {
key: 'setupEventHandlers',
value: function setupEventHandlers() {
this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
if (Modal._count === 1) {
document.body.addEventListener('click', this.handleTriggerClick);
}
this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
}
/**
* Remove Event Handlers
*/
}, {
key: 'removeEventHandlers',
value: function removeEventHandlers() {
if (Modal._count === 0) {
document.body.removeEventListener('click', this.handleTriggerClick);
}
this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
}
/**
* Handle Trigger Click
* @param {Event} e
*/
}, {
key: 'handleTriggerClick',
value: function handleTriggerClick(e) {
var $trigger = $(e.target).closest('.modal-trigger');
if (e.target && $trigger.length) {
var modalId = $trigger[0].getAttribute('href');
if (modalId) {
modalId = modalId.slice(1);
} else {
modalId = $trigger[0].getAttribute('data-target');
}
var modalInstance = document.getElementById(modalId).M_Modal;
if (modalInstance) {
modalInstance.open($trigger);
}
e.preventDefault();
}
}
/**
* Handle Overlay Click
*/
}, {
key: 'handleOverlayClick',
value: function handleOverlayClick() {
if (this.options.dismissible) {
this.close();
}
}
/**
* Handle Modal Close Click
* @param {Event} e
*/
}, {
key: 'handleModalCloseClick',
value: function handleModalCloseClick(e) {
var $closeTrigger = $(e.target).closest('.modal-close');
if (e.target && $closeTrigger.length) {
this.close();
}
}
/**
* Handle Keydown
* @param {Event} e
*/
}, {
key: 'handleKeydown',
value: function handleKeydown(e) {
// ESC key
if (e.keyCode === 27 && this.options.dismissible) {
this.close();
}
}
/**
* Animate in modal
*/
}, {
key: 'animateIn',
value: function animateIn() {
var _this = this;
// Set initial styles
$.extend(this.$el[0].style, {
display: 'block',
opacity: 0
});
$.extend(this.$overlay[0].style, {
display: 'block',
opacity: 0
});
// Animate overlay
Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' });
// Define modal animation options
var enterVelocityOptions = {
duration: this.options.inDuration,
queue: false,
ease: 'easeOutCubic',
// Handle modal ready callback
complete: function () {
if (typeof _this.options.ready === 'function') {
_this.options.ready.call(_this, _this.$el, _this.openingTrigger);
}
}
};
// Bottom sheet animation
if (this.$el[0].classList.contains('bottom-sheet')) {
Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions);
// Normal modal animation
} else {
Vel.hook(this.$el[0], 'scaleX', 0.7);
this.$el[0].style.top = this.options.startingTop;
Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions);
}
}
/**
* Animate out modal
*/
}, {
key: 'animateOut',
value: function animateOut() {
var _this2 = this;
// Animate overlay
Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' });
// Define modal animation options
var exitVelocityOptions = {
duration: this.options.outDuration,
queue: false,
ease: 'easeOutCubic',
// Handle modal ready callback
complete: function () {
_this2.$el[0].style.display = 'none';
// Call complete callback
if (typeof _this2.options.complete === 'function') {
_this2.options.complete.call(_this2, _this2.$el);
}
_this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]);
}
};
// Bottom sheet animation
if (this.$el[0].classList.contains('bottom-sheet')) {
Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions);
// Normal modal animation
} else {
Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions);
}
}
/**
* Open Modal
* @param {jQuery} [$trigger]
*/
}, {
key: 'open',
value: function open($trigger) {
if (this.isOpen) {
return;
}
this.isOpen = true;
var body = document.body;
body.style.overflow = 'hidden';
this.$el[0].classList.add('open');
body.appendChild(this.$overlay[0]);
// Set opening trigger, undefined indicates modal was opened by javascript
this.openingTrigger = !!$trigger ? $trigger : undefined;
if (this.options.dismissible) {
this.handleKeydownBound = this.handleKeydown.bind(this);
document.addEventListener('keydown', this.handleKeydownBound);
}
this.animateIn();
return this;
}
/**
* Close Modal
*/
}, {
key: 'close',
value: function close() {
if (!this.isOpen) {
return;
}
this.isOpen = false;
this.$el[0].classList.remove('open');
document.body.style.overflow = '';
if (this.options.dismissible) {
document.removeEventListener('keydown', this.handleKeydownBound);
}
this.animateOut();
return this;
}
}], [{
key: 'init',
value: function init($els, options) {
var arr = [];
$els.each(function () {
arr.push(new Modal($(this), options));
});
return arr;
}
}, {
key: 'defaults',
get: function () {
return _defaults;
}
}]);
return Modal;
}();
/**
* @static
* @memberof Modal
*/
Modal._increment = 0;
/**
* @static
* @memberof Modal
*/
Modal._count = 0;
Materialize.Modal = Modal;
$.fn.modal = function (methodOrOptions) {
// Call plugin method if valid method name is passed in
if (Modal.prototype[methodOrOptions]) {
// Getter methods
if (methodOrOptions.slice(0, 3) === 'get') {
return this.first()[0].M_Modal[methodOrOptions]();
// Void methods
} else {
return this.each(function () {
this.M_Modal[methodOrOptions]();
});
}
// Initialize plugin if options or no argument is passed in
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
Modal.init(this, arguments[0]);
return this;
// Return error if an unrecognized method name is passed in
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal');
}
};
})(jQuery, Materialize.Vel);
;(function ($) {
$.fn.materialbox = function () {
return this.each(function () {
if ($(this).hasClass('initialized')) {
return;
}
$(this).addClass('initialized');
var overlayActive = false;
var doneAnimating = true;
var inDuration = 275;
var outDuration = 200;
var origin = $(this);
var placeholder = $('<div></div>').addClass('material-placeholder');
var originalWidth = 0;
var originalHeight = 0;
var ancestorsChanged;
var ancestor;
var originInlineStyles = origin.attr('style');
origin.wrap(placeholder);
// Start click handler
origin.on('click', function () {
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.width();
var originalHeight = origin.height();
// If already modal, return to original
if (doneAnimating === false) {
returnToOriginal();
return false;
} else if (overlayActive && doneAnimating === true) {
returnToOriginal();
return false;
}
// Set states
doneAnimating = false;
origin.addClass('active');
overlayActive = true;
// Set positioning for placeholder
placeholder.css({
width: placeholder[0].getBoundingClientRect().width,
height: placeholder[0].getBoundingClientRect().height,
position: 'relative',
top: 0,
left: 0
});
// Find ancestor with overflow: hidden; and remove it
ancestorsChanged = undefined;
ancestor = placeholder[0].parentNode;
var count = 0;
while (ancestor !== null && !$(ancestor).is(document)) {
var curr = $(ancestor);
if (curr.css('overflow') !== 'visible') {
curr.css('overflow', 'visible');
if (ancestorsChanged === undefined) {
ancestorsChanged = curr;
} else {
ancestorsChanged = ancestorsChanged.add(curr);
}
}
ancestor = ancestor.parentNode;
}
// Set css on origin
origin.css({
position: 'absolute',
'z-index': 1000,
'will-change': 'left, top, width, height'
}).data('width', originalWidth).data('height', originalHeight);
// Add overlay
var overlay = $('<div id="materialbox-overlay"></div>').css({
opacity: 0
}).click(function () {
if (doneAnimating === true) returnToOriginal();
});
// Put before in origin image to preserve z-index layering.
origin.before(overlay);
// Set dimensions if needed
var overlayOffset = overlay[0].getBoundingClientRect();
overlay.css({
width: windowWidth,
height: windowHeight,
left: -1 * overlayOffset.left,
top: -1 * overlayOffset.top
});
// Animate Overlay
overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
// Add and animate caption if it exists
if (origin.data('caption') !== "") {
var $photo_caption = $('<div class="materialbox-caption"></div>');
$photo_caption.text(origin.data('caption'));
$('body').append($photo_caption);
$photo_caption.css({ "display": "inline" });
$photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' });
}
// Resize Image
var ratio = 0;
var widthPercent = originalWidth / windowWidth;
var heightPercent = originalHeight / windowHeight;
var newWidth = 0;
var newHeight = 0;
if (widthPercent > heightPercent) {
ratio = originalHeight / originalWidth;
newWidth = windowWidth * 0.9;
newHeight = windowWidth * 0.9 * ratio;
} else {
ratio = originalWidth / originalHeight;
newWidth = windowHeight * 0.9 * ratio;
newHeight = windowHeight * 0.9;
}
// Animate image + set z-index
if (origin.hasClass('responsive-img')) {
origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false,
complete: function () {
origin.css({ left: 0, top: 0 }).velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
});
} // End Complete
}); // End Velocity
} else {
origin.css('left', 0).css('top', 0).velocity({
height: newHeight,
width: newWidth,
left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2,
top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2
}, {
duration: inDuration,
queue: false,
easing: 'easeOutQuad',
complete: function () {
doneAnimating = true;
}
}); // End Velocity
}
// Handle Exit triggers
$(window).on('scroll.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(window).on('resize.materialbox', function () {
if (overlayActive) {
returnToOriginal();
}
});
$(document).on('keyup.materialbox', function (e) {
// ESC key
if (e.keyCode === 27 && doneAnimating === true && overlayActive) {
returnToOriginal();
}
});
}); // End click handler
// This function returns the modaled image to the original spot
function returnToOriginal() {
doneAnimating = false;
var placeholder = origin.parent('.material-placeholder');
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var originalWidth = origin.data('width');
var originalHeight = origin.data('height');
origin.velocity("stop", true);
$('#materialbox-overlay').velocity("stop", true);
$('.materialbox-caption').velocity("stop", true);
// disable exit handlers
$(window).off('scroll.materialbox');
$(document).off('keyup.materialbox');
$(window).off('resize.materialbox');
$('#materialbox-overlay').velocity({ opacity: 0 }, {
duration: outDuration, // Delay prevents animation overlapping
queue: false, easing: 'easeOutQuad',
complete: function () {
// Remove Overlay
overlayActive = false;
$(this).remove();
}
});
// Resize Image
origin.velocity({
width: originalWidth,
height: originalHeight,
left: 0,
top: 0
}, {
duration: outDuration,
queue: false, easing: 'easeOutQuad',
complete: function () {
placeholder.css({
height: '',
width: '',
position: '',
top: '',
left: ''
});
origin.removeAttr('style');
origin.attr('style', originInlineStyles);
// Remove class
origin.removeClass('active');
doneAnimating = true;
// Remove overflow overrides on ancestors
if (ancestorsChanged) {
ancestorsChanged.css('overflow', '');
}
}
});
// Remove Caption + reset css settings on image
$('.materialbox-caption').velocity({ opacity: 0 }, {
duration: outDuration, // Delay prevents animation overlapping
queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
}
});
};
$(document).ready(function () {
$('.materialboxed').materialbox();
});
})(jQuery);
;(function ($) {
$.fn.parallax = function () {
var window_width = $(window).width();
// Parallax Scripts
return this.each(function (i) {
var $this = $(this);
$this.addClass('parallax');
function updateParallax(initial) {
var container_height;
if (window_width < 601) {
container_height = $this.height() > 0 ? $this.height() : $this.children("img").height();
} else {
container_height = $this.height() > 0 ? $this.height() : 500;
}
var $img = $this.children("img").first();
var img_height = $img.height();
var parallax_dist = img_height - container_height;
var bottom = $this.offset().top + container_height;
var top = $this.offset().top;
var scrollTop = $(window).scrollTop();
var windowHeight = window.innerHeight;
var windowBottom = scrollTop + windowHeight;
var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
var parallax = Math.round(parallax_dist * percentScrolled);
if (initial) {
$img.css('display', 'block');
}
if (bottom > scrollTop && top < scrollTop + windowHeight) {
$img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
}
}
// Wait for image load
$this.children("img").one("load", function () {
updateParallax(true);
}).each(function () {
if (this.complete) $(this).trigger("load");
});
$(window).scroll(function () {
window_width = $(window).width();
updateParallax(false);
});
$(window).resize(function () {
window_width = $(window).width();
updateParallax(false);
});
});
};
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
onShow: null,
swipeable: false,
responsiveThreshold: Infinity // breakpoint for swipeable
};
options = $.extend(defaults, options);
var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var uniqueNamespace = namespace + i;
// For each set of tabs, we want to keep track of
// which tab is active and its associated content
var $this = $(this),
window_width = $(window).width();
var $active,
$content,
$links = $this.find('li.tab a'),
$tabs_width = $this.width(),
$tabs_content = $(),
$tabs_wrapper,
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
$indicator,
index = 0,
prev_index = 0,
clicked = false,
clickedTimeout,
transition = 300;
// Finds right attribute for indicator based on active tab.
// el: jQuery Object
var calcRightPos = function (el) {
return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
};
// Finds left attribute for indicator based on active tab.
// el: jQuery Object
var calcLeftPos = function (el) {
return Math.floor(el.position().left + $this.scrollLeft());
};
// Animates Indicator to active tab.
// prev_index: Number
var animateIndicator = function (prev_index) {
if (index - prev_index >= 0) {
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
} else {
$indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' });
$indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 });
}
};
// Change swipeable according to responsive threshold
if (options.swipeable) {
if (window_width > options.responsiveThreshold) {
options.swipeable = false;
}
}
// If the location.hash matches one of the links, use that as the active tab.
$active = $($links.filter('[href="' + location.hash + '"]'));
// If no match is found, use the first link or any with class 'active' as the initial active tab.
if ($active.length === 0) {
$active = $(this).find('li.tab a.active').first();
}
if ($active.length === 0) {
$active = $(this).find('li.tab a').first();
}
$active.addClass('active');
index = $links.index($active);
if (index < 0) {
index = 0;
}
if ($active[0] !== undefined) {
$content = $($active[0].hash);
$content.addClass('active');
}
// append indicator then set indicator width to tab width
if (!$this.find('.indicator').length) {
$this.append('<li class="indicator"></li>');
}
$indicator = $this.find('.indicator');
// we make sure that the indicator is at the end of the tabs
$this.append($indicator);
if ($this.is(":visible")) {
// $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
// $indicator.css({"left": index * $tab_width});
setTimeout(function () {
$indicator.css({ "right": calcRightPos($active) });
$indicator.css({ "left": calcLeftPos($active) });
}, 0);
}
$(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () {
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
if (index < 0) {
index = 0;
}
if ($tab_width !== 0 && $tabs_width !== 0) {
$indicator.css({ "right": calcRightPos($active) });
$indicator.css({ "left": calcLeftPos($active) });
}
});
// Initialize Tabs Content.
if (options.swipeable) {
// TODO: Duplicate calls with swipeable? handle multiple div wrapping.
$links.each(function () {
var $curr_content = $(Materialize.escapeHash(this.hash));
$curr_content.addClass('carousel-item');
$tabs_content = $tabs_content.add($curr_content);
});
$tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
$tabs_content.css('display', '');
$('.tabs-content.carousel').carousel({
fullWidth: true,
noWrap: true,
onCycleTo: function (item) {
if (!clicked) {
var prev_index = index;
index = $tabs_wrapper.index(item);
$active.removeClass('active');
$active = $links.eq(index);
$active.addClass('active');
animateIndicator(prev_index);
if (typeof options.onShow === "function") {
options.onShow.call($this[0], $content);
}
}
}
});
} else {
// Hide the remaining content
$links.not($active).each(function () {
$(Materialize.escapeHash(this.hash)).hide();
});
}
// Bind the click event handler
$this.off('click.tabs').on('click.tabs', 'a', function (e) {
if ($(this).parent().hasClass('disabled')) {
e.preventDefault();
return;
}
// Act as regular link if target attribute is specified.
if (!!$(this).attr("target")) {
return;
}
clicked = true;
$tabs_width = $this.width();
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
// Make the old tab inactive.
$active.removeClass('active');
var $oldContent = $content;
// Update the variables with the new link and content
$active = $(this);
$content = $(Materialize.escapeHash(this.hash));
$links = $this.find('li.tab a');
var activeRect = $active.position();
// Make the tab active.
$active.addClass('active');
prev_index = index;
index = $links.index($(this));
if (index < 0) {
index = 0;
}
// Change url to current tab
// window.location.hash = $active.attr('href');
// Swap content
if (options.swipeable) {
if ($tabs_content.length) {
$tabs_content.carousel('set', index, function () {
if (typeof options.onShow === "function") {
options.onShow.call($this[0], $content);
}
});
}
} else {
if ($content !== undefined) {
$content.show();
$content.addClass('active');
if (typeof options.onShow === "function") {
options.onShow.call(this, $content);
}
}
if ($oldContent !== undefined && !$oldContent.is($content)) {
$oldContent.hide();
$oldContent.removeClass('active');
}
}
// Reset clicked state
clickedTimeout = setTimeout(function () {
clicked = false;
}, transition);
// Update indicator
animateIndicator(prev_index);
// Prevent the anchor's default click action
e.preventDefault();
});
});
},
select_tab: function (id) {
this.find('a[href="#' + id + '"]').trigger('click');
}
};
$.fn.tabs = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs');
}
};
$(document).ready(function () {
$('ul.tabs').tabs();
});
})(jQuery);
;(function ($) {
$.fn.tooltip = function (options) {
var timeout = null,
margin = 5;
// Defaults
var defaults = {
delay: 350,
tooltip: '',
position: 'bottom',
html: false
};
// Remove tooltip from the activator
if (options === "remove") {
this.each(function () {
$('#' + $(this).attr('data-tooltip-id')).remove();
$(this).removeAttr('data-tooltip-id');
$(this).off('mouseenter.tooltip mouseleave.tooltip');
});
return false;
}
options = $.extend(defaults, options);
return this.each(function () {
var tooltipId = Materialize.guid();
var origin = $(this);
// Destroy old tooltip
if (origin.attr('data-tooltip-id')) {
$('#' + origin.attr('data-tooltip-id')).remove();
}
origin.attr('data-tooltip-id', tooltipId);
// Get attributes.
var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop;
var setAttributes = function () {
allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
tooltipDelay = origin.attr('data-delay');
tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay;
tooltipPosition = origin.attr('data-position');
tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition;
tooltipText = origin.attr('data-tooltip');
tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText;
};
setAttributes();
var renderTooltipEl = function () {
var tooltip = $('<div class="material-tooltip"></div>');
// Create Text span
if (allowHtml) {
tooltipText = $('<span></span>').html(tooltipText);
} else {
tooltipText = $('<span></span>').text(tooltipText);
}
// Create tooltip
tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId);
// Create backdrop
backdrop = $('<div class="backdrop"></div>');
backdrop.appendTo(tooltip);
return tooltip;
};
tooltipEl = renderTooltipEl();
// Destroy previously binded events
origin.off('mouseenter.tooltip mouseleave.tooltip');
// Mouse In
var started = false,
timeoutRef;
origin.on({ 'mouseenter.tooltip': function (e) {
var showTooltip = function () {
setAttributes();
started = true;
tooltipEl.velocity('stop');
backdrop.velocity('stop');
tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
// Tooltip positioning
var originWidth = origin.outerWidth();
var originHeight = origin.outerHeight();
var tooltipHeight = tooltipEl.outerHeight();
var tooltipWidth = tooltipEl.outerWidth();
var tooltipVerticalMovement = '0px';
var tooltipHorizontalMovement = '0px';
var backdropOffsetWidth = backdrop[0].offsetWidth;
var backdropOffsetHeight = backdrop[0].offsetHeight;
var scaleXFactor = 8;
var scaleYFactor = 8;
var scaleFactor = 0;
var targetTop, targetLeft, newCoordinates;
if (tooltipPosition === "top") {
// Top Position
targetTop = origin.offset().top - tooltipHeight - margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '-10px';
backdrop.css({
bottom: 0,
left: 0,
borderRadius: '14px 14px 0 0',
transformOrigin: '50% 100%',
marginTop: tooltipHeight,
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
});
}
// Left Position
else if (tooltipPosition === "left") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left - tooltipWidth - margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '-10px';
backdrop.css({
top: '-7px',
right: 0,
width: '14px',
height: '14px',
borderRadius: '14px 0 0 14px',
transformOrigin: '95% 50%',
marginTop: tooltipHeight / 2,
marginLeft: tooltipWidth
});
}
// Right Position
else if (tooltipPosition === "right") {
targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2;
targetLeft = origin.offset().left + originWidth + margin;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipHorizontalMovement = '+10px';
backdrop.css({
top: '-7px',
left: 0,
width: '14px',
height: '14px',
borderRadius: '0 14px 14px 0',
transformOrigin: '5% 50%',
marginTop: tooltipHeight / 2,
marginLeft: '0px'
});
} else {
// Bottom Position
targetTop = origin.offset().top + origin.outerHeight() + margin;
targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2;
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
tooltipVerticalMovement = '+10px';
backdrop.css({
top: 0,
left: 0,
marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2
});
}
// Set tooptip css placement
tooltipEl.css({
top: newCoordinates.y,
left: newCoordinates.x
});
// Calculate Scale to fill
scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
scaleFactor = Math.max(scaleXFactor, scaleYFactor);
tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false });
backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' });
};
timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
// Mouse Out
},
'mouseleave.tooltip': function () {
// Reset State
started = false;
clearTimeout(timeoutRef);
// Animate back
setTimeout(function () {
if (started !== true) {
tooltipEl.velocity({
opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false });
backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, {
duration: 225,
queue: false,
complete: function () {
backdrop.css({ visibility: 'hidden' });
tooltipEl.css({ visibility: 'hidden' });
started = false;
}
});
}
}, 225);
}
});
});
};
var repositionWithinScreen = function (x, y, width, height) {
var newX = x;
var newY = y;
if (newX < 0) {
newX = 4;
} else if (newX + width > window.innerWidth) {
newX -= newX + width - window.innerWidth;
}
if (newY < 0) {
newY = 4;
} else if (newY + height > window.innerHeight + $(window).scrollTop) {
newY -= newY + height - window.innerHeight;
}
return { x: newX, y: newY };
};
$(document).ready(function () {
$('.tooltipped').tooltip();
});
})(jQuery);
; /*!
* Waves v0.6.4
* http://fian.my.id/Waves
*
* Copyright 2014 Alfiana E. Sibuea and other contributors
* Released under the MIT license
* https://github.com/fians/Waves/blob/master/LICENSE
*/
;(function (window) {
'use strict';
var Waves = Waves || {};
var $$ = document.querySelectorAll.bind(document);
// Find exact position of element
function isWindow(obj) {
return obj !== null && obj === obj.window;
}
function getWindow(elem) {
return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
}
function offset(elem) {
var docElem,
win,
box = { top: 0, left: 0 },
doc = elem && elem.ownerDocument;
docElem = doc.documentElement;
if (typeof elem.getBoundingClientRect !== typeof undefined) {
box = elem.getBoundingClientRect();
}
win = getWindow(doc);
return {
top: box.top + win.pageYOffset - docElem.clientTop,
left: box.left + win.pageXOffset - docElem.clientLeft
};
}
function convertStyle(obj) {
var style = '';
for (var a in obj) {
if (obj.hasOwnProperty(a)) {
style += a + ':' + obj[a] + ';';
}
}
return style;
}
var Effect = {
// Effect delay
duration: 750,
show: function (e, element) {
// Disable right click
if (e.button === 2) {
return false;
}
var el = element || this;
// Create ripple
var ripple = document.createElement('div');
ripple.className = 'waves-ripple';
el.appendChild(ripple);
// Get click coordinate and element witdh
var pos = offset(el);
var relativeY = e.pageY - pos.top;
var relativeX = e.pageX - pos.left;
var scale = 'scale(' + el.clientWidth / 100 * 10 + ')';
// Support for touch devices
if ('touches' in e) {
relativeY = e.touches[0].pageY - pos.top;
relativeX = e.touches[0].pageX - pos.left;
}
// Attach data to element
ripple.setAttribute('data-hold', Date.now());
ripple.setAttribute('data-scale', scale);
ripple.setAttribute('data-x', relativeX);
ripple.setAttribute('data-y', relativeY);
// Set ripple position
var rippleStyle = {
'top': relativeY + 'px',
'left': relativeX + 'px'
};
ripple.className = ripple.className + ' waves-notransition';
ripple.setAttribute('style', convertStyle(rippleStyle));
ripple.className = ripple.className.replace('waves-notransition', '');
// Scale the ripple
rippleStyle['-webkit-transform'] = scale;
rippleStyle['-moz-transform'] = scale;
rippleStyle['-ms-transform'] = scale;
rippleStyle['-o-transform'] = scale;
rippleStyle.transform = scale;
rippleStyle.opacity = '1';
rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
rippleStyle['transition-duration'] = Effect.duration + 'ms';
rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
ripple.setAttribute('style', convertStyle(rippleStyle));
},
hide: function (e) {
TouchHandler.touchup(e);
var el = this;
var width = el.clientWidth * 1.4;
// Get first ripple
var ripple = null;
var ripples = el.getElementsByClassName('waves-ripple');
if (ripples.length > 0) {
ripple = ripples[ripples.length - 1];
} else {
return false;
}
var relativeX = ripple.getAttribute('data-x');
var relativeY = ripple.getAttribute('data-y');
var scale = ripple.getAttribute('data-scale');
// Get delay beetween mousedown and mouse leave
var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
var delay = 350 - diff;
if (delay < 0) {
delay = 0;
}
// Fade out ripple after delay
setTimeout(function () {
var style = {
'top': relativeY + 'px',
'left': relativeX + 'px',
'opacity': '0',
// Duration
'-webkit-transition-duration': Effect.duration + 'ms',
'-moz-transition-duration': Effect.duration + 'ms',
'-o-transition-duration': Effect.duration + 'ms',
'transition-duration': Effect.duration + 'ms',
'-webkit-transform': scale,
'-moz-transform': scale,
'-ms-transform': scale,
'-o-transform': scale,
'transform': scale
};
ripple.setAttribute('style', convertStyle(style));
setTimeout(function () {
try {
el.removeChild(ripple);
} catch (e) {
return false;
}
}, Effect.duration);
}, delay);
},
// Little hack to make <input> can perform waves effect
wrapInput: function (elements) {
for (var a = 0; a < elements.length; a++) {
var el = elements[a];
if (el.tagName.toLowerCase() === 'input') {
var parent = el.parentNode;
// If input already have parent just pass through
if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
continue;
}
// Put element class and style to the specified parent
var wrapper = document.createElement('i');
wrapper.className = el.className + ' waves-input-wrapper';
var elementStyle = el.getAttribute('style');
if (!elementStyle) {
elementStyle = '';
}
wrapper.setAttribute('style', elementStyle);
el.className = 'waves-button-input';
el.removeAttribute('style');
// Put element as child
parent.replaceChild(wrapper, el);
wrapper.appendChild(el);
}
}
}
};
/**
* Disable mousedown event for 500ms during and after touch
*/
var TouchHandler = {
/* uses an integer rather than bool so there's no issues with
* needing to clear timeouts if another touch event occurred
* within the 500ms. Cannot mouseup between touchstart and
* touchend, nor in the 500ms after touchend. */
touches: 0,
allowEvent: function (e) {
var allow = true;
if (e.type === 'touchstart') {
TouchHandler.touches += 1; //push
} else if (e.type === 'touchend' || e.type === 'touchcancel') {
setTimeout(function () {
if (TouchHandler.touches > 0) {
TouchHandler.touches -= 1; //pop after 500ms
}
}, 500);
} else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
allow = false;
}
return allow;
},
touchup: function (e) {
TouchHandler.allowEvent(e);
}
};
/**
* Delegated click handler for .waves-effect element.
* returns null when .waves-effect element not in "click tree"
*/
function getWavesEffectElement(e) {
if (TouchHandler.allowEvent(e) === false) {
return null;
}
var element = null;
var target = e.target || e.srcElement;
while (target.parentNode !== null) {
if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
element = target;
break;
}
target = target.parentNode;
}
return element;
}
/**
* Bubble the click and show effect if .waves-effect elem was found
*/
function showEffect(e) {
var element = getWavesEffectElement(e);
if (element !== null) {
Effect.show(e, element);
if ('ontouchstart' in window) {
element.addEventListener('touchend', Effect.hide, false);
element.addEventListener('touchcancel', Effect.hide, false);
}
element.addEventListener('mouseup', Effect.hide, false);
element.addEventListener('mouseleave', Effect.hide, false);
element.addEventListener('dragend', Effect.hide, false);
}
}
Waves.displayEffect = function (options) {
options = options || {};
if ('duration' in options) {
Effect.duration = options.duration;
}
//Wrap input inside <i> tag
Effect.wrapInput($$('.waves-effect'));
if ('ontouchstart' in window) {
document.body.addEventListener('touchstart', showEffect, false);
}
document.body.addEventListener('mousedown', showEffect, false);
};
/**
* Attach Waves to an input element (or any element which doesn't
* bubble mouseup/mousedown events).
* Intended to be used with dynamically loaded forms/inputs, or
* where the user doesn't want a delegated click handler.
*/
Waves.attach = function (element) {
//FUTURE: automatically add waves classes and allow users
// to specify them with an options param? Eg. light/classic/button
if (element.tagName.toLowerCase() === 'input') {
Effect.wrapInput([element]);
element = element.parentNode;
}
if ('ontouchstart' in window) {
element.addEventListener('touchstart', showEffect, false);
}
element.addEventListener('mousedown', showEffect, false);
};
window.Waves = Waves;
document.addEventListener('DOMContentLoaded', function () {
Waves.displayEffect();
}, false);
})(window);
;(function ($, Vel) {
'use strict';
var _defaults = {
displayLength: Infinity,
inDuration: 300,
outDuration: 375,
className: undefined,
completeCallback: undefined,
activationPercent: 0.8
};
var Toast = function () {
function Toast(message, displayLength, className, completeCallback) {
_classCallCheck(this, Toast);
if (!message) {
return;
}
/**
* Options for the toast
* @member Toast#options
*/
this.options = {
displayLength: displayLength,
className: className,
completeCallback: completeCallback
};
this.options = $.extend({}, Toast.defaults, this.options);
this.message = message;
/**
* Describes current pan state toast
* @type {Boolean}
*/
this.panning = false;
/**
* Time remaining until toast is removed
*/
this.timeRemaining = this.options.displayLength;
if (Toast._toasts.length === 0) {
Toast._createContainer();
}
// Create new toast
Toast._toasts.push(this);
var toastElement = this.createToast();
toastElement.M_Toast = this;
this.el = toastElement;
this._animateIn();
this.setTimer();
}
_createClass(Toast, [{
key: 'createToast',
/**
* Create toast and append it to toast container
*/
value: function createToast() {
var toast = document.createElement('div');
toast.classList.add('toast');
// Add custom classes onto toast
if (this.options.className) {
var classes = this.options.className.split(' ');
var i = void 0,
count = void 0;
for (i = 0, count = classes.length; i < count; i++) {
toast.classList.add(classes[i]);
}
}
// Set content
if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') {
toast.appendChild(this.message);
// Check if it is jQuery object
} else if (this.message instanceof jQuery) {
$(toast).append(this.message);
// Insert as text;
} else {
toast.innerHTML = this.message;
}
// Append toasft
Toast._container.appendChild(toast);
return toast;
}
/**
* Animate in toast
*/
}, {
key: '_animateIn',
value: function _animateIn() {
// Animate toast in
Vel(this.el, { top: 0, opacity: 1 }, {
duration: 300,
easing: 'easeOutCubic',
queue: false
});
}
/**
* Create setInterval which automatically removes toast when timeRemaining >= 0
* has been reached
*/
}, {
key: 'setTimer',
value: function setTimer() {
var _this3 = this;
if (this.timeRemaining !== Infinity) {
this.counterInterval = setInterval(function () {
// If toast is not being dragged, decrease its time remaining
if (!_this3.panning) {
_this3.timeRemaining -= 20;
}
// Animate toast out
if (_this3.timeRemaining <= 0) {
_this3.remove();
}
}, 20);
}
}
/**
* Dismiss toast with animation
*/
}, {
key: 'remove',
value: function remove() {
var _this4 = this;
window.clearInterval(this.counterInterval);
var activationDistance = this.el.offsetWidth * this.options.activationPercent;
if (this.wasSwiped) {
this.el.style.transition = 'transform .05s, opacity .05s';
this.el.style.transform = 'translateX(' + activationDistance + 'px)';
this.el.style.opacity = 0;
}
Vel(this.el, { opacity: 0, marginTop: '-40px' }, {
duration: this.options.outDuration,
easing: 'easeOutExpo',
queue: false,
complete: function () {
// Call the optional callback
if (typeof _this4.options.completeCallback === 'function') {
_this4.options.completeCallback();
}
// Remove toast from DOM
_this4.el.parentNode.removeChild(_this4.el);
Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1);
if (Toast._toasts.length === 0) {
Toast._removeContainer();
}
}
});
}
}], [{
key: '_createContainer',
/**
* Append toast container and add event handlers
*/
value: function _createContainer() {
var container = document.createElement('div');
container.setAttribute('id', 'toast-container');
// Add event handler
container.addEventListener('touchstart', Toast._onDragStart);
container.addEventListener('touchmove', Toast._onDragMove);
container.addEventListener('touchend', Toast._onDragEnd);
container.addEventListener('mousedown', Toast._onDragStart);
document.addEventListener('mousemove', Toast._onDragMove);
document.addEventListener('mouseup', Toast._onDragEnd);
document.body.appendChild(container);
Toast._container = container;
}
/**
* Remove toast container and event handlers
*/
}, {
key: '_removeContainer',
value: function _removeContainer() {
// Add event handler
document.removeEventListener('mousemove', Toast._onDragMove);
document.removeEventListener('mouseup', Toast._onDragEnd);
Toast._container.parentNode.removeChild(Toast._container);
Toast._container = null;
}
/**
* Begin drag handler
* @param {Event} e
*/
}, {
key: '_onDragStart',
value: function _onDragStart(e) {
if (e.target && $(e.target).closest('.toast').length) {
var $toast = $(e.target).closest('.toast');
var toast = $toast[0].M_Toast;
toast.panning = true;
Toast._draggedToast = toast;
toast.el.classList.add('panning');
toast.el.style.transition = '';
toast.startingXPos = Toast._xPos(e);
toast.time = Date.now();
toast.xPos = Toast._xPos(e);
}
}
/**
* Drag move handler
* @param {Event} e
*/
}, {
key: '_onDragMove',
value: function _onDragMove(e) {
if (!!Toast._draggedToast) {
e.preventDefault();
var toast = Toast._draggedToast;
toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
toast.xPos = Toast._xPos(e);
toast.velocityX = toast.deltaX / (Date.now() - toast.time);
toast.time = Date.now();
var totalDeltaX = toast.xPos - toast.startingXPos;
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)';
toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance);
}
}
/**
* End drag handler
* @param {Event} e
*/
}, {
key: '_onDragEnd',
value: function _onDragEnd(e) {
if (!!Toast._draggedToast) {
var toast = Toast._draggedToast;
toast.panning = false;
toast.el.classList.remove('panning');
var totalDeltaX = toast.xPos - toast.startingXPos;
var activationDistance = toast.el.offsetWidth * toast.options.activationPercent;
var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1;
// Remove toast
if (shouldBeDismissed) {
toast.wasSwiped = true;
toast.remove();
// Animate toast back to original position
} else {
toast.el.style.transition = 'transform .2s, opacity .2s';
toast.el.style.transform = '';
toast.el.style.opacity = '';
}
Toast._draggedToast = null;
}
}
/**
* Get x position of mouse or touch event
* @param {Event} e
*/
}, {
key: '_xPos',
value: function _xPos(e) {
if (e.targetTouches && e.targetTouches.length >= 1) {
return e.targetTouches[0].clientX;
}
// mouse event
return e.clientX;
}
/**
* Remove all toasts
*/
}, {
key: 'removeAll',
value: function removeAll() {
for (var toastIndex in Toast._toasts) {
Toast._toasts[toastIndex].remove();
}
}
}, {
key: 'defaults',
get: function () {
return _defaults;
}
}]);
return Toast;
}();
/**
* @static
* @memberof Toast
* @type {Array.<Toast>}
*/
Toast._toasts = [];
/**
* @static
* @memberof Toast
*/
Toast._container = null;
/**
* @static
* @memberof Toast
* @type {Toast}
*/
Toast._draggedToast = null;
Materialize.Toast = Toast;
Materialize.toast = function (message, displayLength, className, completeCallback) {
return new Toast(message, displayLength, className, completeCallback);
};
})(jQuery, Materialize.Vel);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
menuWidth: 300,
edge: 'left',
closeOnClick: false,
draggable: true,
onOpen: null,
onClose: null
};
options = $.extend(defaults, options);
$(this).each(function () {
var $this = $(this);
var menuId = $this.attr('data-activates');
var menu = $("#" + menuId);
// Set to width
if (options.menuWidth != 300) {
menu.css('width', options.menuWidth);
}
// Add Touch Area
var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
if (options.draggable) {
// Regenerate dragTarget
if ($dragTarget.length) {
$dragTarget.remove();
}
$dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
$('body').append($dragTarget);
} else {
$dragTarget = $();
}
if (options.edge == 'left') {
menu.css('transform', 'translateX(-100%)');
$dragTarget.css({ 'left': 0 }); // Add Touch Area
} else {
menu.addClass('right-aligned') // Change text-alignment to right
.css('transform', 'translateX(100%)');
$dragTarget.css({ 'right': 0 }); // Add Touch Area
}
// If fixed sidenav, bring menu out
if (menu.hasClass('fixed')) {
if (window.innerWidth > 992) {
menu.css('transform', 'translateX(0)');
}
}
// Window resize to reset on large screens fixed
if (menu.hasClass('fixed')) {
$(window).resize(function () {
if (window.innerWidth > 992) {
// Close menu if window is resized bigger than 992 and user has fixed sidenav
if ($('#sidenav-overlay').length !== 0 && menuOut) {
removeMenu(true);
} else {
// menu.removeAttr('style');
menu.css('transform', 'translateX(0%)');
// menu.css('width', options.menuWidth);
}
} else if (menuOut === false) {
if (options.edge === 'left') {
menu.css('transform', 'translateX(-100%)');
} else {
menu.css('transform', 'translateX(100%)');
}
}
});
}
// if closeOnClick, then add close event for all a tags in side sideNav
if (options.closeOnClick === true) {
menu.on("click.itemclick", "a:not(.collapsible-header)", function () {
if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) {
removeMenu();
}
});
}
var removeMenu = function (restoreNav) {
panning = false;
menuOut = false;
// Reenable scrolling
$('body').css({
overflow: '',
width: ''
});
$('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200,
queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
} });
if (options.edge === 'left') {
// Reset phantom div
$dragTarget.css({ width: '', right: '', left: '0' });
menu.velocity({ 'translateX': '-100%' }, { duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
} else {
// Reset phantom div
$dragTarget.css({ width: '', right: '0', left: '' });
menu.velocity({ 'translateX': '100%' }, { duration: 200,
queue: false,
easing: 'easeOutCubic',
complete: function () {
if (restoreNav === true) {
// Restore Fixed sidenav
menu.removeAttr('style');
menu.css('width', options.menuWidth);
}
}
});
}
// Callback
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
};
// Touch Event
var panning = false;
var menuOut = false;
if (options.draggable) {
$dragTarget.on('click', function () {
if (menuOut) {
removeMenu();
}
});
$dragTarget.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType == "touch") {
var direction = e.gesture.direction;
var x = e.gesture.center.x;
var y = e.gesture.center.y;
var velocityX = e.gesture.velocityX;
// Vertical scroll bugfix
if (x === 0 && y === 0) {
return;
}
// Disable Scrolling
var $body = $('body');
var $overlay = $('#sidenav-overlay');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// If overlay does not exist, create one and if it is clicked, close menu
if ($overlay.length === 0) {
$overlay = $('<div id="sidenav-overlay"></div>');
$overlay.css('opacity', 0).click(function () {
removeMenu();
});
// Run 'onOpen' when sidenav is opened via touch/swipe if applicable
if (typeof options.onOpen === 'function') {
options.onOpen.call(this, menu);
}
$('body').append($overlay);
}
// Keep within boundaries
if (options.edge === 'left') {
if (x > options.menuWidth) {
x = options.menuWidth;
} else if (x < 0) {
x = 0;
}
}
if (options.edge === 'left') {
// Left Direction
if (x < options.menuWidth / 2) {
menuOut = false;
}
// Right Direction
else if (x >= options.menuWidth / 2) {
menuOut = true;
}
menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
} else {
// Left Direction
if (x < window.innerWidth - options.menuWidth / 2) {
menuOut = true;
}
// Right Direction
else if (x >= window.innerWidth - options.menuWidth / 2) {
menuOut = false;
}
var rightPos = x - options.menuWidth / 2;
if (rightPos < 0) {
rightPos = 0;
}
menu.css('transform', 'translateX(' + rightPos + 'px)');
}
// Percentage overlay
var overlayPerc;
if (options.edge === 'left') {
overlayPerc = x / options.menuWidth;
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
} else {
overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
$overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' });
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType == "touch") {
var $overlay = $('#sidenav-overlay');
var velocityX = e.gesture.velocityX;
var x = e.gesture.center.x;
var leftPos = x - options.menuWidth;
var rightPos = x - options.menuWidth / 2;
if (leftPos > 0) {
leftPos = 0;
}
if (rightPos < 0) {
rightPos = 0;
}
panning = false;
if (options.edge === 'left') {
// If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
if (menuOut && velocityX <= 0.3 || velocityX < -0.5) {
// Return menu to open
if (leftPos !== 0) {
menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
$dragTarget.css({ width: '50%', right: 0, left: '' });
menuOut = true;
} else if (!menuOut || velocityX > 0.3) {
// Enable Scrolling
$('body').css({
overflow: '',
width: ''
});
// Slide menu closed
menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
complete: function () {
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
$(this).remove();
} });
$dragTarget.css({ width: '10px', right: '', left: 0 });
}
} else {
if (menuOut && velocityX >= -0.3 || velocityX > 0.5) {
// Return menu to open
if (rightPos !== 0) {
menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
$overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' });
$dragTarget.css({ width: '50%', right: '', left: 0 });
menuOut = true;
} else if (!menuOut || velocityX < -0.3) {
// Enable Scrolling
$('body').css({
overflow: '',
width: ''
});
// Slide menu closed
menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' });
$overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad',
complete: function () {
// Run 'onClose' when sidenav is closed via touch/swipe if applicable
if (typeof options.onClose === 'function') {
options.onClose.call(this, menu);
}
$(this).remove();
} });
$dragTarget.css({ width: '10px', right: 0, left: '' });
}
}
}
});
}
$this.off('click.sidenav').on('click.sidenav', function () {
if (menuOut === true) {
menuOut = false;
panning = false;
removeMenu();
} else {
// Disable Scrolling
var $body = $('body');
var $overlay = $('<div id="sidenav-overlay"></div>');
var oldWidth = $body.innerWidth();
$body.css('overflow', 'hidden');
$body.width(oldWidth);
// Push current drag target on top of DOM tree
$('body').append($dragTarget);
if (options.edge === 'left') {
$dragTarget.css({ width: '50%', right: 0, left: '' });
menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
} else {
$dragTarget.css({ width: '50%', right: '', left: 0 });
menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
// Overlay close on click
$overlay.css('opacity', 0).click(function () {
menuOut = false;
panning = false;
removeMenu();
$overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$(this).remove();
}
});
});
// Append body
$('body').append($overlay);
$overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
menuOut = true;
panning = false;
}
});
// Callback
if (typeof options.onOpen === 'function') {
options.onOpen.call(this, menu);
}
}
return false;
});
});
},
destroy: function () {
var $overlay = $('#sidenav-overlay');
var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
$overlay.trigger('click');
$dragTarget.remove();
$(this).off('click');
$overlay.remove();
},
show: function () {
this.trigger('click');
},
hide: function () {
$('#sidenav-overlay').trigger('click');
}
};
$.fn.sideNav = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav');
}
}; // Plugin end
})(jQuery);
; /**
* Extend jquery with a scrollspy plugin.
* This watches the window scroll and fires events when elements are scrolled into viewport.
*
* throttle() and getTime() taken from Underscore.js
* https://github.com/jashkenas/underscore
*
* @author Copyright 2013 John Smart
* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
* @see https://github.com/thesmart
* @version 0.1.2
*/
(function ($) {
var jWindow = $(window);
var elements = [];
var elementsInView = [];
var isSpying = false;
var ticks = 0;
var unique_id = 1;
var offset = {
top: 0,
right: 0,
bottom: 0,
left: 0
/**
* Find elements that are within the boundary
* @param {number} top
* @param {number} right
* @param {number} bottom
* @param {number} left
* @return {jQuery} A collection of elements
*/
};function findElements(top, right, bottom, left) {
var hits = $();
$.each(elements, function (i, element) {
if (element.height() > 0) {
var elTop = element.offset().top,
elLeft = element.offset().left,
elRight = elLeft + element.width(),
elBottom = elTop + element.height();
var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top);
if (isIntersect) {
hits.push(element);
}
}
});
return hits;
}
/**
* Called when the user scrolls the window
*/
function onScroll(scrollOffset) {
// unique tick id
++ticks;
// viewport rectangle
var top = jWindow.scrollTop(),
left = jWindow.scrollLeft(),
right = left + jWindow.width(),
bottom = top + jWindow.height();
// determine which elements are in view
var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left);
$.each(intersections, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick != 'number') {
// entered into view
element.triggerHandler('scrollSpy:enter');
}
// update tick id
element.data('scrollSpy:ticks', ticks);
});
// determine which elements are no longer in view
$.each(elementsInView, function (i, element) {
var lastTick = element.data('scrollSpy:ticks');
if (typeof lastTick == 'number' && lastTick !== ticks) {
// exited from view
element.triggerHandler('scrollSpy:exit');
element.data('scrollSpy:ticks', null);
}
});
// remember elements in view for next tick
elementsInView = intersections;
}
/**
* Called when window is resized
*/
function onWinSize() {
jWindow.trigger('scrollSpy:winSize');
}
/**
* Enables ScrollSpy using a selector
* @param {jQuery|string} selector The elements collection, or a selector
* @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
activeClass : string -> Class name to be added to the active link. Default: active
* @returns {jQuery}
*/
$.scrollSpy = function (selector, options) {
var defaults = {
throttle: 100,
scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
activeClass: 'active',
getActiveElement: function (id) {
return 'a[href="#' + id + '"]';
}
};
options = $.extend(defaults, options);
var visible = [];
selector = $(selector);
selector.each(function (i, element) {
elements.push($(element));
$(element).data("scrollSpy:id", i);
// Smooth scroll to section
$('a[href="#' + $(element).attr('id') + '"]').click(function (e) {
e.preventDefault();
var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
$('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' });
});
});
offset.top = options.offsetTop || 0;
offset.right = options.offsetRight || 0;
offset.bottom = options.offsetBottom || 0;
offset.left = options.offsetLeft || 0;
var throttledScroll = Materialize.throttle(function () {
onScroll(options.scrollOffset);
}, options.throttle || 100);
var readyScroll = function () {
$(document).ready(throttledScroll);
};
if (!isSpying) {
jWindow.on('scroll', readyScroll);
jWindow.on('resize', readyScroll);
isSpying = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(readyScroll, 0);
selector.on('scrollSpy:enter', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
var $this = $(this);
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
visible.unshift($(this));
} else {
visible.push($(this));
}
} else {
visible.push($(this));
}
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
});
selector.on('scrollSpy:exit', function () {
visible = $.grep(visible, function (value) {
return value.height() != 0;
});
if (visible[0]) {
$(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
var $this = $(this);
visible = $.grep(visible, function (value) {
return value.attr('id') != $this.attr('id');
});
if (visible[0]) {
// Check if empty
$(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
}
}
});
return selector;
};
/**
* Listen for window resize events
* @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
* @returns {jQuery} $(window)
*/
$.winSizeSpy = function (options) {
$.winSizeSpy = function () {
return jWindow;
}; // lock from multiple calls
options = options || {
throttle: 100
};
return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
};
/**
* Enables ScrollSpy on a collection of elements
* e.g. $('.scrollSpy').scrollSpy()
* @param {Object=} options Optional.
throttle : number -> scrollspy throttling. Default: 100 ms
offsetTop : number -> offset from top. Default: 0
offsetRight : number -> offset from right. Default: 0
offsetBottom : number -> offset from bottom. Default: 0
offsetLeft : number -> offset from left. Default: 0
* @returns {jQuery}
*/
$.fn.scrollSpy = function (options) {
return $.scrollSpy($(this), options);
};
})(jQuery);
;(function ($) {
$(document).ready(function () {
// Function to update labels of text fields
Materialize.updateTextFields = function () {
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
$(input_selector).each(function (index, element) {
var $this = $(this);
if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
$this.siblings('label').addClass('active');
} else if ($(element)[0].validity) {
$this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
} else {
$this.siblings('label').removeClass('active');
}
});
};
// Text based inputs
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
// Add active if form auto complete
$(document).on('change', input_selector, function () {
if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
$(this).siblings('label').addClass('active');
}
validate_field($(this));
});
// Add active if input element has been pre-populated on document ready
$(document).ready(function () {
Materialize.updateTextFields();
});
// HTML DOM FORM RESET handling
$(document).on('reset', function (e) {
var formReset = $(e.target);
if (formReset.is('form')) {
formReset.find(input_selector).removeClass('valid').removeClass('invalid');
formReset.find(input_selector).each(function () {
if ($(this).attr('value') === '') {
$(this).siblings('label').removeClass('active');
}
});
// Reset select
formReset.find('select.initialized').each(function () {
var reset_text = formReset.find('option[selected]').text();
formReset.siblings('input.select-dropdown').val(reset_text);
});
}
});
// Add active when element has focus
$(document).on('focus', input_selector, function () {
$(this).siblings('label, .prefix').addClass('active');
});
$(document).on('blur', input_selector, function () {
var $inputElement = $(this);
var selector = ".prefix";
if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
selector += ", label";
}
$inputElement.siblings(selector).removeClass('active');
validate_field($inputElement);
});
window.validate_field = function (object) {
var hasLength = object.attr('data-length') !== undefined;
var lenAttr = parseInt(object.attr('data-length'));
var len = object.val().length;
if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
if (object.hasClass('validate')) {
object.removeClass('valid');
object.removeClass('invalid');
}
} else {
if (object.hasClass('validate')) {
// Check for character counter attributes
if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) {
object.removeClass('invalid');
object.addClass('valid');
} else {
object.removeClass('valid');
object.addClass('invalid');
}
}
}
};
// Radio and Checkbox focus class
var radio_checkbox = 'input[type=radio], input[type=checkbox]';
$(document).on('keyup.radio', radio_checkbox, function (e) {
// TAB, check if tabbing to radio or checkbox.
if (e.which === 9) {
$(this).addClass('tabbed');
var $this = $(this);
$this.one('blur', function (e) {
$(this).removeClass('tabbed');
});
return;
}
});
// Textarea Auto Resize
var hiddenDiv = $('.hiddendiv').first();
if (!hiddenDiv.length) {
hiddenDiv = $('<div class="hiddendiv common"></div>');
$('body').append(hiddenDiv);
}
var text_area_selector = '.materialize-textarea';
function textareaAutoResize($textarea) {
// Set font properties of hiddenDiv
var fontFamily = $textarea.css('font-family');
var fontSize = $textarea.css('font-size');
var lineHeight = $textarea.css('line-height');
var padding = $textarea.css('padding');
if (fontSize) {
hiddenDiv.css('font-size', fontSize);
}
if (fontFamily) {
hiddenDiv.css('font-family', fontFamily);
}
if (lineHeight) {
hiddenDiv.css('line-height', lineHeight);
}
if (padding) {
hiddenDiv.css('padding', padding);
}
// Set original-height, if none
if (!$textarea.data('original-height')) {
$textarea.data('original-height', $textarea.height());
}
if ($textarea.attr('wrap') === 'off') {
hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre');
}
hiddenDiv.text($textarea.val() + '\n');
var content = hiddenDiv.html().replace(/\n/g, '<br>');
hiddenDiv.html(content);
// When textarea is hidden, width goes crazy.
// Approximate with half of window size
if ($textarea.is(':visible')) {
hiddenDiv.css('width', $textarea.width());
} else {
hiddenDiv.css('width', $(window).width() / 2);
}
/**
* Resize if the new height is greater than the
* original height of the textarea
*/
if ($textarea.data('original-height') <= hiddenDiv.height()) {
$textarea.css('height', hiddenDiv.height());
} else if ($textarea.val().length < $textarea.data('previous-length')) {
/**
* In case the new height is less than original height, it
* means the textarea has less text than before
* So we set the height to the original one
*/
$textarea.css('height', $textarea.data('original-height'));
}
$textarea.data('previous-length', $textarea.val().length);
}
$(text_area_selector).each(function () {
var $textarea = $(this);
/**
* Instead of resizing textarea on document load,
* store the original height and the original length
*/
$textarea.data('original-height', $textarea.height());
$textarea.data('previous-length', $textarea.val().length);
});
$('body').on('keyup keydown autoresize', text_area_selector, function () {
textareaAutoResize($(this));
});
// File Input Path
$(document).on('change', '.file-field input[type="file"]', function () {
var file_field = $(this).closest('.file-field');
var path_input = file_field.find('input.file-path');
var files = $(this)[0].files;
var file_names = [];
for (var i = 0; i < files.length; i++) {
file_names.push(files[i].name);
}
path_input.val(file_names.join(", "));
path_input.trigger('change');
});
/****************
* Range Input *
****************/
var range_type = 'input[type=range]';
var range_mousedown = false;
var left;
$(range_type).each(function () {
var thumb = $('<span class="thumb"><span class="value"></span></span>');
$(this).after(thumb);
});
var showRangeBubble = function (thumb) {
var paddingLeft = parseInt(thumb.parent().css('padding-left'));
var marginLeft = -7 + paddingLeft + 'px';
thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' });
};
var calcRangeOffset = function (range) {
var width = range.width() - 15;
var max = parseFloat(range.attr('max'));
var min = parseFloat(range.attr('min'));
var percent = (parseFloat(range.val()) - min) / (max - min);
return percent * width;
};
var range_wrapper = '.range-field';
$(document).on('change', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
thumb.find('.value').html($(this).val());
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
});
$(document).on('mousedown touchstart', range_type, function (e) {
var thumb = $(this).siblings('.thumb');
// If thumb indicator does not exist yet, create it
if (thumb.length <= 0) {
thumb = $('<span class="thumb"><span class="value"></span></span>');
$(this).after(thumb);
}
// Set indicator value
thumb.find('.value').html($(this).val());
range_mousedown = true;
$(this).addClass('active');
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
if (e.type !== 'input') {
var offsetLeft = calcRangeOffset($(this));
thumb.addClass('active').css('left', offsetLeft);
}
});
$(document).on('mouseup touchend', range_wrapper, function () {
range_mousedown = false;
$(this).removeClass('active');
});
$(document).on('input mousemove touchmove', range_wrapper, function (e) {
var thumb = $(this).children('.thumb');
var left;
var input = $(this).find(range_type);
if (range_mousedown) {
if (!thumb.hasClass('active')) {
showRangeBubble(thumb);
}
var offsetLeft = calcRangeOffset(input);
thumb.addClass('active').css('left', offsetLeft);
thumb.find('.value').html(thumb.siblings(range_type).val());
}
});
$(document).on('mouseout touchleave', range_wrapper, function () {
if (!range_mousedown) {
var thumb = $(this).children('.thumb');
var paddingLeft = parseInt($(this).css('padding-left'));
var marginLeft = 7 + paddingLeft + 'px';
if (thumb.hasClass('active')) {
thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 });
}
thumb.removeClass('active');
}
});
/**************************
* Auto complete plugin *
*************************/
$.fn.autocomplete = function (options) {
// Defaults
var defaults = {
data: {},
limit: Infinity,
onAutocomplete: null,
minLength: 1
};
options = $.extend(defaults, options);
return this.each(function () {
var $input = $(this);
var data = options.data,
count = 0,
activeIndex = -1,
oldVal,
$inputDiv = $input.closest('.input-field'); // Div to append on
// Check if data isn't empty
if (!$.isEmptyObject(data)) {
var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
var $oldAutocomplete;
// Append autocomplete element.
// Prevent double structure init.
if ($inputDiv.length) {
$oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
if (!$oldAutocomplete.length) {
$inputDiv.append($autocomplete); // Set ul in body
}
} else {
$oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
if (!$oldAutocomplete.length) {
$input.after($autocomplete);
}
}
if ($oldAutocomplete.length) {
$autocomplete = $oldAutocomplete;
}
// Highlight partial match.
var highlight = function (string, $el) {
var img = $el.find('img');
var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
matchEnd = matchStart + string.length - 1,
beforeMatch = $el.text().slice(0, matchStart),
matchText = $el.text().slice(matchStart, matchEnd + 1),
afterMatch = $el.text().slice(matchEnd + 1);
$el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
if (img.length) {
$el.prepend(img);
}
};
// Reset current element position
var resetCurrentElement = function () {
activeIndex = -1;
$autocomplete.find('.active').removeClass('active');
};
// Remove autocomplete elements
var removeAutocomplete = function () {
$autocomplete.empty();
resetCurrentElement();
oldVal = undefined;
};
$input.off('blur.autocomplete').on('blur.autocomplete', function () {
removeAutocomplete();
});
// Perform search
$input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
// Reset count.
count = 0;
var val = $input.val().toLowerCase();
// Don't capture enter or arrow key usage.
if (e.which === 13 || e.which === 38 || e.which === 40) {
return;
}
// Check if the input isn't empty
if (oldVal !== val) {
removeAutocomplete();
if (val.length >= options.minLength) {
for (var key in data) {
if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) {
// Break if past limit
if (count >= options.limit) {
break;
}
var autocompleteOption = $('<li></li>');
if (!!data[key]) {
autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>');
} else {
autocompleteOption.append('<span>' + key + '</span>');
}
$autocomplete.append(autocompleteOption);
highlight(val, autocompleteOption);
count++;
}
}
}
}
// Update oldVal
oldVal = val;
});
$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
// Arrow keys and enter key usage
var keyCode = e.which,
liElement,
numItems = $autocomplete.children('li').length,
$active = $autocomplete.children('.active').first();
// select element on Enter
if (keyCode === 13 && activeIndex >= 0) {
liElement = $autocomplete.children('li').eq(activeIndex);
if (liElement.length) {
liElement.trigger('mousedown.autocomplete');
e.preventDefault();
}
return;
}
// Capture up and down key
if (keyCode === 38 || keyCode === 40) {
e.preventDefault();
if (keyCode === 38 && activeIndex > 0) {
activeIndex--;
}
if (keyCode === 40 && activeIndex < numItems - 1) {
activeIndex++;
}
$active.removeClass('active');
if (activeIndex >= 0) {
$autocomplete.children('li').eq(activeIndex).addClass('active');
}
}
});
// Set input value
$autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
var text = $(this).text().trim();
$input.val(text);
$input.trigger('change');
removeAutocomplete();
// Handle onAutocomplete callback.
if (typeof options.onAutocomplete === "function") {
options.onAutocomplete.call(this, text);
}
});
// Empty data
} else {
$input.off('keyup.autocomplete focus.autocomplete');
}
});
};
}); // End of $(document).ready
/*******************
* Select Plugin *
******************/
$.fn.material_select = function (callback) {
$(this).each(function () {
var $select = $(this);
if ($select.hasClass('browser-default')) {
return; // Continue to next (return false breaks out of entire loop)
}
var multiple = $select.attr('multiple') ? true : false,
lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
if (lastID) {
$select.parent().find('span.caret').remove();
$select.parent().find('input').remove();
$select.unwrap();
$('ul#select-options-' + lastID).remove();
}
// If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
if (callback === 'destroy') {
$select.removeAttr('data-select-id').removeClass('initialized');
$(window).off('click.select');
return;
}
var uniqueID = Materialize.guid();
$select.attr('data-select-id', uniqueID);
var wrapper = $('<div class="select-wrapper"></div>');
wrapper.addClass($select.attr('class'));
if ($select.is(':disabled')) wrapper.addClass('disabled');
var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
selectChildren = $select.children('option, optgroup'),
valuesSelected = [],
optionsHover = false;
var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
// Function that renders and appends the option taking into
// account type and possible image icon.
var appendOptionWithIcon = function (select, option, type) {
// Add disabled attr if disabled
var disabledClass = option.is(':disabled') ? 'disabled ' : '';
var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : '';
var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
// add icons
var icon_url = option.data('icon');
var classes = option.attr('class');
if (!!icon_url) {
var classString = '';
if (!!classes) classString = ' class="' + classes + '"';
// Check for multiple type.
options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
return true;
}
// Check for multiple type.
options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
};
/* Create dropdown structure. */
if (selectChildren.length) {
selectChildren.each(function () {
if ($(this).is('option')) {
// Direct descendant option.
if (multiple) {
appendOptionWithIcon($select, $(this), 'multiple');
} else {
appendOptionWithIcon($select, $(this));
}
} else if ($(this).is('optgroup')) {
// Optgroup.
var selectOptions = $(this).children('option');
options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
selectOptions.each(function () {
appendOptionWithIcon($select, $(this), 'optgroup-option');
});
}
});
}
options.find('li:not(.optgroup)').each(function (i) {
$(this).click(function (e) {
// Check if option element is disabled
if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
var selected = true;
if (multiple) {
$('input[type="checkbox"]', this).prop('checked', function (i, v) {
return !v;
});
selected = toggleEntryFromArray(valuesSelected, i, $select);
$newSelect.trigger('focus');
} else {
options.find('li').removeClass('active');
$(this).toggleClass('active');
$newSelect.val($(this).text());
}
activateOption(options, $(this));
$select.find('option').eq(i).prop('selected', selected);
// Trigger onchange() event
$select.trigger('change');
if (typeof callback !== 'undefined') callback();
}
e.stopPropagation();
});
});
// Wrap Elements
$select.wrap(wrapper);
// Add Select Display Element
var dropdownIcon = $('<span class="caret">&#9660;</span>');
// escape double quotes
var sanitizedLabelHtml = label.replace(/"/g, '&quot;');
var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>');
$select.before($newSelect);
$newSelect.before(dropdownIcon);
$newSelect.after(options);
// Check if section element is disabled
if (!$select.is(':disabled')) {
$newSelect.dropdown({ 'hover': false });
}
// Copy tabindex
if ($select.attr('tabindex')) {
$($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
}
$select.addClass('initialized');
$newSelect.on({
'focus': function () {
if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
$('input.select-dropdown').trigger('close');
$(window).off('click.select');
}
if (!options.is(':visible')) {
$(this).trigger('open', ['focus']);
var label = $(this).val();
if (multiple && label.indexOf(',') >= 0) {
label = label.split(',')[0];
}
var selectedOption = options.find('li').filter(function () {
return $(this).text().toLowerCase() === label.toLowerCase();
})[0];
activateOption(options, selectedOption, true);
$(window).off('click.select').on('click.select', function () {
multiple && (optionsHover || $newSelect.trigger('close'));
$(window).off('click.select');
});
}
},
'click': function (e) {
e.stopPropagation();
}
});
$newSelect.on('blur', function () {
if (!multiple) {
$(this).trigger('close');
$(window).off('click.select');
}
options.find('li.selected').removeClass('selected');
});
options.hover(function () {
optionsHover = true;
}, function () {
optionsHover = false;
});
// Add initial multiple selections.
if (multiple) {
$select.find("option:selected:not(:disabled)").each(function () {
var index = this.index;
toggleEntryFromArray(valuesSelected, index, $select);
options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
});
}
/**
* Make option as selected and scroll to selected position
* @param {jQuery} collection Select options jQuery element
* @param {Element} newOption element of the new option
* @param {Boolean} firstActivation If on first activation of select
*/
var activateOption = function (collection, newOption, firstActivation) {
if (newOption) {
collection.find('li.selected').removeClass('selected');
var option = $(newOption);
option.addClass('selected');
if (!multiple || !!firstActivation) {
options.scrollTo(option);
}
}
};
// Allow user to search by typing
// this array is cleared after 1 second
var filterQuery = [],
onKeyDown = function (e) {
// TAB - switch to another input
if (e.which == 9) {
$newSelect.trigger('close');
return;
}
// ARROW DOWN WHEN SELECT IS CLOSED - open select options
if (e.which == 40 && !options.is(':visible')) {
$newSelect.trigger('open');
return;
}
// ENTER WHEN SELECT IS CLOSED - submit form
if (e.which == 13 && !options.is(':visible')) {
return;
}
e.preventDefault();
// CASE WHEN USER TYPE LETTERS
var letter = String.fromCharCode(e.which).toLowerCase(),
nonLetters = [9, 13, 27, 38, 40];
if (letter && nonLetters.indexOf(e.which) === -1) {
filterQuery.push(letter);
var string = filterQuery.join(''),
newOption = options.find('li').filter(function () {
return $(this).text().toLowerCase().indexOf(string) === 0;
})[0];
if (newOption) {
activateOption(options, newOption);
}
}
// ENTER - select option and close when select options are opened
if (e.which == 13) {
var activeOption = options.find('li.selected:not(.disabled)')[0];
if (activeOption) {
$(activeOption).trigger('click');
if (!multiple) {
$newSelect.trigger('close');
}
}
}
// ARROW DOWN - move to next not disabled option
if (e.which == 40) {
if (options.find('li.selected').length) {
newOption = options.find('li.selected').next('li:not(.disabled)')[0];
} else {
newOption = options.find('li:not(.disabled)')[0];
}
activateOption(options, newOption);
}
// ESC - close options
if (e.which == 27) {
$newSelect.trigger('close');
}
// ARROW UP - move to previous not disabled option
if (e.which == 38) {
newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
if (newOption) activateOption(options, newOption);
}
// Automaticaly clean filter query so user can search again by starting letters
setTimeout(function () {
filterQuery = [];
}, 1000);
};
$newSelect.on('keydown', onKeyDown);
});
function toggleEntryFromArray(entriesArray, entryIndex, select) {
var index = entriesArray.indexOf(entryIndex),
notAdded = index === -1;
if (notAdded) {
entriesArray.push(entryIndex);
} else {
entriesArray.splice(index, 1);
}
select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
// use notAdded instead of true (to detect if the option is selected or not)
select.find('option').eq(entryIndex).prop('selected', notAdded);
setValueToInput(entriesArray, select);
return notAdded;
}
function setValueToInput(entriesArray, select) {
var value = '';
for (var i = 0, count = entriesArray.length; i < count; i++) {
var text = select.find('option').eq(entriesArray[i]).text();
i === 0 ? value += text : value += ', ' + text;
}
if (value === '') {
value = select.find('option:disabled').eq(0).text();
}
select.siblings('input.select-dropdown').val(value);
}
};
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
indicators: true,
height: 400,
transition: 500,
interval: 6000
};
options = $.extend(defaults, options);
return this.each(function () {
// For each slider, we want to keep track of
// which slide is active and its associated content
var $this = $(this);
var $slider = $this.find('ul.slides').first();
var $slides = $slider.find('> li');
var $active_index = $slider.find('.active').index();
var $active, $indicators, $interval;
if ($active_index != -1) {
$active = $slides.eq($active_index);
}
// Transitions the caption depending on alignment
function captionTransition(caption, duration) {
if (caption.hasClass("center-align")) {
caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false });
} else if (caption.hasClass("right-align")) {
caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false });
} else if (caption.hasClass("left-align")) {
caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false });
}
}
// This function will transition the slide to any index of the next slide
function moveToSlide(index) {
// Wrap around indices.
if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1;
$active_index = $slider.find('.active').index();
// Only do if index changes
if ($active_index != index) {
$active = $slides.eq($active_index);
$caption = $active.find('.caption');
$active.removeClass('active');
$active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad',
complete: function () {
$slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false });
} });
captionTransition($caption, options.transition);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).removeClass('active');
}
$slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
$slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' });
$slides.eq(index).addClass('active');
// Update indicators
if (options.indicators) {
$indicators.eq(index).addClass('active');
}
}
}
// Set height of slider
// If fullscreen, do nothing
if (!$this.hasClass('fullscreen')) {
if (options.indicators) {
// Add height if indicators are present
$this.height(options.height + 40);
} else {
$this.height(options.height);
}
$slider.height(options.height);
}
// Set initial positions of captions
$slides.find('.caption').each(function () {
captionTransition($(this), 0);
});
// Move img src into background-image
$slides.find('img').each(function () {
var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
if ($(this).attr('src') !== placeholderBase64) {
$(this).css('background-image', 'url("' + $(this).attr('src') + '")');
$(this).attr('src', placeholderBase64);
}
});
// dynamically add indicators
if (options.indicators) {
$indicators = $('<ul class="indicators"></ul>');
$slides.each(function (index) {
var $indicator = $('<li class="indicator-item"></li>');
// Handle clicks on indicators
$indicator.click(function () {
var $parent = $slider.parent();
var curr_index = $parent.find($(this)).index();
moveToSlide(curr_index);
// reset interval
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
});
$indicators.append($indicator);
});
$this.append($indicators);
$indicators = $this.find('ul.indicators').find('li.indicator-item');
}
if ($active) {
$active.show();
} else {
$slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
$active_index = 0;
$active = $slides.eq($active_index);
// Update indicators
if (options.indicators) {
$indicators.eq($active_index).addClass('active');
}
}
// Adjust height to current slide
$active.find('img').each(function () {
$active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' });
});
// auto scroll
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
}, options.transition + options.interval);
// HammerJS, Swipe navigation
// Touch Event
var panning = false;
var swipeLeft = false;
var swipeRight = false;
$this.hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
// reset interval
clearInterval($interval);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
var velocityY = e.gesture.velocityY;
$curr_slide = $slider.find('.active');
if (Math.abs(velocityX) > Math.abs(velocityY)) {
$curr_slide.velocity({ translateX: x
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
}
// Swipe Left
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) {
swipeRight = true;
}
// Swipe Right
else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) {
swipeLeft = true;
}
// Make Slide Behind active slide visible
var next_slide;
if (swipeLeft) {
next_slide = $curr_slide.next();
if (next_slide.length === 0) {
next_slide = $slides.first();
}
next_slide.velocity({ opacity: 1
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
if (swipeRight) {
next_slide = $curr_slide.prev();
if (next_slide.length === 0) {
next_slide = $slides.last();
}
next_slide.velocity({ opacity: 1
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
}
}
}).on('panend', function (e) {
if (e.gesture.pointerType === "touch") {
$curr_slide = $slider.find('.active');
panning = false;
curr_index = $slider.find('.active').index();
if (!swipeRight && !swipeLeft || $slides.length <= 1) {
// Return to original spot
$curr_slide.velocity({ translateX: 0
}, { duration: 300, queue: false, easing: 'easeOutQuad' });
} else if (swipeLeft) {
moveToSlide(curr_index + 1);
$curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
} });
} else if (swipeRight) {
moveToSlide(curr_index - 1);
$curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad',
complete: function () {
$curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false });
} });
}
swipeLeft = false;
swipeRight = false;
// Restart interval
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
}
});
$this.on('sliderPause', function () {
clearInterval($interval);
});
$this.on('sliderStart', function () {
clearInterval($interval);
$interval = setInterval(function () {
$active_index = $slider.find('.active').index();
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
else $active_index += 1;
moveToSlide($active_index);
}, options.transition + options.interval);
});
$this.on('sliderNext', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index + 1);
});
$this.on('sliderPrev', function () {
$active_index = $slider.find('.active').index();
moveToSlide($active_index - 1);
});
});
},
pause: function () {
$(this).trigger('sliderPause');
},
start: function () {
$(this).trigger('sliderStart');
},
next: function () {
$(this).trigger('sliderNext');
},
prev: function () {
$(this).trigger('sliderPrev');
}
};
$.fn.slider = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip');
}
}; // Plugin end
})(jQuery);
;(function ($) {
$(document).ready(function () {
$(document).on('click.card', '.card', function (e) {
if ($(this).find('> .card-reveal').length) {
var $card = $(e.target).closest('.card');
if ($card.data('initialOverflow') === undefined) {
$card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow'));
}
if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
// Make Reveal animate down and display none
$(this).find('.card-reveal').velocity({ translateY: 0 }, {
duration: 225,
queue: false,
easing: 'easeInOutQuad',
complete: function () {
$(this).css({ display: 'none' });
$card.css('overflow', $card.data('initialOverflow'));
}
});
} else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) {
$card.css('overflow', 'hidden');
$(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' });
}
}
});
});
})(jQuery);
;(function ($) {
var materialChipsDefaults = {
data: [],
placeholder: '',
secondaryPlaceholder: '',
autocompleteOptions: {}
};
$(document).ready(function () {
// Handle removal of static chips.
$(document).on('click', '.chip .close', function (e) {
var $chips = $(this).closest('.chips');
if ($chips.attr('data-initialized')) {
return;
}
$(this).closest('.chip').remove();
});
});
$.fn.material_chip = function (options) {
var self = this;
this.$el = $(this);
this.$document = $(document);
this.SELS = {
CHIPS: '.chips',
CHIP: '.chip',
INPUT: 'input',
DELETE: '.material-icons',
SELECTED_CHIP: '.selected'
};
if ('data' === options) {
return this.$el.data('chips');
}
var curr_options = $.extend({}, materialChipsDefaults, options);
self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
// Initialize
this.init = function () {
var i = 0;
var chips;
self.$el.each(function () {
var $chips = $(this);
var chipId = Materialize.guid();
self.chipId = chipId;
if (!curr_options.data || !(curr_options.data instanceof Array)) {
curr_options.data = [];
}
$chips.data('chips', curr_options.data);
$chips.attr('data-index', i);
$chips.attr('data-initialized', true);
if (!$chips.hasClass(self.SELS.CHIPS)) {
$chips.addClass('chips');
}
self.chips($chips, chipId);
i++;
});
};
this.handleEvents = function () {
var SELS = self.SELS;
self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) {
$(e.target).find(SELS.INPUT).focus();
});
self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) {
var $chip = $(e.target);
if ($chip.length) {
var wasSelected = $chip.hasClass('selected');
var $chips = $chip.closest(SELS.CHIPS);
$(SELS.CHIP).removeClass('selected');
if (!wasSelected) {
self.selectChip($chip.index(), $chips);
}
}
});
self.$document.off('keydown.chips').on('keydown.chips', function (e) {
if ($(e.target).is('input, textarea')) {
return;
}
// delete
var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
var $chips = $chip.closest(SELS.CHIPS);
var length = $chip.siblings(SELS.CHIP).length;
var index;
if (!$chip.length) {
return;
}
if (e.which === 8 || e.which === 46) {
e.preventDefault();
index = $chip.index();
self.deleteChip(index, $chips);
var selectIndex = null;
if (index + 1 < length) {
selectIndex = index;
} else if (index === length || index + 1 === length) {
selectIndex = length - 1;
}
if (selectIndex < 0) selectIndex = null;
if (null !== selectIndex) {
self.selectChip(selectIndex, $chips);
}
if (!length) $chips.find('input').focus();
// left
} else if (e.which === 37) {
index = $chip.index() - 1;
if (index < 0) {
return;
}
$(SELS.CHIP).removeClass('selected');
self.selectChip(index, $chips);
// right
} else if (e.which === 39) {
index = $chip.index() + 1;
$(SELS.CHIP).removeClass('selected');
if (index > length) {
$chips.find('input').focus();
return;
}
self.selectChip(index, $chips);
}
});
self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.addClass('focus');
$currChips.siblings('label, .prefix').addClass('active');
$(SELS.CHIP).removeClass('selected');
});
self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $currChips = $(e.target).closest(SELS.CHIPS);
$currChips.removeClass('focus');
// Remove active if empty
if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
$currChips.siblings('label').removeClass('active');
}
$currChips.siblings('.prefix').removeClass('active');
});
self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var chipsLength = $chips.children(SELS.CHIP).length;
// enter
if (13 === e.which) {
// Override enter if autocompleting.
if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) {
return;
}
e.preventDefault();
self.addChip({ tag: $target.val() }, $chips);
$target.val('');
return;
}
// delete or left
if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
e.preventDefault();
self.selectChip(chipsLength - 1, $chips);
$target.blur();
return;
}
});
// Click on delete icon in chip.
self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) {
var $target = $(e.target);
var $chips = $target.closest(SELS.CHIPS);
var $chip = $target.closest(SELS.CHIP);
e.stopPropagation();
self.deleteChip($chip.index(), $chips);
$chips.find('input').focus();
});
};
this.chips = function ($chips, chipId) {
$chips.empty();
$chips.data('chips').forEach(function (elem) {
$chips.append(self.renderChip(elem));
});
$chips.append($('<input id="' + chipId + '" class="input" placeholder="">'));
self.setPlaceholder($chips);
// Set for attribute for label
var label = $chips.next('label');
if (label.length) {
label.attr('for', chipId);
if ($chips.data('chips') !== undefined && $chips.data('chips').length) {
label.addClass('active');
}
}
// Setup autocomplete if needed.
var input = $('#' + chipId);
if (self.hasAutocomplete) {
curr_options.autocompleteOptions.onAutocomplete = function (val) {
self.addChip({ tag: val }, $chips);
input.val('');
input.focus();
};
input.autocomplete(curr_options.autocompleteOptions);
}
};
/**
* Render chip jQuery element.
* @param {Object} elem
* @return {jQuery}
*/
this.renderChip = function (elem) {
if (!elem.tag) return;
var $renderedChip = $('<div class="chip"></div>');
$renderedChip.text(elem.tag);
if (elem.image) {
$renderedChip.prepend($('<img />').attr('src', elem.image));
}
$renderedChip.append($('<i class="material-icons close">close</i>'));
return $renderedChip;
};
this.setPlaceholder = function ($chips) {
if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) {
$chips.find('input').prop('placeholder', curr_options.placeholder);
} else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
$chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
}
};
this.isValid = function ($chips, elem) {
var chips = $chips.data('chips');
var exists = false;
for (var i = 0; i < chips.length; i++) {
if (chips[i].tag === elem.tag) {
exists = true;
return;
}
}
return '' !== elem.tag && !exists;
};
this.addChip = function (elem, $chips) {
if (!self.isValid($chips, elem)) {
return;
}
var $renderedChip = self.renderChip(elem);
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
newData.push(oldData[i]);
}
newData.push(elem);
$chips.data('chips', newData);
$renderedChip.insertBefore($chips.find('input'));
$chips.trigger('chip.add', elem);
self.setPlaceholder($chips);
};
this.deleteChip = function (chipIndex, $chips) {
var chip = $chips.data('chips')[chipIndex];
$chips.find('.chip').eq(chipIndex).remove();
var newData = [];
var oldData = $chips.data('chips');
for (var i = 0; i < oldData.length; i++) {
if (i !== chipIndex) {
newData.push(oldData[i]);
}
}
$chips.data('chips', newData);
$chips.trigger('chip.delete', chip);
self.setPlaceholder($chips);
};
this.selectChip = function (chipIndex, $chips) {
var $chip = $chips.find('.chip').eq(chipIndex);
if ($chip && false === $chip.hasClass('selected')) {
$chip.addClass('selected');
$chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
}
};
this.getChipsElement = function (index, $chips) {
return $chips.eq(index);
};
// init
this.init();
this.handleEvents();
};
})(jQuery);
;(function ($) {
$.fn.pushpin = function (options) {
// Defaults
var defaults = {
top: 0,
bottom: Infinity,
offset: 0
};
// Remove pushpin event and classes
if (options === "remove") {
this.each(function () {
if (id = $(this).data('pushpin-id')) {
$(window).off('scroll.' + id);
$(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
}
});
return false;
}
options = $.extend(defaults, options);
$index = 0;
return this.each(function () {
var $uniqueId = Materialize.guid(),
$this = $(this),
$original_offset = $(this).offset().top;
function removePinClasses(object) {
object.removeClass('pin-top');
object.removeClass('pinned');
object.removeClass('pin-bottom');
}
function updateElements(objects, scrolled) {
objects.each(function () {
// Add position fixed (because its between top and bottom)
if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
removePinClasses($(this));
$(this).css('top', options.offset);
$(this).addClass('pinned');
}
// Add pin-top (when scrolled position is above top)
if (scrolled < options.top && !$(this).hasClass('pin-top')) {
removePinClasses($(this));
$(this).css('top', 0);
$(this).addClass('pin-top');
}
// Add pin-bottom (when scrolled position is below bottom)
if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
removePinClasses($(this));
$(this).addClass('pin-bottom');
$(this).css('top', options.bottom - $original_offset);
}
});
}
$(this).data('pushpin-id', $uniqueId);
updateElements($this, $(window).scrollTop());
$(window).on('scroll.' + $uniqueId, function () {
var $scrolled = $(window).scrollTop() + options.offset;
updateElements($this, $scrolled);
});
});
};
})(jQuery);;(function ($) {
$(document).ready(function () {
// jQuery reverse
$.fn.reverse = [].reverse;
// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
$(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
openFABMenu($this);
});
$(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) {
var $this = $(this);
closeFABMenu($this);
});
// Toggle-on-click behaviour.
$(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
if ($menu.hasClass('active')) {
closeFABMenu($menu);
} else {
openFABMenu($menu);
}
});
// Toolbar transition behaviour.
$(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) {
var $this = $(this);
var $menu = $this.parent();
FABtoToolbar($menu);
});
});
$.fn.extend({
openFAB: function () {
openFABMenu($(this));
},
closeFAB: function () {
closeFABMenu($(this));
},
openToolbar: function () {
FABtoToolbar($(this));
},
closeToolbar: function () {
toolbarToFAB($(this));
}
});
var openFABMenu = function (btn) {
var $this = btn;
if ($this.hasClass('active') === false) {
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.addClass('active');
$this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 });
var time = 0;
$this.find('ul .btn-floating').reverse().each(function () {
$(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time });
time += 40;
});
}
};
var closeFABMenu = function (btn) {
var $this = btn;
// Get direction option
var horizontal = $this.hasClass('horizontal');
var offsetY, offsetX;
if (horizontal === true) {
offsetX = 40;
} else {
offsetY = 40;
}
$this.removeClass('active');
var time = 0;
$this.find('ul .btn-floating').velocity("stop", true);
$this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 });
};
/**
* Transform FAB into toolbar
* @param {Object} object jQuery object
*/
var FABtoToolbar = function (btn) {
if (btn.attr('data-open') === "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnRect = btn[0].getBoundingClientRect();
var anchor = btn.find('> a').first();
var menu = btn.find('> ul').first();
var backdrop = $('<div class="fab-backdrop"></div>');
var fabColor = anchor.css('background-color');
anchor.append(backdrop);
offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2;
offsetY = windowHeight - btnRect.bottom;
scaleFactor = windowWidth / backdrop.width();
btn.attr('data-origin-bottom', btnRect.bottom);
btn.attr('data-origin-left', btnRect.left);
btn.attr('data-origin-width', btnRect.width);
// Set initial state
btn.addClass('active');
btn.attr('data-open', true);
btn.css({
'text-align': 'center',
width: '100%',
bottom: 0,
left: 0,
transform: 'translateX(' + offsetX + 'px)',
transition: 'none'
});
anchor.css({
transform: 'translateY(' + -offsetY + 'px)',
transition: 'none'
});
backdrop.css({
'background-color': fabColor
});
setTimeout(function () {
btn.css({
transform: '',
transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
});
anchor.css({
overflow: 'visible',
transform: '',
transition: 'transform .2s'
});
setTimeout(function () {
btn.css({
overflow: 'hidden',
'background-color': fabColor
});
backdrop.css({
transform: 'scale(' + scaleFactor + ')',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
menu.find('> li > a').css({
opacity: 1
});
// Scroll to close.
$(window).on('scroll.fabToolbarClose', function () {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
});
$(document).on('click.fabToolbarClose', function (e) {
if (!$(e.target).closest(menu).length) {
toolbarToFAB(btn);
$(window).off('scroll.fabToolbarClose');
$(document).off('click.fabToolbarClose');
}
});
}, 100);
}, 0);
};
/**
* Transform toolbar back into FAB
* @param {Object} object jQuery object
*/
var toolbarToFAB = function (btn) {
if (btn.attr('data-open') !== "true") {
return;
}
var offsetX, offsetY, scaleFactor;
var windowWidth = window.innerWidth;
var windowHeight = window.innerHeight;
var btnWidth = btn.attr('data-origin-width');
var btnBottom = btn.attr('data-origin-bottom');
var btnLeft = btn.attr('data-origin-left');
var anchor = btn.find('> .btn-floating').first();
var menu = btn.find('> ul').first();
var backdrop = btn.find('.fab-backdrop');
var fabColor = anchor.css('background-color');
offsetX = btnLeft - windowWidth / 2 + btnWidth / 2;
offsetY = windowHeight - btnBottom;
scaleFactor = windowWidth / backdrop.width();
// Hide backdrop
btn.removeClass('active');
btn.attr('data-open', false);
btn.css({
'background-color': 'transparent',
transition: 'none'
});
anchor.css({
transition: 'none'
});
backdrop.css({
transform: 'scale(0)',
'background-color': fabColor
});
menu.find('> li > a').css({
opacity: ''
});
setTimeout(function () {
backdrop.remove();
// Set initial state.
btn.css({
'text-align': '',
width: '',
bottom: '',
left: '',
overflow: '',
'background-color': '',
transform: 'translate3d(' + -offsetX + 'px,0,0)'
});
anchor.css({
overflow: '',
transform: 'translate3d(0,' + offsetY + 'px,0)'
});
setTimeout(function () {
btn.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s'
});
anchor.css({
transform: 'translate3d(0,0,0)',
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
});
}, 20);
}, 200);
};
})(jQuery);
;(function ($) {
// Image transition function
Materialize.fadeInImage = function (selectorOrEl) {
var element;
if (typeof selectorOrEl === 'string') {
element = $(selectorOrEl);
} else if (typeof selectorOrEl === 'object') {
element = selectorOrEl;
} else {
return;
}
element.css({ opacity: 0 });
$(element).velocity({ opacity: 1 }, {
duration: 650,
queue: false,
easing: 'easeOutSine'
});
$(element).velocity({ opacity: 1 }, {
duration: 1300,
queue: false,
easing: 'swing',
step: function (now, fx) {
fx.start = 100;
var grayscale_setting = now / 100;
var brightness_setting = 150 - (100 - now) / 1.75;
if (brightness_setting < 100) {
brightness_setting = 100;
}
if (now >= 0) {
$(this).css({
"-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)",
"filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)"
});
}
}
});
};
// Horizontal staggered list
Materialize.showStaggeredList = function (selectorOrEl) {
var element;
if (typeof selectorOrEl === 'string') {
element = $(selectorOrEl);
} else if (typeof selectorOrEl === 'object') {
element = selectorOrEl;
} else {
return;
}
var time = 0;
element.find('li').velocity({ translateX: "-100px" }, { duration: 0 });
element.find('li').each(function () {
$(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] });
time += 120;
});
};
$(document).ready(function () {
// Hardcoded .staggered-list scrollFire
// var staggeredListOptions = [];
// $('ul.staggered-list').each(function (i) {
// var label = 'scrollFire-' + i;
// $(this).addClass(label);
// staggeredListOptions.push(
// {selector: 'ul.staggered-list.' + label,
// offset: 200,
// callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
// });
// scrollFire(staggeredListOptions);
// HammerJS, Swipe navigation
// Touch Event
var swipeLeft = false;
var swipeRight = false;
// Dismissible Collections
$('.dismissable').each(function () {
$(this).hammer({
prevent_default: false
}).on('pan', function (e) {
if (e.gesture.pointerType === "touch") {
var $this = $(this);
var direction = e.gesture.direction;
var x = e.gesture.deltaX;
var velocityX = e.gesture.velocityX;
$this.velocity({ translateX: x
}, { duration: 50, queue: false, easing: 'easeOutQuad' });
// Swipe Left
if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) {
swipeLeft = true;
}
// Swipe Right
if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) {
swipeRight = true;
}
}
}).on('panend', function (e) {
// Reset if collection is moved back into original position
if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) {
swipeRight = false;
swipeLeft = false;
}
if (e.gesture.pointerType === "touch") {
var $this = $(this);
if (swipeLeft || swipeRight) {
var fullWidth;
if (swipeLeft) {
fullWidth = $this.innerWidth();
} else {
fullWidth = -1 * $this.innerWidth();
}
$this.velocity({ translateX: fullWidth
}, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () {
$this.css('border', 'none');
$this.velocity({ height: 0, padding: 0
}, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () {
$this.remove();
}
});
}
});
} else {
$this.velocity({ translateX: 0
}, { duration: 100, queue: false, easing: 'easeOutQuad' });
}
swipeLeft = false;
swipeRight = false;
}
});
});
// time = 0
// // Vertical Staggered list
// $('ul.staggered-list.vertical li').velocity(
// { translateY: "100px"},
// { duration: 0 });
// $('ul.staggered-list.vertical li').each(function() {
// $(this).velocity(
// { opacity: "1", translateY: "0"},
// { duration: 800, delay: time, easing: [60, 25] });
// time += 120;
// });
// // Fade in and Scale
// $('.fade-in.scale').velocity(
// { scaleX: .4, scaleY: .4, translateX: -600},
// { duration: 0});
// $('.fade-in').each(function() {
// $(this).velocity(
// { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
// { duration: 800, easing: [60, 10] });
// });
});
})(jQuery);
;(function ($) {
var scrollFireEventsHandled = false;
// Input: Array of JSON objects {selector, offset, callback}
Materialize.scrollFire = function (options) {
var onScroll = function () {
var windowScroll = window.pageYOffset + window.innerHeight;
for (var i = 0; i < options.length; i++) {
// Get options from each line
var value = options[i];
var selector = value.selector,
offset = value.offset,
callback = value.callback;
var currentElement = document.querySelector(selector);
if (currentElement !== null) {
var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
if (windowScroll > elementOffset + offset) {
if (value.done !== true) {
if (typeof callback === 'function') {
callback.call(this, currentElement);
} else if (typeof callback === 'string') {
var callbackFunc = new Function(callback);
callbackFunc(currentElement);
}
value.done = true;
}
}
}
}
};
var throttledScroll = Materialize.throttle(function () {
onScroll();
}, options.throttle || 100);
if (!scrollFireEventsHandled) {
window.addEventListener("scroll", throttledScroll);
window.addEventListener("resize", throttledScroll);
scrollFireEventsHandled = true;
}
// perform a scan once, after current execution context, and after dom is ready
setTimeout(throttledScroll, 0);
};
})(jQuery);
; /*!
* pickadate.js v3.5.0, 2014/04/13
* By Amsul, http://amsul.ca
* Hosted on http://amsul.github.io/pickadate.js
* Licensed under MIT
*/
(function (factory) {
Materialize.Picker = factory(jQuery);
})(function ($) {
var $window = $(window);
var $document = $(document);
var $html = $(document.documentElement);
/**
* The picker constructor that creates a blank picker.
*/
function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) {
// If theres no element, return the picker constructor.
if (!ELEMENT) return PickerConstructor;
var IS_DEFAULT_THEME = false,
// The state of the picker.
STATE = {
id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date()))
},
// Merge the defaults and options passed.
SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {},
// Merge the default classes with the settings classes.
CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass),
// The element node wrapper into a jQuery object.
$ELEMENT = $(ELEMENT),
// Pseudo picker constructor.
PickerInstance = function () {
return this.start();
},
// The picker prototype.
P = PickerInstance.prototype = {
constructor: PickerInstance,
$node: $ELEMENT,
/**
* Initialize everything
*/
start: function () {
// If its already started, do nothing.
if (STATE && STATE.start) return P;
// Update the picker states.
STATE.methods = {};
STATE.start = true;
STATE.open = false;
STATE.type = ELEMENT.type;
// Confirm focus state, convert into text input to remove UA stylings,
// and set as readonly to prevent keyboard popup.
ELEMENT.autofocus = ELEMENT == getActiveElement();
ELEMENT.readOnly = !SETTINGS.editable;
ELEMENT.id = ELEMENT.id || STATE.id;
if (ELEMENT.type != 'text') {
ELEMENT.type = 'text';
}
// Create a new picker component with the settings.
P.component = new COMPONENT(P, SETTINGS);
// Create the picker root with a holder and then prepare it.
P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"'));
prepareElementRoot();
// If theres a format for the hidden input element, create the element.
if (SETTINGS.formatSubmit) {
prepareElementHidden();
}
// Prepare the input element.
prepareElement();
// Insert the root as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root);
// Bind the default component and settings events.
P.on({
start: P.component.onStart,
render: P.component.onRender,
stop: P.component.onStop,
open: P.component.onOpen,
close: P.component.onClose,
set: P.component.onSet
}).on({
start: SETTINGS.onStart,
render: SETTINGS.onRender,
stop: SETTINGS.onStop,
open: SETTINGS.onOpen,
close: SETTINGS.onClose,
set: SETTINGS.onSet
});
// Once were all set, check the theme in use.
IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]);
// If the element has autofocus, open the picker.
if (ELEMENT.autofocus) {
P.open();
}
// Trigger queued the “start” and “render” events.
return P.trigger('start').trigger('render');
}, //start
/**
* Render a new picker
*/
render: function (entireComponent) {
// Insert a new component holder in the root or box.
if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open));
// Trigger the queued “render” events.
return P.trigger('render');
}, //render
/**
* Destroy everything
*/
stop: function () {
// If its already stopped, do nothing.
if (!STATE.start) return P;
// Then close the picker.
P.close();
// Remove the hidden field.
if (P._hidden) {
P._hidden.parentNode.removeChild(P._hidden);
}
// Remove the root.
P.$root.remove();
// Remove the input class, remove the stored data, and unbind
// the events (after a tick for IE - see `P.close`).
$ELEMENT.removeClass(CLASSES.input).removeData(NAME);
setTimeout(function () {
$ELEMENT.off('.' + STATE.id);
}, 0);
// Restore the element state
ELEMENT.type = STATE.type;
ELEMENT.readOnly = false;
// Trigger the queued “stop” events.
P.trigger('stop');
// Reset the picker states.
STATE.methods = {};
STATE.start = false;
return P;
}, //stop
/**
* Open up the picker
*/
open: function (dontGiveFocus) {
// If its already open, do nothing.
if (STATE.open) return P;
// Add the “active” class.
$ELEMENT.addClass(CLASSES.active);
aria(ELEMENT, 'expanded', true);
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So add the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Add the “opened” class to the picker root.
P.$root.addClass(CLASSES.opened);
aria(P.$root[0], 'hidden', false);
}, 0);
// If we have to give focus, bind the element and doc events.
if (dontGiveFocus !== false) {
// Set it as open.
STATE.open = true;
// Prevent the page from scrolling.
if (IS_DEFAULT_THEME) {
$html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth());
}
// Pass focus to the root elements jQuery object.
// * Workaround for iOS8 to bring the pickers root into view.
P.$root.eq(0).focus();
// Bind the document events.
$document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) {
var target = event.target;
// If the target of the event is not the element, close the picker picker.
// * Dont worry about clicks or focusins on the root because those dont bubble up.
// Also, for Firefox, a click on an `option` element bubbles up directly
// to the doc. So make sure the target wasn't the doc.
// * In Firefox stopPropagation() doesnt prevent right-click events from bubbling,
// which causes the picker to unexpectedly close when right-clicking it. So make
// sure the event wasnt a right-click.
if (target != ELEMENT && target != document && event.which != 3) {
// If the target was the holder that covers the screen,
// keep the element focused to maintain tabindex.
P.close(target === P.$root.children()[0]);
}
}).on('keydown.' + STATE.id, function (event) {
var
// Get the keycode.
keycode = event.keyCode,
// Translate that to a selection change.
keycodeToMove = P.component.key[keycode],
// Grab the target.
target = event.target;
// On escape, close the picker and give focus.
if (keycode == 27) {
P.close(true);
}
// Check if there is a key movement or “enter” keypress on the element.
else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) {
// Prevent the default action to stop page movement.
event.preventDefault();
// Trigger the key movement action.
if (keycodeToMove) {
PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]);
}
// On “enter”, if the highlighted item isnt disabled, set the value and close.
else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) {
P.set('select', P.component.item.highlight);
if (SETTINGS.closeOnSelect) {
P.close(true);
}
}
}
// If the target is within the root and “enter” is pressed,
// prevent the default action and trigger a click on the target instead.
else if ($.contains(P.$root[0], target) && keycode == 13) {
event.preventDefault();
target.click();
}
});
}
// Trigger the queued “open” events.
return P.trigger('open');
}, //open
/**
* Close the picker
*/
close: function (giveFocus) {
// If we need to give focus, do it before changing states.
if (giveFocus) {
// ....ah yes! It wouldve been incomplete without a crazy workaround for IE :|
// The focus is triggered *after* the close has completed - causing it
// to open again. So unbind and rebind the event at the next tick.
P.$root.off('focus.toOpen').eq(0).focus();
setTimeout(function () {
P.$root.on('focus.toOpen', handleFocusToOpenEvent);
}, 0);
}
// Remove the “active” class.
$ELEMENT.removeClass(CLASSES.active);
aria(ELEMENT, 'expanded', false);
// * A Firefox bug, when `html` has `overflow:hidden`, results in
// killing transitions :(. So remove the “opened” state on the next tick.
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
setTimeout(function () {
// Remove the “opened” and “focused” class from the picker root.
P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused);
aria(P.$root[0], 'hidden', true);
}, 0);
// If its already closed, do nothing more.
if (!STATE.open) return P;
// Set it as closed.
STATE.open = false;
// Allow the page to scroll.
if (IS_DEFAULT_THEME) {
$html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth());
}
// Unbind the document events.
$document.off('.' + STATE.id);
// Trigger the queued “close” events.
return P.trigger('close');
}, //close
/**
* Clear the values
*/
clear: function (options) {
return P.set('clear', null, options);
}, //clear
/**
* Set something
*/
set: function (thing, value, options) {
var thingItem,
thingValue,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {};
// Make sure we have usable options.
options = thingIsObject && $.isPlainObject(value) ? value : options || {};
if (thing) {
// If the thing isnt an object, make it one.
if (!thingIsObject) {
thingObject[thing] = value;
}
// Go through the things of items to set.
for (thingItem in thingObject) {
// Grab the value of the thing.
thingValue = thingObject[thingItem];
// First, if the item exists and theres a value, set it.
if (thingItem in P.component.item) {
if (thingValue === undefined) thingValue = null;
P.component.set(thingItem, thingValue, options);
}
// Then, check to update the element value and broadcast a change.
if (thingItem == 'select' || thingItem == 'clear') {
$ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change');
}
}
// Render a new picker.
P.render();
}
// When the method isnt muted, trigger queued “set” events and pass the `thingObject`.
return options.muted ? P : P.trigger('set', thingObject);
}, //set
/**
* Get something
*/
get: function (thing, format) {
// Make sure theres something to get.
thing = thing || 'value';
// If a picker state exists, return that.
if (STATE[thing] != null) {
return STATE[thing];
}
// Return the submission value, if that.
if (thing == 'valueSubmit') {
if (P._hidden) {
return P._hidden.value;
}
thing = 'value';
}
// Return the value, if that.
if (thing == 'value') {
return ELEMENT.value;
}
// Check if a component item exists, return that.
if (thing in P.component.item) {
if (typeof format == 'string') {
var thingValue = P.component.get(thing);
return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : '';
}
return P.component.get(thing);
}
}, //get
/**
* Bind events on the things.
*/
on: function (thing, method, internal) {
var thingName,
thingMethod,
thingIsObject = $.isPlainObject(thing),
thingObject = thingIsObject ? thing : {};
if (thing) {
// If the thing isnt an object, make it one.
if (!thingIsObject) {
thingObject[thing] = method;
}
// Go through the things to bind to.
for (thingName in thingObject) {
// Grab the method of the thing.
thingMethod = thingObject[thingName];
// If it was an internal binding, prefix it.
if (internal) {
thingName = '_' + thingName;
}
// Make sure the thing methods collection exists.
STATE.methods[thingName] = STATE.methods[thingName] || [];
// Add the method to the relative method collection.
STATE.methods[thingName].push(thingMethod);
}
}
return P;
}, //on
/**
* Unbind events on the things.
*/
off: function () {
var i,
thingName,
names = arguments;
for (i = 0, namesCount = names.length; i < namesCount; i += 1) {
thingName = names[i];
if (thingName in STATE.methods) {
delete STATE.methods[thingName];
}
}
return P;
},
/**
* Fire off method events.
*/
trigger: function (name, data) {
var _trigger = function (name) {
var methodList = STATE.methods[name];
if (methodList) {
methodList.map(function (method) {
PickerConstructor._.trigger(method, P, [data]);
});
}
};
_trigger('_' + name);
_trigger(name);
return P;
} //trigger
//PickerInstance.prototype
/**
* Wrap the picker holder components together.
*/
};function createWrappedComponent() {
// Create a picker wrapper holder
return PickerConstructor._.node('div',
// Create a picker wrapper node
PickerConstructor._.node('div',
// Create a picker frame
PickerConstructor._.node('div',
// Create a picker box node
PickerConstructor._.node('div',
// Create the components nodes.
P.component.nodes(STATE.open),
// The picker box class
CLASSES.box),
// Picker wrap class
CLASSES.wrap),
// Picker frame class
CLASSES.frame),
// Picker holder class
CLASSES.holder); //endreturn
} //createWrappedComponent
/**
* Prepare the input element with all bindings.
*/
function prepareElement() {
$ELEMENT.
// Store the picker data by component name.
data(NAME, P).
// Add the “input” class name.
addClass(CLASSES.input).
// Remove the tabindex.
attr('tabindex', -1).
// If theres a `data-value`, update the value of the element.
val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value);
// Only bind keydown events if the element isnt editable.
if (!SETTINGS.editable) {
$ELEMENT.
// On focus/click, focus onto the root to open it up.
on('focus.' + STATE.id + ' click.' + STATE.id, function (event) {
event.preventDefault();
P.$root.eq(0).focus();
}).
// Handle keyboard event based on the picker being opened or not.
on('keydown.' + STATE.id, handleKeydownEvent);
}
// Update the aria attributes.
aria(ELEMENT, {
haspopup: true,
expanded: false,
readonly: false,
owns: ELEMENT.id + '_root'
});
}
/**
* Prepare the root picker element with all bindings.
*/
function prepareElementRoot() {
P.$root.on({
// For iOS8.
keydown: handleKeydownEvent,
// When something within the root is focused, stop from bubbling
// to the doc and remove the “focused” state from the root.
focusin: function (event) {
P.$root.removeClass(CLASSES.focused);
event.stopPropagation();
},
// When something within the root holder is clicked, stop it
// from bubbling to the doc.
'mousedown click': function (event) {
var target = event.target;
// Make sure the target isnt the root holder so it can bubble up.
if (target != P.$root.children()[0]) {
event.stopPropagation();
// * For mousedown events, cancel the default action in order to
// prevent cases where focus is shifted onto external elements
// when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
// Also, for Firefox, dont prevent action on the `option` element.
if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) {
event.preventDefault();
// Re-focus onto the root so that users can click away
// from elements focused within the picker.
P.$root.eq(0).focus();
}
}
}
}).
// Add/remove the “target” class on focus and blur.
on({
focus: function () {
$ELEMENT.addClass(CLASSES.target);
},
blur: function () {
$ELEMENT.removeClass(CLASSES.target);
}
}).
// Open the picker and adjust the root “focused” state
on('focus.toOpen', handleFocusToOpenEvent).
// If theres a click on an actionable element, carry out the actions.
on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () {
var $target = $(this),
targetData = $target.data(),
targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled),
// * For IE, non-focusable elements can be active elements as well
// (http://stackoverflow.com/a/2684561).
activeElement = getActiveElement();
activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement;
// If its disabled or nothing inside is actively focused, re-focus the element.
if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) {
P.$root.eq(0).focus();
}
// If something is superficially changed, update the `highlight` based on the `nav`.
if (!targetDisabled && targetData.nav) {
P.set('highlight', P.component.item.highlight, { nav: targetData.nav });
}
// If something is picked, set `select` then close with focus.
else if (!targetDisabled && 'pick' in targetData) {
P.set('select', targetData.pick);
if (SETTINGS.closeOnSelect) {
P.close(true);
}
}
// If a “clear” button is pressed, empty the values and close with focus.
else if (targetData.clear) {
P.clear();
if (SETTINGS.closeOnSelect) {
P.close(true);
}
} else if (targetData.close) {
P.close(true);
}
}); //P.$root
aria(P.$root[0], 'hidden', true);
}
/**
* Prepare the hidden input element along with all bindings.
*/
function prepareElementHidden() {
var name;
if (SETTINGS.hiddenName === true) {
name = ELEMENT.name;
ELEMENT.name = '';
} else {
name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'];
name = name[0] + ELEMENT.name + name[1];
}
P._hidden = $('<input ' + 'type=hidden ' +
// Create the name using the original inputs with a prefix and suffix.
'name="' + name + '"' + (
// If the element has a value, set the hidden value as well.
$ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0];
$ELEMENT.
// If the value changes, update the hidden input with the correct format.
on('change.' + STATE.id, function () {
P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : '';
});
// Insert the hidden input as specified in the settings.
if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden);
}
// For iOS8.
function handleKeydownEvent(event) {
var keycode = event.keyCode,
// Check if one of the delete keys was pressed.
isKeycodeDelete = /^(8|46)$/.test(keycode);
// For some reason IE clears the input value on “escape”.
if (keycode == 27) {
P.close();
return false;
}
// Check if `space` or `delete` was pressed or the picker is closed with a key movement.
if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) {
// Prevent it from moving the page and bubbling to doc.
event.preventDefault();
event.stopPropagation();
// If `delete` was pressed, clear the values and close the picker.
// Otherwise open the picker.
if (isKeycodeDelete) {
P.clear().close();
} else {
P.open();
}
}
}
// Separated for IE
function handleFocusToOpenEvent(event) {
// Stop the event from propagating to the doc.
event.stopPropagation();
// If its a focus event, add the “focused” class to the root.
if (event.type == 'focus') {
P.$root.addClass(CLASSES.focused);
}
// And then finally open the picker.
P.open();
}
// Return a new picker instance.
return new PickerInstance();
} //PickerConstructor
/**
* The default classes and prefix to use for the HTML classes.
*/
PickerConstructor.klasses = function (prefix) {
prefix = prefix || 'picker';
return {
picker: prefix,
opened: prefix + '--opened',
focused: prefix + '--focused',
input: prefix + '__input',
active: prefix + '__input--active',
target: prefix + '__input--target',
holder: prefix + '__holder',
frame: prefix + '__frame',
wrap: prefix + '__wrap',
box: prefix + '__box'
};
}; //PickerConstructor.klasses
/**
* Check if the default theme is being used.
*/
function isUsingDefaultTheme(element) {
var theme,
prop = 'position';
// For IE.
if (element.currentStyle) {
theme = element.currentStyle[prop];
}
// For normal browsers.
else if (window.getComputedStyle) {
theme = getComputedStyle(element)[prop];
}
return theme == 'fixed';
}
/**
* Get the width of the browsers scrollbar.
* Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
*/
function getScrollbarWidth() {
if ($html.height() <= $window.height()) {
return 0;
}
var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body');
// Get the width without scrollbars.
var widthWithoutScroll = $outer[0].offsetWidth;
// Force adding scrollbars.
$outer.css('overflow', 'scroll');
// Add the inner div.
var $inner = $('<div style="width:100%" />').appendTo($outer);
// Get the width with scrollbars.
var widthWithScroll = $inner[0].offsetWidth;
// Remove the divs.
$outer.remove();
// Return the difference between the widths.
return widthWithoutScroll - widthWithScroll;
}
/**
* PickerConstructor helper methods.
*/
PickerConstructor._ = {
/**
* Create a group of nodes. Expects:
* `
{
min: {Integer},
max: {Integer},
i: {Integer},
node: {String},
item: {Function}
}
* `
*/
group: function (groupObject) {
var
// Scope for the looped object
loopObjectScope,
// Create the nodes list
nodesList = '',
// The counter starts from the `min`
counter = PickerConstructor._.trigger(groupObject.min, groupObject);
// Loop from the `min` to `max`, incrementing by `i`
for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) {
// Trigger the `item` function within scope of the object
loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]);
// Splice the subgroup and create nodes out of the sub nodes
nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node
loopObjectScope[1], // the classes
loopObjectScope[2] // the attributes
);
}
// Return the list of nodes
return nodesList;
}, //group
/**
* Create a dom node string
*/
node: function (wrapper, item, klass, attribute) {
// If the item is false-y, just return an empty string
if (!item) return '';
// If the item is an array, do a join
item = $.isArray(item) ? item.join('') : item;
// Check for the class
klass = klass ? ' class="' + klass + '"' : '';
// Check for any attributes
attribute = attribute ? ' ' + attribute : '';
// Return the wrapped item
return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>';
}, //node
/**
* Lead numbers below 10 with a zero.
*/
lead: function (number) {
return (number < 10 ? '0' : '') + number;
},
/**
* Trigger a function otherwise return the value.
*/
trigger: function (callback, scope, args) {
return typeof callback == 'function' ? callback.apply(scope, args || []) : callback;
},
/**
* If the second character is a digit, length is 2 otherwise 1.
*/
digits: function (string) {
return (/\d/.test(string[1]) ? 2 : 1
);
},
/**
* Tell if something is a date object.
*/
isDate: function (value) {
return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate());
},
/**
* Tell if something is an integer.
*/
isInteger: function (value) {
return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0;
},
/**
* Create ARIA attribute strings.
*/
ariaAttr: ariaAttr //PickerConstructor._
/**
* Extend the picker with a component and defaults.
*/
};PickerConstructor.extend = function (name, Component) {
// Extend jQuery.
$.fn[name] = function (options, action) {
// Grab the component data.
var componentData = this.data(name);
// If the picker is requested, return the data object.
if (options == 'picker') {
return componentData;
}
// If the component data exists and `options` is a string, carry out the action.
if (componentData && typeof options == 'string') {
return PickerConstructor._.trigger(componentData[options], componentData, [action]);
}
// Otherwise go through each matched element and if the component
// doesnt exist, create a new picker using `this` element
// and merging the defaults and options with a deep copy.
return this.each(function () {
var $this = $(this);
if (!$this.data(name)) {
new PickerConstructor(this, name, Component, options);
}
});
};
// Set the defaults.
$.fn[name].defaults = Component.defaults;
}; //PickerConstructor.extend
function aria(element, attribute, value) {
if ($.isPlainObject(attribute)) {
for (var key in attribute) {
ariaSet(element, key, attribute[key]);
}
} else {
ariaSet(element, attribute, value);
}
}
function ariaSet(element, attribute, value) {
element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value);
}
function ariaAttr(attribute, data) {
if (!$.isPlainObject(attribute)) {
attribute = { attribute: data };
}
data = '';
for (var key in attribute) {
var attr = (key == 'role' ? '' : 'aria-') + key,
attrVal = attribute[key];
data += attrVal == null ? '' : attr + '="' + attribute[key] + '"';
}
return data;
}
// IE8 bug throws an error for activeElements within iframes.
function getActiveElement() {
try {
return document.activeElement;
} catch (err) {}
}
// Expose the picker constructor.
return PickerConstructor;
});
; /*!
* Date picker for pickadate.js v3.5.0
* http://amsul.github.io/pickadate.js/date.htm
*/
(function (factory) {
factory(Materialize.Picker, jQuery);
})(function (Picker, $) {
/**
* Globals and constants
*/
var DAYS_IN_WEEK = 7,
WEEKS_IN_CALENDAR = 6,
_ = Picker._;
/**
* The date picker constructor
*/
function DatePicker(picker, settings) {
var calendar = this,
element = picker.$node[0],
elementValue = element.value,
elementDataValue = picker.$node.data('value'),
valueString = elementDataValue || elementValue,
formatString = elementDataValue ? settings.formatSubmit : settings.format,
isRTL = function () {
return element.currentStyle ?
// For IE.
element.currentStyle.direction == 'rtl' :
// For normal browsers.
getComputedStyle(picker.$root[0]).direction == 'rtl';
};
calendar.settings = settings;
calendar.$node = picker.$node;
// The queue of methods that will be used to build item objects.
calendar.queue = {
min: 'measure create',
max: 'measure create',
now: 'now create',
select: 'parse create validate',
highlight: 'parse navigate create validate',
view: 'parse create validate viewset',
disable: 'deactivate',
enable: 'activate'
// The component's item object.
};calendar.item = {};
calendar.item.clear = null;
calendar.item.disable = (settings.disable || []).slice(0);
calendar.item.enable = -function (collectionDisabled) {
return collectionDisabled[0] === true ? collectionDisabled.shift() : -1;
}(calendar.item.disable);
calendar.set('min', settings.min).set('max', settings.max).set('now');
// When theres a value, set the `select`, which in turn
// also sets the `highlight` and `view`.
if (valueString) {
calendar.set('select', valueString, { format: formatString });
}
// If theres no value, default to highlighting “today”.
else {
calendar.set('select', null).set('highlight', calendar.item.now);
}
// The keycode to movement mapping.
calendar.key = {
40: 7, // Down
38: -7, // Up
39: function () {
return isRTL() ? -1 : 1;
}, // Right
37: function () {
return isRTL() ? 1 : -1;
}, // Left
go: function (timeChange) {
var highlightedObject = calendar.item.highlight,
targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange);
calendar.set('highlight', targetDate, { interval: timeChange });
this.render();
}
// Bind some picker events.
};picker.on('render', function () {
picker.$root.find('.' + settings.klass.selectMonth).on('change', function () {
var value = this.value;
if (value) {
picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]);
picker.$root.find('.' + settings.klass.selectMonth).trigger('focus');
}
});
picker.$root.find('.' + settings.klass.selectYear).on('change', function () {
var value = this.value;
if (value) {
picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]);
picker.$root.find('.' + settings.klass.selectYear).trigger('focus');
}
});
}, 1).on('open', function () {
var includeToday = '';
if (calendar.disabled(calendar.get('now'))) {
includeToday = ':not(.' + settings.klass.buttonToday + ')';
}
picker.$root.find('button' + includeToday + ', select').attr('disabled', false);
}, 1).on('close', function () {
picker.$root.find('button, select').attr('disabled', true);
}, 1);
} //DatePicker
/**
* Set a datepicker item object.
*/
DatePicker.prototype.set = function (type, value, options) {
var calendar = this,
calendarItem = calendar.item;
// If the value is `null` just set it immediately.
if (value === null) {
if (type == 'clear') type = 'select';
calendarItem[type] = value;
return calendar;
}
// Otherwise go through the queue of methods, and invoke the functions.
// Update this as the time unit, and set the final value as this item.
// * In the case of `enable`, keep the queue but set `disable` instead.
// And in the case of `flip`, keep the queue but set `enable` instead.
calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) {
value = calendar[method](type, value, options);
return value;
}).pop();
// Check if we need to cascade through more updates.
if (type == 'select') {
calendar.set('highlight', calendarItem.select, options);
} else if (type == 'highlight') {
calendar.set('view', calendarItem.highlight, options);
} else if (type.match(/^(flip|min|max|disable|enable)$/)) {
if (calendarItem.select && calendar.disabled(calendarItem.select)) {
calendar.set('select', calendarItem.select, options);
}
if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) {
calendar.set('highlight', calendarItem.highlight, options);
}
}
return calendar;
}; //DatePicker.prototype.set
/**
* Get a datepicker item object.
*/
DatePicker.prototype.get = function (type) {
return this.item[type];
}; //DatePicker.prototype.get
/**
* Create a picker date object.
*/
DatePicker.prototype.create = function (type, value, options) {
var isInfiniteValue,
calendar = this;
// If theres no value, use the type as the value.
value = value === undefined ? type : value;
// If its infinity, update the value.
if (value == -Infinity || value == Infinity) {
isInfiniteValue = value;
}
// If its an object, use the native date object.
else if ($.isPlainObject(value) && _.isInteger(value.pick)) {
value = value.obj;
}
// If its an array, convert it into a date and make sure
// that its a valid date otherwise default to today.
else if ($.isArray(value)) {
value = new Date(value[0], value[1], value[2]);
value = _.isDate(value) ? value : calendar.create().obj;
}
// If its a number or date object, make a normalized date.
else if (_.isInteger(value) || _.isDate(value)) {
value = calendar.normalize(new Date(value), options);
}
// If its a literal true or any other case, set it to now.
else /*if ( value === true )*/{
value = calendar.now(type, value, options);
}
// Return the compiled object.
return {
year: isInfiniteValue || value.getFullYear(),
month: isInfiniteValue || value.getMonth(),
date: isInfiniteValue || value.getDate(),
day: isInfiniteValue || value.getDay(),
obj: isInfiniteValue || value,
pick: isInfiniteValue || value.getTime()
};
}; //DatePicker.prototype.create
/**
* Create a range limit object using an array, date object,
* literal true, or integer relative to another time.
*/
DatePicker.prototype.createRange = function (from, to) {
var calendar = this,
createDate = function (date) {
if (date === true || $.isArray(date) || _.isDate(date)) {
return calendar.create(date);
}
return date;
};
// Create objects if possible.
if (!_.isInteger(from)) {
from = createDate(from);
}
if (!_.isInteger(to)) {
to = createDate(to);
}
// Create relative dates.
if (_.isInteger(from) && $.isPlainObject(to)) {
from = [to.year, to.month, to.date + from];
} else if (_.isInteger(to) && $.isPlainObject(from)) {
to = [from.year, from.month, from.date + to];
}
return {
from: createDate(from),
to: createDate(to)
};
}; //DatePicker.prototype.createRange
/**
* Check if a date unit falls within a date range object.
*/
DatePicker.prototype.withinRange = function (range, dateUnit) {
range = this.createRange(range.from, range.to);
return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick;
};
/**
* Check if two date range objects overlap.
*/
DatePicker.prototype.overlapRanges = function (one, two) {
var calendar = this;
// Convert the ranges into comparable dates.
one = calendar.createRange(one.from, one.to);
two = calendar.createRange(two.from, two.to);
return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to);
};
/**
* Get the date today.
*/
DatePicker.prototype.now = function (type, value, options) {
value = new Date();
if (options && options.rel) {
value.setDate(value.getDate() + options.rel);
}
return this.normalize(value, options);
};
/**
* Navigate to next/prev month.
*/
DatePicker.prototype.navigate = function (type, value, options) {
var targetDateObject,
targetYear,
targetMonth,
targetDate,
isTargetArray = $.isArray(value),
isTargetObject = $.isPlainObject(value),
viewsetObject = this.item.view; /*,
safety = 100*/
if (isTargetArray || isTargetObject) {
if (isTargetObject) {
targetYear = value.year;
targetMonth = value.month;
targetDate = value.date;
} else {
targetYear = +value[0];
targetMonth = +value[1];
targetDate = +value[2];
}
// If were navigating months but the view is in a different
// month, navigate to the views year and month.
if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) {
targetYear = viewsetObject.year;
targetMonth = viewsetObject.month;
}
// Figure out the expected target year and month.
targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1);
targetYear = targetDateObject.getFullYear();
targetMonth = targetDateObject.getMonth();
// If the month were going to doesnt have enough days,
// keep decreasing the date until we reach the months last date.
while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) {
targetDate -= 1;
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
}*/
}
value = [targetYear, targetMonth, targetDate];
}
return value;
}; //DatePicker.prototype.navigate
/**
* Normalize a date by setting the hours to midnight.
*/
DatePicker.prototype.normalize = function (value /*, options*/) {
value.setHours(0, 0, 0, 0);
return value;
};
/**
* Measure the range of dates.
*/
DatePicker.prototype.measure = function (type, value /*, options*/) {
var calendar = this;
// If its anything false-y, remove the limits.
if (!value) {
value = type == 'min' ? -Infinity : Infinity;
}
// If its a string, parse it.
else if (typeof value == 'string') {
value = calendar.parse(type, value);
}
// If it's an integer, get a date relative to today.
else if (_.isInteger(value)) {
value = calendar.now(type, value, { rel: value });
}
return value;
}; ///DatePicker.prototype.measure
/**
* Create a viewset object based on navigation.
*/
DatePicker.prototype.viewset = function (type, dateObject /*, options*/) {
return this.create([dateObject.year, dateObject.month, 1]);
};
/**
* Validate a date as enabled and shift if needed.
*/
DatePicker.prototype.validate = function (type, dateObject, options) {
var calendar = this,
// Keep a reference to the original date.
originalDateObject = dateObject,
// Make sure we have an interval.
interval = options && options.interval ? options.interval : 1,
// Check if the calendar enabled dates are inverted.
isFlippedBase = calendar.item.enable === -1,
// Check if we have any enabled dates after/before now.
hasEnabledBeforeTarget,
hasEnabledAfterTarget,
// The min & max limits.
minLimitObject = calendar.item.min,
maxLimitObject = calendar.item.max,
// Check if weve reached the limit during shifting.
reachedMin,
reachedMax,
// Check if the calendar is inverted and at least one weekday is enabled.
hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) {
// If theres a date, check where it is relative to the target.
if ($.isArray(value)) {
var dateTime = calendar.create(value).pick;
if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true;
}
// Return only integers for enabled weekdays.
return _.isInteger(value);
}).length; /*,
safety = 100*/
// Cases to validate for:
// [1] Not inverted and date disabled.
// [2] Inverted and some dates enabled.
// [3] Not inverted and out of range.
//
// Cases to **not** validate for:
// • Navigating months.
// • Not inverted and date enabled.
// • Inverted and all dates disabled.
// • ..and anything else.
if (!options || !options.nav) if (
/* 1 */!isFlippedBase && calendar.disabled(dateObject) ||
/* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) ||
/* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) {
// When inverted, flip the direction if there arent any enabled weekdays
// and there are no enabled dates in the direction of the interval.
if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) {
interval *= -1;
}
// Keep looping until we reach an enabled date.
while ( /*safety &&*/calendar.disabled(dateObject)) {
/*safety -= 1
if ( !safety ) {
throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
}*/
// If weve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) {
dateObject = originalDateObject;
interval = interval > 0 ? 1 : -1;
}
// If weve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
if (dateObject.pick <= minLimitObject.pick) {
reachedMin = true;
interval = 1;
dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]);
} else if (dateObject.pick >= maxLimitObject.pick) {
reachedMax = true;
interval = -1;
dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]);
}
// If weve reached both limits, just break out of the loop.
if (reachedMin && reachedMax) {
break;
}
// Finally, create the shifted date using the interval and keep looping.
dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]);
}
} //endif
// Return the date object settled on.
return dateObject;
}; //DatePicker.prototype.validate
/**
* Check if a date is disabled.
*/
DatePicker.prototype.disabled = function (dateToVerify) {
var calendar = this,
// Filter through the disabled dates to check if this is one.
isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) {
// If the date is a number, match the weekday with 0index and `firstDay` check.
if (_.isInteger(dateToDisable)) {
return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7;
}
// If its an array or a native JS date, create and match the exact date.
if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) {
return dateToVerify.pick === calendar.create(dateToDisable).pick;
}
// If its an object, match a date within the “from” and “to” range.
if ($.isPlainObject(dateToDisable)) {
return calendar.withinRange(dateToDisable, dateToVerify);
}
});
// If this date matches a disabled date, confirm its not inverted.
isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) {
return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted;
}).length;
// Check the calendar “enabled” flag and respectively flip the
// disabled state. Then also check if its beyond the min/max limits.
return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick;
}; //DatePicker.prototype.disabled
/**
* Parse a string into a usable type.
*/
DatePicker.prototype.parse = function (type, value, options) {
var calendar = this,
parsingObject = {};
// If its already parsed, were good.
if (!value || typeof value != 'string') {
return value;
}
// We need a `.format` to parse the value with.
if (!(options && options.format)) {
options = options || {};
options.format = calendar.settings.format;
}
// Convert the format into an array and then map through it.
calendar.formats.toArray(options.format).map(function (label) {
var
// Grab the formatting label.
formattingLabel = calendar.formats[label],
// The format length is from the formatting label function or the
// label length without the escaping exclamation (!) mark.
formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length;
// If there's a format label, split the value up to the format length.
// Then add it to the parsing object with appropriate label.
if (formattingLabel) {
parsingObject[label] = value.substr(0, formatLength);
}
// Update the value as the substring from format length to end.
value = value.substr(formatLength);
});
// Compensate for month 0index.
return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d];
}; //DatePicker.prototype.parse
/**
* Various formats to display the object in.
*/
DatePicker.prototype.formats = function () {
// Return the length of the first word in a collection.
function getWordLengthFromCollection(string, collection, dateObject) {
// Grab the first word from the string.
var word = string.match(/\w+/)[0];
// If there's no month index, add it to the date object
if (!dateObject.mm && !dateObject.m) {
dateObject.m = collection.indexOf(word) + 1;
}
// Return the length of the word.
return word.length;
}
// Get the length of the first word in a string.
function getFirstWordLength(string) {
return string.match(/\w+/)[0].length;
}
return {
d: function (string, dateObject) {
// If there's string, then get the digits length.
// Otherwise return the selected date.
return string ? _.digits(string) : dateObject.date;
},
dd: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected date with a leading zero.
return string ? 2 : _.lead(dateObject.date);
},
ddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the short selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day];
},
dddd: function (string, dateObject) {
// If there's a string, then get the length of the first word.
// Otherwise return the full selected weekday.
return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day];
},
m: function (string, dateObject) {
// If there's a string, then get the length of the digits
// Otherwise return the selected month with 0index compensation.
return string ? _.digits(string) : dateObject.month + 1;
},
mm: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected month with 0index and leading zero.
return string ? 2 : _.lead(dateObject.month + 1);
},
mmm: function (string, dateObject) {
var collection = this.settings.monthsShort;
// If there's a string, get length of the relevant month from the short
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
},
mmmm: function (string, dateObject) {
var collection = this.settings.monthsFull;
// If there's a string, get length of the relevant month from the full
// months collection. Otherwise return the selected month from that collection.
return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month];
},
yy: function (string, dateObject) {
// If there's a string, then the length is always 2.
// Otherwise return the selected year by slicing out the first 2 digits.
return string ? 2 : ('' + dateObject.year).slice(2);
},
yyyy: function (string, dateObject) {
// If there's a string, then the length is always 4.
// Otherwise return the selected year.
return string ? 4 : dateObject.year;
},
// Create an array by splitting the formatting string passed.
toArray: function (formatString) {
return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g);
},
// Format an object into a string using the formatting options.
toString: function (formatString, itemObject) {
var calendar = this;
return calendar.formats.toArray(formatString).map(function (label) {
return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, '');
}).join('');
}
};
}(); //DatePicker.prototype.formats
/**
* Check if two date units are the exact.
*/
DatePicker.prototype.isDateExact = function (one, two) {
var calendar = this;
// When were working with weekdays, do a direct comparison.
if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') {
return one === two;
}
// When were working with date representations, compare the “pick” value.
if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) {
return calendar.create(one).pick === calendar.create(two).pick;
}
// When were working with range objects, compare the “from” and “to”.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to);
}
return false;
};
/**
* Check if two date units overlap.
*/
DatePicker.prototype.isDateOverlap = function (one, two) {
var calendar = this,
firstDay = calendar.settings.firstDay ? 1 : 0;
// When were working with a weekday index, compare the days.
if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) {
one = one % 7 + firstDay;
return one === calendar.create(two).day + 1;
}
if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) {
two = two % 7 + firstDay;
return two === calendar.create(one).day + 1;
}
// When were working with range objects, check if the ranges overlap.
if ($.isPlainObject(one) && $.isPlainObject(two)) {
return calendar.overlapRanges(one, two);
}
return false;
};
/**
* Flip the enabled state.
*/
DatePicker.prototype.flipEnable = function (val) {
var itemObject = this.item;
itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1);
};
/**
* Mark a collection of dates as disabled.
*/
DatePicker.prototype.deactivate = function (type, datesToDisable) {
var calendar = this,
disabledItems = calendar.item.disable.slice(0);
// If were flipping, thats all we need to do.
if (datesToDisable == 'flip') {
calendar.flipEnable();
} else if (datesToDisable === false) {
calendar.flipEnable(1);
disabledItems = [];
} else if (datesToDisable === true) {
calendar.flipEnable(-1);
disabledItems = [];
}
// Otherwise go through the dates to disable.
else {
datesToDisable.map(function (unitToDisable) {
var matchFound;
// When we have disabled items, check for matches.
// If something is matched, immediately break out.
for (var index = 0; index < disabledItems.length; index += 1) {
if (calendar.isDateExact(unitToDisable, disabledItems[index])) {
matchFound = true;
break;
}
}
// If nothing was found, add the validated unit to the collection.
if (!matchFound) {
if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) {
disabledItems.push(unitToDisable);
}
}
});
}
// Return the updated collection.
return disabledItems;
}; //DatePicker.prototype.deactivate
/**
* Mark a collection of dates as enabled.
*/
DatePicker.prototype.activate = function (type, datesToEnable) {
var calendar = this,
disabledItems = calendar.item.disable,
disabledItemsCount = disabledItems.length;
// If were flipping, thats all we need to do.
if (datesToEnable == 'flip') {
calendar.flipEnable();
} else if (datesToEnable === true) {
calendar.flipEnable(1);
disabledItems = [];
} else if (datesToEnable === false) {
calendar.flipEnable(-1);
disabledItems = [];
}
// Otherwise go through the disabled dates.
else {
datesToEnable.map(function (unitToEnable) {
var matchFound, disabledUnit, index, isExactRange;
// Go through the disabled items and try to find a match.
for (index = 0; index < disabledItemsCount; index += 1) {
disabledUnit = disabledItems[index];
// When an exact match is found, remove it from the collection.
if (calendar.isDateExact(disabledUnit, unitToEnable)) {
matchFound = disabledItems[index] = null;
isExactRange = true;
break;
}
// When an overlapped match is found, add the “inverted” state to it.
else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) {
if ($.isPlainObject(unitToEnable)) {
unitToEnable.inverted = true;
matchFound = unitToEnable;
} else if ($.isArray(unitToEnable)) {
matchFound = unitToEnable;
if (!matchFound[3]) matchFound.push('inverted');
} else if (_.isDate(unitToEnable)) {
matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted'];
}
break;
}
}
// If a match was found, remove a previous duplicate entry.
if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateExact(disabledItems[index], unitToEnable)) {
disabledItems[index] = null;
break;
}
}
// In the event that were dealing with an exact range of dates,
// make sure there are no “inverted” dates because of it.
if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) {
if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) {
disabledItems[index] = null;
break;
}
}
// If something is still matched, add it into the collection.
if (matchFound) {
disabledItems.push(matchFound);
}
});
}
// Return the updated collection.
return disabledItems.filter(function (val) {
return val != null;
});
}; //DatePicker.prototype.activate
/**
* Create a string for the nodes in the picker.
*/
DatePicker.prototype.nodes = function (isOpen) {
var calendar = this,
settings = calendar.settings,
calendarItem = calendar.item,
nowObject = calendarItem.now,
selectedObject = calendarItem.select,
highlightedObject = calendarItem.highlight,
viewsetObject = calendarItem.view,
disabledCollection = calendarItem.disable,
minLimitObject = calendarItem.min,
maxLimitObject = calendarItem.max,
// Create the calendar table head using a copy of weekday labels collection.
// * We do a copy so we don't mutate the original array.
tableHead = function (collection, fullCollection) {
// If the first day should be Monday, move Sunday to the end.
if (settings.firstDay) {
collection.push(collection.shift());
fullCollection.push(fullCollection.shift());
}
// Create and return the table head group.
return _.node('thead', _.node('tr', _.group({
min: 0,
max: DAYS_IN_WEEK - 1,
i: 1,
node: 'th',
item: function (counter) {
return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"'];
}
}))); //endreturn
// Materialize modified
}((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)),
//tableHead
// Create the nav for next/prev month.
createMonthNav = function (next) {
// Otherwise, return the created month tag.
return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + (
// If the focused month is outside the range, disabled the button.
next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({
role: 'button',
controls: calendar.$node[0].id + '_table'
}) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn
},
//createMonthNav
// Create the month label.
//Materialize modified
createMonthLabel = function (override) {
var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull;
// Materialize modified
if (override == "short_months") {
monthsCollection = settings.monthsShort;
}
// If there are months to select, add a dropdown menu.
if (settings.selectMonths && override == undefined) {
return _.node('select', _.group({
min: 0,
max: 11,
i: 1,
node: 'option',
item: function (loopedMonth) {
return [
// The looped month and no classes.
monthsCollection[loopedMonth], 0,
// Set the value and selected index.
'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')];
}
}), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"');
}
// Materialize modified
if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month];
// If there's a need for a month selector
return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month);
},
//createMonthLabel
// Create the year label.
// Materialize modified
createYearLabel = function (override) {
var focusedYear = viewsetObject.year,
// If years selector is set to a literal "true", set it to 5. Otherwise
// divide in half to get half before and half after focused year.
numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2);
// If there are years to select, add a dropdown menu.
if (numberYears) {
var minYear = minLimitObject.year,
maxYear = maxLimitObject.year,
lowestYear = focusedYear - numberYears,
highestYear = focusedYear + numberYears;
// If the min year is greater than the lowest year, increase the highest year
// by the difference and set the lowest year to the min year.
if (minYear > lowestYear) {
highestYear += minYear - lowestYear;
lowestYear = minYear;
}
// If the max year is less than the highest year, decrease the lowest year
// by the lower of the two: available and needed years. Then set the
// highest year to the max year.
if (maxYear < highestYear) {
var availableYears = lowestYear - minYear,
neededYears = highestYear - maxYear;
lowestYear -= availableYears > neededYears ? neededYears : availableYears;
highestYear = maxYear;
}
if (settings.selectYears && override == undefined) {
return _.node('select', _.group({
min: lowestYear,
max: highestYear,
i: 1,
node: 'option',
item: function (loopedYear) {
return [
// The looped year and no classes.
loopedYear, 0,
// Set the value and selected index.
'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')];
}
}), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"');
}
}
// Materialize modified
if (override === 'raw' && selectedObject != null) {
return _.node('div', selectedObject.year);
}
// Otherwise just return the year focused
return _.node('div', focusedYear, settings.klass.year);
}; //createYearLabel
// Materialize modified
createDayLabel = function () {
if (selectedObject != null) return selectedObject.date;else return nowObject.date;
};
createWeekdayLabel = function () {
var display_day;
if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day;
var weekday = settings.weekdaysShort[display_day];
return weekday;
};
// Create and return the entire calendar.
return _.node(
// Date presentation View
'div', _.node(
// Div for Year
'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node(
// Div for short Month
'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node(
// Div for Day
'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) +
// Calendar container
_.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({
min: 0,
max: WEEKS_IN_CALENDAR - 1,
i: 1,
node: 'tr',
item: function (rowCounter) {
// If Monday is the first day and the month starts on Sunday, shift the date back a week.
var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0;
return [_.group({
min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
max: function () {
return this.min + DAYS_IN_WEEK - 1;
},
i: 1,
node: 'td',
item: function (targetDate) {
// Convert the time date from a relative date to a target date.
targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]);
var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]);
return [_.node('div', targetDate.date, function (klasses) {
// Add the `infocus` or `outfocus` classes based on month in view.
klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus);
// Add the `today` class if needed.
if (nowObject.pick == targetDate.pick) {
klasses.push(settings.klass.now);
}
// Add the `selected` class if something's selected and the time matches.
if (isSelected) {
klasses.push(settings.klass.selected);
}
// Add the `highlighted` class if something's highlighted and the time matches.
if (isHighlighted) {
klasses.push(settings.klass.highlighted);
}
// Add the `disabled` class if something's disabled and the object matches.
if (isDisabled) {
klasses.push(settings.klass.disabled);
}
return klasses.join(' ');
}([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
role: 'gridcell',
label: formattedDate,
selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
activedescendant: isHighlighted ? true : null,
disabled: isDisabled ? true : null
}) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn
}
})]; //endreturn
}
})), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
role: 'grid',
controls: calendar.$node[0].id,
readonly: true
})), settings.klass.calendar_container) // end calendar
+
// * For Firefox forms to submit, make sure to set the buttons `type` attributes as “button”.
_.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn
}; //DatePicker.prototype.nodes
/**
* The date picker defaults.
*/
DatePicker.defaults = function (prefix) {
return {
// The title label to use for the month nav buttons
labelMonthNext: 'Next month',
labelMonthPrev: 'Previous month',
// The title label to use for the dropdown selectors
labelMonthSelect: 'Select a month',
labelYearSelect: 'Select a year',
// Months and weekdays
monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'],
monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
// Materialize modified
weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'],
// Today and clear
today: 'Today',
clear: 'Clear',
close: 'Ok',
// Picker close behavior (Prevent a change in behaviour for backwards compatibility)
closeOnSelect: false,
// The format to show on the `input` element
format: 'd mmmm, yyyy',
// Classes
klass: {
table: prefix + 'table',
header: prefix + 'header',
// Materialize Added klasses
date_display: prefix + 'date-display',
day_display: prefix + 'day-display',
month_display: prefix + 'month-display',
year_display: prefix + 'year-display',
calendar_container: prefix + 'calendar-container',
// end
navPrev: prefix + 'nav--prev',
navNext: prefix + 'nav--next',
navDisabled: prefix + 'nav--disabled',
month: prefix + 'month',
year: prefix + 'year',
selectMonth: prefix + 'select--month',
selectYear: prefix + 'select--year',
weekdays: prefix + 'weekday',
day: prefix + 'day',
disabled: prefix + 'day--disabled',
selected: prefix + 'day--selected',
highlighted: prefix + 'day--highlighted',
now: prefix + 'day--today',
infocus: prefix + 'day--infocus',
outfocus: prefix + 'day--outfocus',
footer: prefix + 'footer',
buttonClear: prefix + 'button--clear',
buttonToday: prefix + 'button--today',
buttonClose: prefix + 'button--close'
}
};
}(Picker.klasses().picker + '__');
/**
* Extend the picker to add the date picker.
*/
Picker.extend('pickadate', DatePicker);
});
; /*!
* ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
* Copyright 2014 Wang Shenwei.
* Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
*
* Further modified
* Copyright 2015 Ching Yaw Hao.
*/
(function ($) {
var $win = $(window),
$doc = $(document);
// Can I use inline svg ?
var svgNS = 'http://www.w3.org/2000/svg',
svgSupported = 'SVGAngle' in window && function () {
var supported,
el = document.createElement('div');
el.innerHTML = '<svg/>';
supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
el.innerHTML = '';
return supported;
}();
// Can I use transition ?
var transitionSupported = function () {
var style = document.createElement('div').style;
return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style;
}();
// Listen touch events in touch screen device, instead of mouse events in desktop.
var touchSupported = 'ontouchstart' in window,
mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''),
mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''),
mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : '');
// Vibrate the device if supported
var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
function createSvgElement(name) {
return document.createElementNS(svgNS, name);
}
function leadingZero(num) {
return (num < 10 ? '0' : '') + num;
}
// Get a unique id
var idCounter = 0;
function uniqueId(prefix) {
var id = ++idCounter + '';
return prefix ? prefix + id : id;
}
// Clock size
var dialRadius = 135,
outerRadius = 105,
// innerRadius = 80 on 12 hour clock
innerRadius = 70,
tickRadius = 20,
diameter = dialRadius * 2,
duration = transitionSupported ? 350 : 1;
// Popover template
var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join('');
// ClockPicker
function ClockPicker(element, options) {
var popover = $(tpl),
plate = popover.find('.clockpicker-plate'),
holder = popover.find('.picker__holder'),
hoursView = popover.find('.clockpicker-hours'),
minutesView = popover.find('.clockpicker-minutes'),
amPmBlock = popover.find('.clockpicker-am-pm-block'),
isInput = element.prop('tagName') === 'INPUT',
input = isInput ? element : element.find('input'),
label = $("label[for=" + input.attr("id") + "]"),
self = this;
this.id = uniqueId('cp');
this.element = element;
this.holder = holder;
this.options = options;
this.isAppended = false;
this.isShown = false;
this.currentView = 'hours';
this.isInput = isInput;
this.input = input;
this.label = label;
this.popover = popover;
this.plate = plate;
this.hoursView = hoursView;
this.minutesView = minutesView;
this.amPmBlock = amPmBlock;
this.spanHours = popover.find('.clockpicker-span-hours');
this.spanMinutes = popover.find('.clockpicker-span-minutes');
this.spanAmPm = popover.find('.clockpicker-span-am-pm');
this.footer = popover.find('.picker__footer');
this.amOrPm = "PM";
// Setup for for 12 hour clock if option is selected
if (options.twelvehour) {
if (!options.ampmclickable) {
this.spanAmPm.empty();
$('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
$('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
} else {
this.spanAmPm.empty();
$('<div id="click-am">AM</div>').on("click", function () {
self.spanAmPm.children('#click-am').addClass("text-primary");
self.spanAmPm.children('#click-pm').removeClass("text-primary");
self.amOrPm = "AM";
}).appendTo(this.spanAmPm);
$('<div id="click-pm">PM</div>').on("click", function () {
self.spanAmPm.children('#click-pm').addClass("text-primary");
self.spanAmPm.children('#click-am').removeClass("text-primary");
self.amOrPm = 'PM';
}).appendTo(this.spanAmPm);
}
}
// Add buttons to footer
$('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
$('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
// Show or toggle
input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
// Build ticks
var tickTpl = $('<div class="clockpicker-tick"></div>'),
i,
tick,
radian,
radius;
// Hours view
if (options.twelvehour) {
for (i = 1; i < 13; i += 1) {
tick = tickTpl.clone();
radian = i / 6 * Math.PI;
radius = outerRadius;
tick.css({
left: dialRadius + Math.sin(radian) * radius - tickRadius,
top: dialRadius - Math.cos(radian) * radius - tickRadius
});
tick.html(i === 0 ? '00' : i);
hoursView.append(tick);
tick.on(mousedownEvent, mousedown);
}
} else {
for (i = 0; i < 24; i += 1) {
tick = tickTpl.clone();
radian = i / 6 * Math.PI;
var inner = i > 0 && i < 13;
radius = inner ? innerRadius : outerRadius;
tick.css({
left: dialRadius + Math.sin(radian) * radius - tickRadius,
top: dialRadius - Math.cos(radian) * radius - tickRadius
});
tick.html(i === 0 ? '00' : i);
hoursView.append(tick);
tick.on(mousedownEvent, mousedown);
}
}
// Minutes view
for (i = 0; i < 60; i += 5) {
tick = tickTpl.clone();
radian = i / 30 * Math.PI;
tick.css({
left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
});
tick.html(leadingZero(i));
minutesView.append(tick);
tick.on(mousedownEvent, mousedown);
}
// Clicking on minutes view space
plate.on(mousedownEvent, function (e) {
if ($(e.target).closest('.clockpicker-tick').length === 0) {
mousedown(e, true);
}
});
// Mousedown or touchstart
function mousedown(e, space) {
var offset = plate.offset(),
isTouch = /^touch/.test(e.type),
x0 = offset.left + dialRadius,
y0 = offset.top + dialRadius,
dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
z = Math.sqrt(dx * dx + dy * dy),
moved = false;
// When clicking on minutes view space, check the mouse position
if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
return;
}
e.preventDefault();
// Set cursor style of body after 200ms
var movingTimer = setTimeout(function () {
self.popover.addClass('clockpicker-moving');
}, 200);
// Clock
self.setHand(dx, dy, !space, true);
// Mousemove on document
$doc.off(mousemoveEvent).on(mousemoveEvent, function (e) {
e.preventDefault();
var isTouch = /^touch/.test(e.type),
x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
if (!moved && x === dx && y === dy) {
// Clicking in chrome on windows will trigger a mousemove event
return;
}
moved = true;
self.setHand(x, y, false, true);
});
// Mouseup on document
$doc.off(mouseupEvent).on(mouseupEvent, function (e) {
$doc.off(mouseupEvent);
e.preventDefault();
var isTouch = /^touch/.test(e.type),
x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
if ((space || moved) && x === dx && y === dy) {
self.setHand(x, y);
}
if (self.currentView === 'hours') {
self.toggleView('minutes', duration / 2);
} else if (options.autoclose) {
self.minutesView.addClass('clockpicker-dial-out');
setTimeout(function () {
self.done();
}, duration / 2);
}
plate.prepend(canvas);
// Reset cursor style of body
clearTimeout(movingTimer);
self.popover.removeClass('clockpicker-moving');
// Unbind mousemove event
$doc.off(mousemoveEvent);
});
}
if (svgSupported) {
// Draw clock hands and others
var canvas = popover.find('.clockpicker-canvas'),
svg = createSvgElement('svg');
svg.setAttribute('class', 'clockpicker-svg');
svg.setAttribute('width', diameter);
svg.setAttribute('height', diameter);
var g = createSvgElement('g');
g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
var bearing = createSvgElement('circle');
bearing.setAttribute('class', 'clockpicker-canvas-bearing');
bearing.setAttribute('cx', 0);
bearing.setAttribute('cy', 0);
bearing.setAttribute('r', 4);
var hand = createSvgElement('line');
hand.setAttribute('x1', 0);
hand.setAttribute('y1', 0);
var bg = createSvgElement('circle');
bg.setAttribute('class', 'clockpicker-canvas-bg');
bg.setAttribute('r', tickRadius);
g.appendChild(hand);
g.appendChild(bg);
g.appendChild(bearing);
svg.appendChild(g);
canvas.append(svg);
this.hand = hand;
this.bg = bg;
this.bearing = bearing;
this.g = g;
this.canvas = canvas;
}
raiseCallback(this.options.init);
}
function raiseCallback(callbackFunction) {
if (callbackFunction && typeof callbackFunction === "function") callbackFunction();
}
// Default options
ClockPicker.DEFAULTS = {
'default': '', // default time, 'now' or '13:14' e.g.
fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
donetext: 'Ok', // done button text
cleartext: 'Clear',
canceltext: 'Cancel',
autoclose: false, // auto close when minute is selected
ampmclickable: true, // set am/pm button on itself
darktheme: false, // set to dark theme
twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
vibrate: true // vibrate the device when dragging clock hand
};
// Show or hide popover
ClockPicker.prototype.toggle = function () {
this[this.isShown ? 'hide' : 'show']();
};
// Set popover position
ClockPicker.prototype.locate = function () {
var element = this.element,
popover = this.popover,
offset = element.offset(),
width = element.outerWidth(),
height = element.outerHeight(),
align = this.options.align,
self = this;
popover.show();
};
// Show popover
ClockPicker.prototype.show = function (e) {
// Not show again
if (this.isShown) {
return;
}
raiseCallback(this.options.beforeShow);
$(':input').each(function () {
$(this).attr('tabindex', -1);
});
var self = this;
// Initialize
this.input.blur();
this.popover.addClass('picker--opened');
this.input.addClass('picker__input picker__input--active');
$(document.body).css('overflow', 'hidden');
// Get the time
var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
if (value[1].indexOf("AM") > 0) {
this.amOrPm = 'AM';
} else {
this.amOrPm = 'PM';
}
value[1] = value[1].replace("AM", "").replace("PM", "");
}
if (value[0] === 'now') {
var now = new Date(+new Date() + this.options.fromnow);
value = [now.getHours(), now.getMinutes()];
if (this.options.twelvehour) {
this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
}
}
this.hours = +value[0] || 0;
this.minutes = +value[1] || 0;
this.spanHours.html(this.hours);
this.spanMinutes.html(leadingZero(this.minutes));
if (!this.isAppended) {
// Append popover to input by default
var containerEl = document.querySelector(this.options.container);
if (this.options.container && containerEl) {
containerEl.appendChild(this.popover[0]);
} else {
this.popover.insertAfter(this.input);
}
if (this.options.twelvehour) {
if (this.amOrPm === 'PM') {
this.spanAmPm.children('#click-pm').addClass("text-primary");
this.spanAmPm.children('#click-am').removeClass("text-primary");
} else {
this.spanAmPm.children('#click-am').addClass("text-primary");
this.spanAmPm.children('#click-pm').removeClass("text-primary");
}
}
// Reset position when resize
$win.on('resize.clockpicker' + this.id, function () {
if (self.isShown) {
self.locate();
}
});
this.isAppended = true;
}
// Toggle to hours view
this.toggleView('hours');
// Set position
this.locate();
this.isShown = true;
// Hide when clicking or tabbing on any element except the clock and input
$doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) {
var target = $(e.target);
if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
self.hide();
}
});
// Hide when ESC is pressed
$doc.on('keyup.clockpicker.' + this.id, function (e) {
if (e.keyCode === 27) {
self.hide();
}
});
raiseCallback(this.options.afterShow);
};
// Hide popover
ClockPicker.prototype.hide = function () {
raiseCallback(this.options.beforeHide);
this.input.removeClass('picker__input picker__input--active');
this.popover.removeClass('picker--opened');
$(document.body).css('overflow', 'visible');
this.isShown = false;
$(':input').each(function (index) {
$(this).attr('tabindex', index + 1);
});
// Unbinding events on document
$doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
$doc.off('keyup.clockpicker.' + this.id);
this.popover.hide();
raiseCallback(this.options.afterHide);
};
// Toggle to hours or minutes view
ClockPicker.prototype.toggleView = function (view, delay) {
var raiseAfterHourSelect = false;
if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
raiseCallback(this.options.beforeHourSelect);
raiseAfterHourSelect = true;
}
var isHours = view === 'hours',
nextView = isHours ? this.hoursView : this.minutesView,
hideView = isHours ? this.minutesView : this.hoursView;
this.currentView = view;
this.spanHours.toggleClass('text-primary', isHours);
this.spanMinutes.toggleClass('text-primary', !isHours);
// Let's make transitions
hideView.addClass('clockpicker-dial-out');
nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
// Reset clock hand
this.resetClock(delay);
// After transitions ended
clearTimeout(this.toggleViewTimer);
this.toggleViewTimer = setTimeout(function () {
hideView.css('visibility', 'hidden');
}, duration);
if (raiseAfterHourSelect) {
raiseCallback(this.options.afterHourSelect);
}
};
// Reset clock hand
ClockPicker.prototype.resetClock = function (delay) {
var view = this.currentView,
value = this[view],
isHours = view === 'hours',
unit = Math.PI / (isHours ? 6 : 30),
radian = value * unit,
radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
x = Math.sin(radian) * radius,
y = -Math.cos(radian) * radius,
self = this;
if (svgSupported && delay) {
self.canvas.addClass('clockpicker-canvas-out');
setTimeout(function () {
self.canvas.removeClass('clockpicker-canvas-out');
self.setHand(x, y);
}, delay);
} else this.setHand(x, y);
};
// Set clock hand to (x, y)
ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) {
var radian = Math.atan2(x, -y),
isHours = this.currentView === 'hours',
unit = Math.PI / (isHours || roundBy5 ? 6 : 30),
z = Math.sqrt(x * x + y * y),
options = this.options,
inner = isHours && z < (outerRadius + innerRadius) / 2,
radius = inner ? innerRadius : outerRadius,
value;
if (options.twelvehour) {
radius = outerRadius;
}
// Radian should in range [0, 2PI]
if (radian < 0) {
radian = Math.PI * 2 + radian;
}
// Get the round value
value = Math.round(radian / unit);
// Get the round radian
radian = value * unit;
// Correct the hours or minutes
if (options.twelvehour) {
if (isHours) {
if (value === 0) value = 12;
} else {
if (roundBy5) value *= 5;
if (value === 60) value = 0;
}
} else {
if (isHours) {
if (value === 12) value = 0;
value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12;
} else {
if (roundBy5) value *= 5;
if (value === 60) value = 0;
}
}
// Once hours or minutes changed, vibrate the device
if (this[this.currentView] !== value) {
if (vibrate && this.options.vibrate) {
// Do not vibrate too frequently
if (!this.vibrateTimer) {
navigator[vibrate](10);
this.vibrateTimer = setTimeout($.proxy(function () {
this.vibrateTimer = null;
}, this), 100);
}
}
}
this[this.currentView] = value;
if (isHours) {
this['spanHours'].html(value);
} else {
this['spanMinutes'].html(leadingZero(value));
}
// If svg is not supported, just add an active class to the tick
if (!svgSupported) {
this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () {
var tick = $(this);
tick.toggleClass('active', value === +tick.html());
});
return;
}
// Set clock hand and others' position
var cx1 = Math.sin(radian) * (radius - tickRadius),
cy1 = -Math.cos(radian) * (radius - tickRadius),
cx2 = Math.sin(radian) * radius,
cy2 = -Math.cos(radian) * radius;
this.hand.setAttribute('x2', cx1);
this.hand.setAttribute('y2', cy1);
this.bg.setAttribute('cx', cx2);
this.bg.setAttribute('cy', cy2);
};
// Hours and minutes are selected
ClockPicker.prototype.done = function () {
raiseCallback(this.options.beforeDone);
this.hide();
this.label.addClass('active');
var last = this.input.prop('value'),
value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
if (this.options.twelvehour) {
value = value + this.amOrPm;
}
this.input.prop('value', value);
if (value !== last) {
this.input.triggerHandler('change');
if (!this.isInput) {
this.element.trigger('change');
}
}
if (this.options.autoclose) this.input.trigger('blur');
raiseCallback(this.options.afterDone);
};
// Clear input field
ClockPicker.prototype.clear = function () {
this.hide();
this.label.removeClass('active');
var last = this.input.prop('value'),
value = '';
this.input.prop('value', value);
if (value !== last) {
this.input.triggerHandler('change');
if (!this.isInput) {
this.element.trigger('change');
}
}
if (this.options.autoclose) {
this.input.trigger('blur');
}
};
// Remove clockpicker from input
ClockPicker.prototype.remove = function () {
this.element.removeData('clockpicker');
this.input.off('focus.clockpicker click.clockpicker');
if (this.isShown) {
this.hide();
}
if (this.isAppended) {
$win.off('resize.clockpicker' + this.id);
this.popover.remove();
}
};
// Extends $.fn.clockpicker
$.fn.pickatime = function (option) {
var args = Array.prototype.slice.call(arguments, 1);
return this.each(function () {
var $this = $(this),
data = $this.data('clockpicker');
if (!data) {
var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
$this.data('clockpicker', new ClockPicker($this, options));
} else {
// Manual operatsions. show, hide, remove, e.g.
if (typeof data[option] === 'function') {
data[option].apply(data, args);
}
}
});
};
})(jQuery);
;(function ($) {
$.fn.characterCounter = function () {
return this.each(function () {
var $input = $(this);
var $counterElement = $input.parent().find('span[class="character-counter"]');
// character counter has already been added appended to the parent container
if ($counterElement.length) {
return;
}
var itHasLengthAttribute = $input.attr('data-length') !== undefined;
if (itHasLengthAttribute) {
$input.on('input', updateCounter);
$input.on('focus', updateCounter);
$input.on('blur', removeCounterElement);
addCounterElement($input);
}
});
};
function updateCounter() {
var maxLength = +$(this).attr('data-length'),
actualLength = +$(this).val().length,
isValidLength = actualLength <= maxLength;
$(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength);
addInputStyle(isValidLength, $(this));
}
function addCounterElement($input) {
var $counterElement = $input.parent().find('span[class="character-counter"]');
if ($counterElement.length) {
return;
}
$counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1);
$input.parent().append($counterElement);
}
function removeCounterElement() {
$(this).parent().find('span[class="character-counter"]').html('');
}
function addInputStyle(isValidLength, $input) {
var inputHasInvalidClass = $input.hasClass('invalid');
if (isValidLength && inputHasInvalidClass) {
$input.removeClass('invalid');
} else if (!isValidLength && !inputHasInvalidClass) {
$input.removeClass('valid');
$input.addClass('invalid');
}
}
$(document).ready(function () {
$('input, textarea').characterCounter();
});
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
var defaults = {
duration: 200, // ms
dist: -100, // zoom scale TODO: make this more intuitive as an option
shift: 0, // spacing for center image
padding: 0, // Padding between non center items
fullWidth: false, // Change to full width styles
indicators: false, // Toggle indicators
noWrap: false, // Don't wrap around and cycle through items.
onCycleTo: null // Callback for when a new slide is cycled to.
};
options = $.extend(defaults, options);
var namespace = Materialize.objectSelectorString($(this));
return this.each(function (i) {
var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged;
var $indicators = $('<ul class="indicators"></ul>');
var scrollingTimeout = null;
var oneTimeCallback = null;
// Initialize
var view = $(this);
var hasMultipleSlides = view.find('.carousel-item').length > 1;
var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides;
var uniqueNamespace = view.attr('data-namespace') || namespace + i;
view.attr('data-namespace', uniqueNamespace);
// Options
var setCarouselHeight = function (imageOnly) {
var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
var firstImage = firstSlide.find('img').first();
if (firstImage.length) {
if (firstImage[0].complete) {
// If image won't trigger the load event
var imageHeight = firstImage.height();
if (imageHeight > 0) {
view.css('height', firstImage.height());
} else {
// If image still has no height, use the natural dimensions to calculate
var naturalWidth = firstImage[0].naturalWidth;
var naturalHeight = firstImage[0].naturalHeight;
var adjustedHeight = view.width() / naturalWidth * naturalHeight;
view.css('height', adjustedHeight);
}
} else {
// Get height when image is loaded normally
firstImage.on('load', function () {
view.css('height', $(this).height());
});
}
} else if (!imageOnly) {
var slideHeight = firstSlide.height();
view.css('height', slideHeight);
}
};
if (options.fullWidth) {
options.dist = 0;
setCarouselHeight();
// Offset fixed items when indicators.
if (showIndicators) {
view.find('.carousel-fixed-item').addClass('with-indicators');
}
}
// Don't double initialize.
if (view.hasClass('initialized')) {
// Recalculate variables
$(window).trigger('resize');
// Redraw carousel.
view.trigger('carouselNext', [0.000001]);
return true;
}
view.addClass('initialized');
pressed = false;
offset = target = 0;
images = [];
item_width = view.find('.carousel-item').first().innerWidth();
item_height = view.find('.carousel-item').first().innerHeight();
dim = item_width * 2 + options.padding;
view.find('.carousel-item').each(function (i) {
images.push($(this)[0]);
if (showIndicators) {
var $indicator = $('<li class="indicator-item"></li>');
// Add active to first by default.
if (i === 0) {
$indicator.addClass('active');
}
// Handle clicks on indicators.
$indicator.click(function (e) {
e.stopPropagation();
var index = $(this).index();
cycleTo(index);
});
$indicators.append($indicator);
}
});
if (showIndicators) {
view.append($indicators);
}
count = images.length;
function setupEvents() {
if (typeof window.ontouchstart !== 'undefined') {
view.on('touchstart.carousel', tap);
view.on('touchmove.carousel', drag);
view.on('touchend.carousel', release);
}
view.on('mousedown.carousel', tap);
view.on('mousemove.carousel', drag);
view.on('mouseup.carousel', release);
view.on('mouseleave.carousel', release);
view.on('click.carousel', click);
}
function xpos(e) {
// touch event
if (e.targetTouches && e.targetTouches.length >= 1) {
return e.targetTouches[0].clientX;
}
// mouse event
return e.clientX;
}
function ypos(e) {
// touch event
if (e.targetTouches && e.targetTouches.length >= 1) {
return e.targetTouches[0].clientY;
}
// mouse event
return e.clientY;
}
function wrap(x) {
return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x;
}
function scroll(x) {
// Track scrolling state
scrolling = true;
if (!view.hasClass('scrolling')) {
view.addClass('scrolling');
}
if (scrollingTimeout != null) {
window.clearTimeout(scrollingTimeout);
}
scrollingTimeout = window.setTimeout(function () {
scrolling = false;
view.removeClass('scrolling');
}, options.duration);
// Start actual scroll
var i, half, delta, dir, tween, el, alignment, xTranslation;
var lastCenter = center;
offset = typeof x === 'number' ? x : offset;
center = Math.floor((offset + dim / 2) / dim);
delta = offset - center * dim;
dir = delta < 0 ? 1 : -1;
tween = -dir * delta * 2 / dim;
half = count >> 1;
if (!options.fullWidth) {
alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
} else {
alignment = 'translateX(0)';
}
// Set indicator active
if (showIndicators) {
var diff = center % count;
var activeIndicator = $indicators.find('.indicator-item.active');
if (activeIndicator.index() !== diff) {
activeIndicator.removeClass('active');
$indicators.find('.indicator-item').eq(diff).addClass('active');
}
}
// center
// Don't show wrapped items.
if (!noWrap || center >= 0 && center < count) {
el = images[wrap(center)];
// Add active class to center item.
if (!$(el).hasClass('active')) {
view.find('.carousel-item').removeClass('active');
$(el).addClass('active');
}
el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
el.style.zIndex = 0;
if (options.fullWidth) {
tweenedOpacity = 1;
} else {
tweenedOpacity = 1 - 0.2 * tween;
}
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
for (i = 1; i <= half; ++i) {
// right side
if (options.fullWidth) {
zTranslation = options.dist;
tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1;
} else {
zTranslation = options.dist * (i * 2 + tween * dir);
tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
}
// Don't show wrapped items.
if (!noWrap || center + i < count) {
el = images[wrap(center + i)];
el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
el.style.zIndex = -i;
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
// left side
if (options.fullWidth) {
zTranslation = options.dist;
tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1;
} else {
zTranslation = options.dist * (i * 2 - tween * dir);
tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
}
// Don't show wrapped items.
if (!noWrap || center - i >= 0) {
el = images[wrap(center - i)];
el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)';
el.style.zIndex = -i;
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
}
// center
// Don't show wrapped items.
if (!noWrap || center >= 0 && center < count) {
el = images[wrap(center)];
el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)';
el.style.zIndex = 0;
if (options.fullWidth) {
tweenedOpacity = 1;
} else {
tweenedOpacity = 1 - 0.2 * tween;
}
el.style.opacity = tweenedOpacity;
el.style.display = 'block';
}
// onCycleTo callback
if (lastCenter !== center && typeof options.onCycleTo === "function") {
var $curr_item = view.find('.carousel-item').eq(wrap(center));
options.onCycleTo.call(this, $curr_item, dragged);
}
// One time callback
if (typeof oneTimeCallback === "function") {
oneTimeCallback.call(this, $curr_item, dragged);
oneTimeCallback = null;
}
}
function track() {
var now, elapsed, delta, v;
now = Date.now();
elapsed = now - timestamp;
timestamp = now;
delta = offset - frame;
frame = offset;
v = 1000 * delta / (1 + elapsed);
velocity = 0.8 * v + 0.2 * velocity;
}
function autoScroll() {
var elapsed, delta;
if (amplitude) {
elapsed = Date.now() - timestamp;
delta = amplitude * Math.exp(-elapsed / options.duration);
if (delta > 2 || delta < -2) {
scroll(target - delta);
requestAnimationFrame(autoScroll);
} else {
scroll(target);
}
}
}
function click(e) {
// Disable clicks if carousel was dragged.
if (dragged) {
e.preventDefault();
e.stopPropagation();
return false;
} else if (!options.fullWidth) {
var clickedIndex = $(e.target).closest('.carousel-item').index();
var diff = wrap(center) - clickedIndex;
// Disable clicks if carousel was shifted by click
if (diff !== 0) {
e.preventDefault();
e.stopPropagation();
}
cycleTo(clickedIndex);
}
}
function cycleTo(n) {
var diff = center % count - n;
// Account for wraparound.
if (!noWrap) {
if (diff < 0) {
if (Math.abs(diff + count) < Math.abs(diff)) {
diff += count;
}
} else if (diff > 0) {
if (Math.abs(diff - count) < diff) {
diff -= count;
}
}
}
// Call prev or next accordingly.
if (diff < 0) {
view.trigger('carouselNext', [Math.abs(diff)]);
} else if (diff > 0) {
view.trigger('carouselPrev', [diff]);
}
}
function tap(e) {
// Fixes firefox draggable image bug
if (e.type === 'mousedown' && $(e.target).is('img')) {
e.preventDefault();
}
pressed = true;
dragged = false;
vertical_dragged = false;
reference = xpos(e);
referenceY = ypos(e);
velocity = amplitude = 0;
frame = offset;
timestamp = Date.now();
clearInterval(ticker);
ticker = setInterval(track, 100);
}
function drag(e) {
var x, delta, deltaY;
if (pressed) {
x = xpos(e);
y = ypos(e);
delta = reference - x;
deltaY = Math.abs(referenceY - y);
if (deltaY < 30 && !vertical_dragged) {
// If vertical scrolling don't allow dragging.
if (delta > 2 || delta < -2) {
dragged = true;
reference = x;
scroll(offset + delta);
}
} else if (dragged) {
// If dragging don't allow vertical scroll.
e.preventDefault();
e.stopPropagation();
return false;
} else {
// Vertical scrolling.
vertical_dragged = true;
}
}
if (dragged) {
// If dragging don't allow vertical scroll.
e.preventDefault();
e.stopPropagation();
return false;
}
}
function release(e) {
if (pressed) {
pressed = false;
} else {
return;
}
clearInterval(ticker);
target = offset;
if (velocity > 10 || velocity < -10) {
amplitude = 0.9 * velocity;
target = offset + amplitude;
}
target = Math.round(target / dim) * dim;
// No wrap of items.
if (noWrap) {
if (target >= dim * (count - 1)) {
target = dim * (count - 1);
} else if (target < 0) {
target = 0;
}
}
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
if (dragged) {
e.preventDefault();
e.stopPropagation();
}
return false;
}
xform = 'transform';
['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
var e = prefix + 'Transform';
if (typeof document.body.style[e] !== 'undefined') {
xform = e;
return false;
}
return true;
});
var throttledResize = Materialize.throttle(function () {
if (options.fullWidth) {
item_width = view.find('.carousel-item').first().innerWidth();
var imageHeight = view.find('.carousel-item.active').height();
dim = item_width * 2 + options.padding;
offset = center * 2 * item_width;
target = offset;
setCarouselHeight(true);
} else {
scroll();
}
}, 200);
$(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize);
setupEvents();
scroll(offset);
$(this).on('carouselNext', function (e, n, callback) {
if (n === undefined) {
n = 1;
}
if (typeof callback === "function") {
oneTimeCallback = callback;
}
target = dim * Math.round(offset / dim) + dim * n;
if (offset !== target) {
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
}
});
$(this).on('carouselPrev', function (e, n, callback) {
if (n === undefined) {
n = 1;
}
if (typeof callback === "function") {
oneTimeCallback = callback;
}
target = dim * Math.round(offset / dim) - dim * n;
if (offset !== target) {
amplitude = target - offset;
timestamp = Date.now();
requestAnimationFrame(autoScroll);
}
});
$(this).on('carouselSet', function (e, n, callback) {
if (n === undefined) {
n = 0;
}
if (typeof callback === "function") {
oneTimeCallback = callback;
}
cycleTo(n);
});
});
},
next: function (n, callback) {
$(this).trigger('carouselNext', [n, callback]);
},
prev: function (n, callback) {
$(this).trigger('carouselPrev', [n, callback]);
},
set: function (n, callback) {
$(this).trigger('carouselSet', [n, callback]);
},
destroy: function () {
var uniqueNamespace = $(this).attr('data-namespace');
$(this).removeAttr('data-namespace');
$(this).removeClass('initialized');
$(this).find('.indicators').remove();
// Remove event handlers
$(this).off('carouselNext carouselPrev carouselSet');
$(window).off('resize.carousel-' + uniqueNamespace);
if (typeof window.ontouchstart !== 'undefined') {
$(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
}
$(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
}
};
$.fn.carousel = function (methodOrOptions) {
if (methods[methodOrOptions]) {
return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1));
} else if (typeof methodOrOptions === 'object' || !methodOrOptions) {
// Default to "init"
return methods.init.apply(this, arguments);
} else {
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel');
}
}; // Plugin end
})(jQuery);
;(function ($) {
var methods = {
init: function (options) {
return this.each(function () {
var origin = $('#' + $(this).attr('data-activates'));
var screen = $('body');
// Creating tap target
var tapTargetEl = $(this);
var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
// Creating wrapper
if (!tapTargetWrapper.length) {
tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
}
// Creating content
if (!tapTargetContentEl.length) {
tapTargetContentEl = $('<div class="tap-target-content"></div>');
tapTargetEl.append(tapTargetContentEl);
}
// Creating foreground wave
if (!tapTargetWave.length) {
tapTargetWave = $('<div class="tap-target-wave"></div>');
// Creating origin
if (!tapTargetOriginEl.length) {
tapTargetOriginEl = origin.clone(true, true);
tapTargetOriginEl.addClass('tap-target-origin');
tapTargetOriginEl.removeAttr('id');
tapTargetOriginEl.removeAttr('style');
tapTargetWave.append(tapTargetOriginEl);
}
tapTargetWrapper.append(tapTargetWave);
}
// Open
var openTapTarget = function () {
if (tapTargetWrapper.is('.open')) {
return;
}
// Adding open class
tapTargetWrapper.addClass('open');
setTimeout(function () {
tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) {
closeTapTarget();
tapTargetOriginEl.off('click.tapTarget');
});
$(document).off('click.tapTarget').on('click.tapTarget', function (e) {
closeTapTarget();
$(document).off('click.tapTarget');
});
var throttledCalc = Materialize.throttle(function () {
calculateTapTarget();
}, 200);
$(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
}, 0);
};
// Close
var closeTapTarget = function () {
if (!tapTargetWrapper.is('.open')) {
return;
}
tapTargetWrapper.removeClass('open');
tapTargetOriginEl.off('click.tapTarget');
$(document).off('click.tapTarget');
$(window).off('resize.tapTarget');
};
// Pre calculate
var calculateTapTarget = function () {
// Element or parent is fixed position?
var isFixed = origin.css('position') === 'fixed';
if (!isFixed) {
var parents = origin.parents();
for (var i = 0; i < parents.length; i++) {
isFixed = $(parents[i]).css('position') == 'fixed';
if (isFixed) {
break;
}
}
}
// Calculating origin
var originWidth = origin.outerWidth();
var originHeight = origin.outerHeight();
var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
// Calculating screen
var windowWidth = $(window).width();
var windowHeight = $(window).height();
var centerX = windowWidth / 2;
var centerY = windowHeight / 2;
var isLeft = originLeft <= centerX;
var isRight = originLeft > centerX;
var isTop = originTop <= centerY;
var isBottom = originTop > centerY;
var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75;
var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75;
// Calculating tap target
var tapTargetWidth = tapTargetEl.outerWidth();
var tapTargetHeight = tapTargetEl.outerHeight();
var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2;
var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2;
var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
// Calculating content
var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth;
var tapTargetTextHeight = tapTargetHeight / 2;
var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0;
var tapTargetTextBottom = 0;
var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0;
var tapTargetTextRight = 0;
var tapTargetTextPadding = originWidth;
var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
// Calculating wave
var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2;
var tapTargetWaveHeight = tapTargetWaveWidth;
var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2;
var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2;
// Setting tap target
var tapTargetWrapperCssObj = {};
tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
tapTargetWrapperCssObj.position = tapTargetPosition;
tapTargetWrapper.css(tapTargetWrapperCssObj);
// Setting content
tapTargetContentEl.css({
width: tapTargetTextWidth,
height: tapTargetTextHeight,
top: tapTargetTextTop,
right: tapTargetTextRight,
bottom: tapTargetTextBottom,
left: tapTargetTextLeft,
padding: tapTargetTextPadding,
verticalAlign: tapTargetTextAlign
});
// Setting wave
tapTargetWave.css({
top: tapTargetWaveTop,
left: tapTargetWaveLeft,
width: tapTargetWaveWidth,
height: tapTargetWaveHeight
});
};
if (options == 'open') {
calculateTapTarget();
openTapTarget();
}
if (options == 'close') closeTapTarget();
});
},
open: function () {},
close: function () {}
};
$.fn.tapTarget = function (methodOrOptions) {
if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments);
$.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target');
};
})(jQuery);